Difference between revisions of "XYLCAT-PWY"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-8614 CPD-8614] == * smiles: ** CC(C)CCCC([CH]4(C1(C)([CH](C2(=C(CC1)C3(C)([CH](CC2)C(C)C(=O...")
 
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=XYLCAT-PWY XYLCAT-PWY] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-4751 TA...")
 
(2 intermediate revisions by the same user not shown)
Line 1: Line 1:
[[Category:Metabolite]]
+
[[Category:Pathway]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-8614 CPD-8614] ==
+
== Pathway [http://metacyc.org/META/NEW-IMAGE?object=XYLCAT-PWY XYLCAT-PWY] ==
* smiles:
+
* taxonomic range:
** CC(C)CCCC([CH]4(C1(C)([CH](C2(=C(CC1)C3(C)([CH](CC2)C(C)C(=O)CC3)))CC4)))C
+
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-4751 TAX-4751]
* inchi key:
+
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2 TAX-2]
** InChIKey=SDZUXFFGOQZLPK-SINUOACOSA-N
+
 
* common name:
 
* common name:
** 4α-methyl-5α-cholesta-8-en-3-one
+
** xylose degradation I
* molecular weight:
+
** 398.671   
+
 
* Synonym(s):
 
* Synonym(s):
 +
** xylose catabolism
  
== Reaction(s) known to consume the compound ==
+
== Reaction(s) found ==
== Reaction(s) known to produce the compound ==
+
'''1''' reactions found over '''2''' reactions in the full pathway
* [[RXN66-18]]
+
* [[XYLULOKIN-RXN]]
== Reaction(s) of unknown directionality ==
+
** 1 associated gene(s):
 +
*** [[Ec-01_002810]]
 +
** 2 reconstruction source(s) associated:
 +
*** [[annotation-esiliculosus_genome]]
 +
*** [[orthology-aragem]]
 +
== Reaction(s) not found ==
 +
* [http://metacyc.org/META/NEW-IMAGE?object=XYLISOM-RXN XYLISOM-RXN]
 
== External links  ==
 
== External links  ==
* PUBCHEM:
+
* ECOCYC:
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25202835 25202835]
+
** [http://metacyc.org/ECOLI/NEW-IMAGE?object=XYLCAT-PWY XYLCAT-PWY]
* HMDB : HMDB12174
+
{{#set: taxonomic range=TAX-4751}}
{{#set: smiles=CC(C)CCCC([CH]4(C1(C)([CH](C2(=C(CC1)C3(C)([CH](CC2)C(C)C(=O)CC3)))CC4)))C}}
+
{{#set: taxonomic range=TAX-2}}
{{#set: inchi key=InChIKey=SDZUXFFGOQZLPK-SINUOACOSA-N}}
+
{{#set: common name=xylose degradation I}}
{{#set: common name=4α-methyl-5α-cholesta-8-en-3-one}}
+
{{#set: common name=xylose catabolism}}
{{#set: molecular weight=398.671    }}
+
{{#set: reaction found=1}}
{{#set: produced by=RXN66-18}}
+
{{#set: total reaction=2}}
 +
{{#set: completion rate=50.0}}

Latest revision as of 19:15, 21 March 2018

Pathway XYLCAT-PWY

  • taxonomic range:
  • common name:
    • xylose degradation I
  • Synonym(s):
    • xylose catabolism

Reaction(s) found

1 reactions found over 2 reactions in the full pathway

Reaction(s) not found

External links