Difference between revisions of "PWY-5686"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-474 CPD-474] == * smiles: ** C1(C=C(O)C(O)=CC=1C2(OC3(C=C([O-])C=C(O)C(C(=O)C(O)2)=3))) * i...") |
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-5686 PWY-5686] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2157 TAX-21...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Pathway]] |
− | == | + | == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-5686 PWY-5686] == |
− | * | + | * taxonomic range: |
− | ** | + | ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2157 TAX-2157] |
− | * | + | ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2759 TAX-2759] |
− | ** | + | ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2 TAX-2] |
* common name: | * common name: | ||
− | ** | + | ** UMP biosynthesis |
− | + | ||
− | + | ||
* Synonym(s): | * Synonym(s): | ||
− | ** | + | ** uridine-5'-phosphate biosynthesis |
− | ** | + | ** de novo biosynthesis of uridine-5'-phosphate |
− | ** | + | ** de novo biosynthesis of uridine-5'-monophosphate |
− | == Reaction(s) | + | == Reaction(s) found == |
− | * [[RXN- | + | '''6''' reactions found over '''6''' reactions in the full pathway |
− | * [[RXN- | + | * [[ASPCARBTRANS-RXN]] |
− | + | ** 2 associated gene(s): | |
− | * [[RXN- | + | *** [[Ec-00_004630]] |
− | == Reaction(s) | + | *** [[Ec-07_003480]] |
+ | ** 2 reconstruction source(s) associated: | ||
+ | *** [[annotation-esiliculosus_genome]] | ||
+ | *** [[orthology-aragem]] | ||
+ | * [[CARBPSYN-RXN]] | ||
+ | ** 1 associated gene(s): | ||
+ | *** [[Ec-10_006110]] | ||
+ | ** 1 reconstruction source(s) associated: | ||
+ | *** [[annotation-esiliculosus_genome]] | ||
+ | * [[DIHYDROOROT-RXN]] | ||
+ | ** 0 associated gene: | ||
+ | ** 1 reconstruction source(s) associated: | ||
+ | *** [[annotation-esiliculosus_genome]] | ||
+ | * [[OROPRIBTRANS-RXN]] | ||
+ | ** 1 associated gene(s): | ||
+ | *** [[Ec-23_000110]] | ||
+ | ** 2 reconstruction source(s) associated: | ||
+ | *** [[annotation-esiliculosus_genome]] | ||
+ | *** [[orthology-aragem]] | ||
+ | * [[OROTPDECARB-RXN]] | ||
+ | ** 1 associated gene(s): | ||
+ | *** [[Ec-23_000110]] | ||
+ | ** 2 reconstruction source(s) associated: | ||
+ | *** [[annotation-esiliculosus_genome]] | ||
+ | *** [[orthology-aragem]] | ||
+ | * [[RXN0-6491]] | ||
+ | ** 1 associated gene(s): | ||
+ | *** [[Ec-27_005670]] | ||
+ | ** 1 reconstruction source(s) associated: | ||
+ | *** [[annotation-esiliculosus_genome]] | ||
+ | == Reaction(s) not found == | ||
== External links == | == External links == | ||
− | * | + | * ECOCYC: |
− | + | ** [http://metacyc.org/ECOLI/NEW-IMAGE?object=PWY-5686 PWY-5686] | |
− | ** [http:// | + | {{#set: taxonomic range=TAX-2157}} |
− | + | {{#set: taxonomic range=TAX-2759}} | |
− | + | {{#set: taxonomic range=TAX-2}} | |
− | + | {{#set: common name=UMP biosynthesis}} | |
− | + | {{#set: common name=uridine-5'-phosphate biosynthesis|de novo biosynthesis of uridine-5'-phosphate|de novo biosynthesis of uridine-5'-monophosphate}} | |
− | {{#set: | + | {{#set: reaction found=6}} |
− | {{#set: | + | {{#set: total reaction=6}} |
− | {{#set: | + | {{#set: completion rate=100.0}} |
− | {{#set: | + | |
− | {{#set: common name= | + | |
− | {{#set: | + | |
− | {{#set: | + |
Latest revision as of 19:28, 21 March 2018
Pathway PWY-5686
- taxonomic range:
- common name:
- UMP biosynthesis
- Synonym(s):
- uridine-5'-phosphate biosynthesis
- de novo biosynthesis of uridine-5'-phosphate
- de novo biosynthesis of uridine-5'-monophosphate
Reaction(s) found
6 reactions found over 6 reactions in the full pathway
- ASPCARBTRANS-RXN
- 2 associated gene(s):
- 2 reconstruction source(s) associated:
- CARBPSYN-RXN
- 1 associated gene(s):
- 1 reconstruction source(s) associated:
- DIHYDROOROT-RXN
- 0 associated gene:
- 1 reconstruction source(s) associated:
- OROPRIBTRANS-RXN
- 1 associated gene(s):
- 2 reconstruction source(s) associated:
- OROTPDECARB-RXN
- 1 associated gene(s):
- 2 reconstruction source(s) associated:
- RXN0-6491
- 1 associated gene(s):
- 1 reconstruction source(s) associated:
Reaction(s) not found
External links
- ECOCYC: