Difference between revisions of "PWY-6519"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-19151 CPD-19151] == * smiles: ** CCCCCCC=CCC(O)CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP...")
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-6519 PWY-6519] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2 TAX-2] *...")
 
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Pathway]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-19151 CPD-19151] ==
+
== Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-6519 PWY-6519] ==
−
* smiles:
+
* taxonomic range:
−
** CCCCCCC=CCC(O)CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]
+
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2 TAX-2]
−
* inchi key:
+
−
** InChIKey=AYORDFMYYBNSBO-QCCSJADRSA-J
+
 
* common name:
 
* common name:
−
** (S)-3-hydroxy-(5Z)-dodecenoyl-CoA
+
** 8-amino-7-oxononanoate biosynthesis I
−
* molecular weight:
+
−
** 959.791   
+
 
* Synonym(s):
 
* Synonym(s):
−
** (S)-3-hydroxy-12:1-Δ5-CoA
+
** 7-keto-8-aminopelargonate biosynthesis I
−
** (S)-3-hydroxy-5-cis-dodecenoyl-CoA
+
  
−
== Reaction(s) known to consume the compound ==
+
== Reaction(s) found ==
−
* [[RXN-17798]]
+
'''7''' reactions found over '''11''' reactions in the full pathway
−
== Reaction(s) known to produce the compound ==
+
* [[RXN-11474]]
−
* [[RXN-17797]]
+
** 4 associated gene(s):
−
== Reaction(s) of unknown directionality ==
+
*** [[Ec-12_000650]]
 +
*** [[Ec-12_000640]]
 +
*** [[Ec-27_003480]]
 +
*** [[Ec-27_002090]]
 +
** 1 reconstruction source(s) associated:
 +
*** [[annotation-esiliculosus_genome]]
 +
* [[RXN-11476]]
 +
** 1 associated gene(s):
 +
*** [[Ec-01_007100]]
 +
** 1 reconstruction source(s) associated:
 +
*** [[annotation-esiliculosus_genome]]
 +
* [[RXN-11478]]
 +
** 1 associated gene(s):
 +
*** [[Ec-27_002470]]
 +
** 1 reconstruction source(s) associated:
 +
*** [[annotation-esiliculosus_genome]]
 +
* [[RXN-11479]]
 +
** 4 associated gene(s):
 +
*** [[Ec-12_000650]]
 +
*** [[Ec-27_003480]]
 +
*** [[Ec-27_002090]]
 +
*** [[Ec-12_000640]]
 +
** 1 reconstruction source(s) associated:
 +
*** [[annotation-esiliculosus_genome]]
 +
* [[RXN-11480]]
 +
** 1 associated gene(s):
 +
*** [[Ec-01_007100]]
 +
** 1 reconstruction source(s) associated:
 +
*** [[annotation-esiliculosus_genome]]
 +
* [[RXN-11482]]
 +
** 1 associated gene(s):
 +
*** [[Ec-27_002470]]
 +
** 1 reconstruction source(s) associated:
 +
*** [[annotation-esiliculosus_genome]]
 +
* [[RXN-11484]]
 +
** 1 associated gene(s):
 +
*** [[Ec-04_002200]]
 +
** 1 reconstruction source(s) associated:
 +
*** [[annotation-esiliculosus_genome]]
 +
== Reaction(s) not found ==
 +
* [http://metacyc.org/META/NEW-IMAGE?object=RXN-11475 RXN-11475]
 +
* [http://metacyc.org/META/NEW-IMAGE?object=RXN-11477 RXN-11477]
 +
* [http://metacyc.org/META/NEW-IMAGE?object=RXN-11481 RXN-11481]
 +
* [http://metacyc.org/META/NEW-IMAGE?object=RXN-11483 RXN-11483]
 
== External links  ==
 
== External links  ==
−
{{#set: smiles=CCCCCCC=CCC(O)CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]}}
+
* ECOCYC:
−
{{#set: inchi key=InChIKey=AYORDFMYYBNSBO-QCCSJADRSA-J}}
+
** [http://metacyc.org/ECOLI/NEW-IMAGE?object=PWY-6519 PWY-6519]
−
{{#set: common name=(S)-3-hydroxy-(5Z)-dodecenoyl-CoA}}
+
{{#set: taxonomic range=TAX-2}}
−
{{#set: molecular weight=959.791    }}
+
{{#set: common name=8-amino-7-oxononanoate biosynthesis I}}
−
{{#set: common name=(S)-3-hydroxy-12:1-Δ5-CoA|(S)-3-hydroxy-5-cis-dodecenoyl-CoA}}
+
{{#set: common name=7-keto-8-aminopelargonate biosynthesis I}}
−
{{#set: consumed by=RXN-17798}}
+
{{#set: reaction found=7}}
−
{{#set: produced by=RXN-17797}}
+
{{#set: total reaction=11}}
 +
{{#set: completion rate=64.0}}

Latest revision as of 19:27, 21 March 2018

Pathway PWY-6519

  • taxonomic range:
  • common name:
    • 8-amino-7-oxononanoate biosynthesis I
  • Synonym(s):
    • 7-keto-8-aminopelargonate biosynthesis I

Reaction(s) found

7 reactions found over 11 reactions in the full pathway

Reaction(s) not found

External links




Retrieved from "http://gem-aureme.irisa.fr/ectogem/index.php?title=PWY-6519&oldid=27052"