Difference between revisions of "CPD0-2030"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-15635 RXN-15635] == * direction: ** LEFT-TO-RIGHT * common name: ** 3-methyl-2-oxobutanoate hyd...")
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD0-2030 CPD0-2030] == * smiles: ** C(O)C(O)COP([O-])(OCC([N+])C(=O)[O-])=O * inchi key: ** In...")
 
Line 1: Line 1:
−
[[Category:Reaction]]
+
[[Category:Metabolite]]
−
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-15635 RXN-15635] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD0-2030 CPD0-2030] ==
−
* direction:
+
* smiles:
−
** LEFT-TO-RIGHT
+
** C(O)C(O)COP([O-])(OCC([N+])C(=O)[O-])=O
 +
* inchi key:
 +
** InChIKey=ZWZWYGMENQVNFU-UHNVWZDZSA-M
 
* common name:
 
* common name:
−
** 3-methyl-2-oxobutanoate hydroxymethyltransferase
+
** glycerophosphoserine
−
* ec number:
+
* molecular weight:
−
** [http://enzyme.expasy.org/EC/2.1.2.11 EC-2.1.2.11]
+
** 258.144   
 
* Synonym(s):
 
* Synonym(s):
  
−
== Reaction Formula ==
+
== Reaction(s) known to consume the compound ==
−
* With identifiers:
+
* [[RXN-14136]]
−
** 1 [[WATER]][c] '''+''' 1 [[2-KETO-ISOVALERATE]][c] '''+''' 1 [[METHYLENETETRAHYDROMETHANOPTERIN]][c] '''=>''' 1 [[THMPT]][c] '''+''' 1 [[2-DEHYDROPANTOATE]][c]
+
== Reaction(s) known to produce the compound ==
−
* With common name(s):
+
== Reaction(s) of unknown directionality ==
−
** 1 H2O[c] '''+''' 1 3-methyl-2-oxobutanoate[c] '''+''' 1 5,10-methylene-tetrahydromethanopterin[c] '''=>''' 1 tetrahydromethanopterin[c] '''+''' 1 2-dehydropantoate[c]
+
−
 
+
−
== Genes associated with this reaction  ==
+
−
Genes have been associated with this reaction based on different elements listed below.
+
−
* Gene: [[Ec-01_001700]]
+
−
** Source: [[annotation-esiliculosus_genome]]
+
−
*** Assignment: GO-TERM
+
−
== Pathways  ==
+
−
* [[PWY-6654]], phosphopantothenate biosynthesis III: [http://metacyc.org/META/NEW-IMAGE?object=PWY-6654 PWY-6654]
+
−
** '''2''' reactions found over '''4''' reactions in the full pathway
+
−
== Reconstruction information  ==
+
−
* Category: [[annotation]]
+
−
** Source: [[annotation-esiliculosus_genome]]
+
−
*** Tool: [[pathwaytools]]
+
 
== External links  ==
 
== External links  ==
−
{{#set: direction=LEFT-TO-RIGHT}}
+
* PUBCHEM:
−
{{#set: common name=3-methyl-2-oxobutanoate hydroxymethyltransferase}}
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=57339260 57339260]
−
{{#set: ec number=EC-2.1.2.11}}
+
* CHEBI:
−
{{#set: gene associated=Ec-01_001700}}
+
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=61931 61931]
−
{{#set: in pathway=PWY-6654}}
+
* BIGG : 1484554
−
{{#set: reconstruction category=annotation}}
+
{{#set: smiles=C(O)C(O)COP([O-])(OCC([N+])C(=O)[O-])=O}}
−
{{#set: reconstruction source=annotation-esiliculosus_genome}}
+
{{#set: inchi key=InChIKey=ZWZWYGMENQVNFU-UHNVWZDZSA-M}}
−
{{#set: reconstruction tool=pathwaytools}}
+
{{#set: common name=glycerophosphoserine}}
 +
{{#set: molecular weight=258.144    }}
 +
{{#set: consumed by=RXN-14136}}

Latest revision as of 20:29, 21 March 2018

Metabolite CPD0-2030

  • smiles:
    • C(O)C(O)COP([O-])(OCC([N+])C(=O)[O-])=O
  • inchi key:
    • InChIKey=ZWZWYGMENQVNFU-UHNVWZDZSA-M
  • common name:
    • glycerophosphoserine
  • molecular weight:
    • 258.144
  • Synonym(s):

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"C(O)C(O)COP([O-])(OCC([N+])C(=O)[O-])=O" cannot be used as a page name in this wiki.



Retrieved from "http://gem-aureme.irisa.fr/ectogem/index.php?title=CPD0-2030&oldid=27276"