Difference between revisions of "PWY-5686"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-474 CPD-474] == * smiles: ** C1(C=C(O)C(O)=CC=1C2(OC3(C=C([O-])C=C(O)C(C(=O)C(O)2)=3))) * i...")
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-5686 PWY-5686] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2157 TAX-21...")
 
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Pathway]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-474 CPD-474] ==
+
== Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-5686 PWY-5686] ==
−
* smiles:
+
* taxonomic range:
−
** C1(C=C(O)C(O)=CC=1C2(OC3(C=C([O-])C=C(O)C(C(=O)C(O)2)=3)))
+
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2157 TAX-2157]
−
* inchi key:
+
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2759 TAX-2759]
−
** InChIKey=CXQWRCVTCMQVQX-LSDHHAIUSA-M
+
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2 TAX-2]
 
* common name:
 
* common name:
−
** (+)-taxifolin
+
** UMP biosynthesis
−
* molecular weight:
+
−
** 303.248   
+
 
* Synonym(s):
 
* Synonym(s):
−
** trans dihydroquercetin
+
** uridine-5'-phosphate biosynthesis
−
** (+)-dihydroquercetin
+
** de novo biosynthesis of uridine-5'-phosphate
−
** taxifolin
+
** de novo biosynthesis of uridine-5'-monophosphate
  
−
== Reaction(s) known to consume the compound ==
+
== Reaction(s) found ==
−
* [[RXN-527]]
+
'''6''' reactions found over '''6''' reactions in the full pathway
−
* [[RXN-600]]
+
* [[ASPCARBTRANS-RXN]]
−
== Reaction(s) known to produce the compound ==
+
** 2 associated gene(s):
−
* [[RXN-7775]]
+
*** [[Ec-00_004630]]
−
== Reaction(s) of unknown directionality ==
+
*** [[Ec-07_003480]]
 +
** 2 reconstruction source(s) associated:
 +
*** [[annotation-esiliculosus_genome]]
 +
*** [[orthology-aragem]]
 +
* [[CARBPSYN-RXN]]
 +
** 1 associated gene(s):
 +
*** [[Ec-10_006110]]
 +
** 1 reconstruction source(s) associated:
 +
*** [[annotation-esiliculosus_genome]]
 +
* [[DIHYDROOROT-RXN]]
 +
** 0 associated gene:
 +
** 1 reconstruction source(s) associated:
 +
*** [[annotation-esiliculosus_genome]]
 +
* [[OROPRIBTRANS-RXN]]
 +
** 1 associated gene(s):
 +
*** [[Ec-23_000110]]
 +
** 2 reconstruction source(s) associated:
 +
*** [[annotation-esiliculosus_genome]]
 +
*** [[orthology-aragem]]
 +
* [[OROTPDECARB-RXN]]
 +
** 1 associated gene(s):
 +
*** [[Ec-23_000110]]
 +
** 2 reconstruction source(s) associated:
 +
*** [[annotation-esiliculosus_genome]]
 +
*** [[orthology-aragem]]
 +
* [[RXN0-6491]]
 +
** 1 associated gene(s):
 +
*** [[Ec-27_005670]]
 +
** 1 reconstruction source(s) associated:
 +
*** [[annotation-esiliculosus_genome]]
 +
== Reaction(s) not found ==
 
== External links  ==
 
== External links  ==
−
* CAS : 480-18-2
+
* ECOCYC:
−
* PUBCHEM:
+
** [http://metacyc.org/ECOLI/NEW-IMAGE?object=PWY-5686 PWY-5686]
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25244891 25244891]
+
{{#set: taxonomic range=TAX-2157}}
−
* CHEBI:
+
{{#set: taxonomic range=TAX-2759}}
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=58329 58329]
+
{{#set: taxonomic range=TAX-2}}
−
* LIGAND-CPD:
+
{{#set: common name=UMP biosynthesis}}
−
** [http://www.genome.jp/dbget-bin/www_bget?C01617 C01617]
+
{{#set: common name=uridine-5'-phosphate biosynthesis|de novo biosynthesis of uridine-5'-phosphate|de novo biosynthesis of uridine-5'-monophosphate}}
−
{{#set: smiles=C1(C=C(O)C(O)=CC=1C2(OC3(C=C([O-])C=C(O)C(C(=O)C(O)2)=3)))}}
+
{{#set: reaction found=6}}
−
{{#set: inchi key=InChIKey=CXQWRCVTCMQVQX-LSDHHAIUSA-M}}
+
{{#set: total reaction=6}}
−
{{#set: common name=(+)-taxifolin}}
+
{{#set: completion rate=100.0}}
−
{{#set: molecular weight=303.248    }}
+
−
{{#set: common name=trans dihydroquercetin|(+)-dihydroquercetin|taxifolin}}
+
−
{{#set: consumed by=RXN-527|RXN-600}}
+
−
{{#set: produced by=RXN-7775}}
+

Latest revision as of 19:28, 21 March 2018

Pathway PWY-5686

  • taxonomic range:
  • common name:
    • UMP biosynthesis
  • Synonym(s):
    • uridine-5'-phosphate biosynthesis
    • de novo biosynthesis of uridine-5'-phosphate
    • de novo biosynthesis of uridine-5'-monophosphate

Reaction(s) found

6 reactions found over 6 reactions in the full pathway

Reaction(s) not found

External links





Retrieved from "http://gem-aureme.irisa.fr/ectogem/index.php?title=PWY-5686&oldid=27100"