Difference between revisions of "SHIKIMATE"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=GDPRHAMSYN-PWY GDPRHAMSYN-PWY] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?object=TAX...")
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=SHIKIMATE SHIKIMATE] == * smiles: ** C1(=C(CC(C(O)C(O)1)O)C(=O)[O-]) * inchi key: ** InChIKey=J...")
 
Line 1: Line 1:
−
[[Category:Pathway]]
+
[[Category:Metabolite]]
−
== Pathway [http://metacyc.org/META/NEW-IMAGE?object=GDPRHAMSYN-PWY GDPRHAMSYN-PWY] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=SHIKIMATE SHIKIMATE] ==
−
* taxonomic range:
+
* smiles:
−
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-1239 TAX-1239]
+
** C1(=C(CC(C(O)C(O)1)O)C(=O)[O-])
−
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-1224 TAX-1224]
+
* inchi key:
 +
** InChIKey=JXOHGGNKMLTUBP-HSUXUTPPSA-M
 
* common name:
 
* common name:
−
** GDP-D-rhamnose biosynthesis
+
** shikimate
 +
* molecular weight:
 +
** 173.145   
 
* Synonym(s):
 
* Synonym(s):
−
** GDP-α-D-rhamnose biosynthesis
+
** shikimic acid
 +
** (3R,4S,5R)--3,4,5-trihydroxycyclohex-1-ene-1-carboxylate
  
−
== Reaction(s) found ==
+
== Reaction(s) known to consume the compound ==
−
'''1''' reactions found over '''2''' reactions in the full pathway
+
* [[RXN-7968]]
−
* [[GDPMANDEHYDRA-RXN]]
+
== Reaction(s) known to produce the compound ==
−
** 2 associated gene(s):
+
* [[SHIKIMATE-5-DEHYDROGENASE-RXN]]
−
*** [[Ec-28_003400]]
+
== Reaction(s) of unknown directionality ==
−
*** [[Ec-11_005510]]
+
* [[SHIKIMATE-KINASE-RXN]]
−
** 2 reconstruction source(s) associated:
+
−
*** [[annotation-esiliculosus_genome]]
+
−
*** [[orthology-aragem]]
+
−
== Reaction(s) not found ==
+
−
* [http://metacyc.org/META/NEW-IMAGE?object=GDP-4-DEHYDRO-D-RHAMNOSE-REDUCTASE-RXN GDP-4-DEHYDRO-D-RHAMNOSE-REDUCTASE-RXN]
+
 
== External links  ==
 
== External links  ==
−
{{#set: taxonomic range=TAX-1239}}
+
* CAS : 138-59-0
−
{{#set: taxonomic range=TAX-1224}}
+
* PUBCHEM:
−
{{#set: common name=GDP-D-rhamnose biosynthesis}}
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=7057976 7057976]
−
{{#set: common name=GDP-α-D-rhamnose biosynthesis}}
+
* HMDB : HMDB03070
−
{{#set: reaction found=1}}
+
* LIGAND-CPD:
−
{{#set: total reaction=2}}
+
** [http://www.genome.jp/dbget-bin/www_bget?C00493 C00493]
−
{{#set: completion rate=50.0}}
+
* CHEMSPIDER:
 +
** [http://www.chemspider.com/Chemical-Structure.5414360.html 5414360]
 +
* CHEBI:
 +
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=36208 36208]
 +
* BIGG : 35144
 +
{{#set: smiles=C1(=C(CC(C(O)C(O)1)O)C(=O)[O-])}}
 +
{{#set: inchi key=InChIKey=JXOHGGNKMLTUBP-HSUXUTPPSA-M}}
 +
{{#set: common name=shikimate}}
 +
{{#set: molecular weight=173.145    }}
 +
{{#set: common name=shikimic acid|(3R,4S,5R)--3,4,5-trihydroxycyclohex-1-ene-1-carboxylate}}
 +
{{#set: consumed by=RXN-7968}}
 +
{{#set: produced by=SHIKIMATE-5-DEHYDROGENASE-RXN}}
 +
{{#set: reversible reaction associated=SHIKIMATE-KINASE-RXN}}

Latest revision as of 19:28, 21 March 2018

Metabolite SHIKIMATE

  • smiles:
    • C1(=C(CC(C(O)C(O)1)O)C(=O)[O-])
  • inchi key:
    • InChIKey=JXOHGGNKMLTUBP-HSUXUTPPSA-M
  • common name:
    • shikimate
  • molecular weight:
    • 173.145
  • Synonym(s):
    • shikimic acid
    • (3R,4S,5R)--3,4,5-trihydroxycyclohex-1-ene-1-carboxylate

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"C1(=C(CC(C(O)C(O)1)O)C(=O)[O-])" cannot be used as a page name in this wiki.




Retrieved from "http://gem-aureme.irisa.fr/ectogem/index.php?title=SHIKIMATE&oldid=27124"