Difference between revisions of "CPD-7002"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Chitodextrins Chitodextrins] == * common name: ** a chitodextrin * Synonym(s): ** a chtin fragm...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-7002 CPD-7002] == * smiles: ** CC(=CCCC(=CCCC(CCCC(=CCOP([O-])(=O)OP([O-])(=O)[O-])C)C)C)C...") |
||
| Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
| − | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-7002 CPD-7002] == |
| + | * smiles: | ||
| + | ** CC(=CCCC(=CCCC(CCCC(=CCOP([O-])(=O)OP([O-])(=O)[O-])C)C)C)C | ||
| + | * inchi key: | ||
| + | ** InChIKey=YJGANOFPASCZBK-WCNZLWBOSA-K | ||
* common name: | * common name: | ||
| − | ** | + | ** dihydrogeranylgeranyl diphosphate |
| + | * molecular weight: | ||
| + | ** 449.44 | ||
* Synonym(s): | * Synonym(s): | ||
| − | ** | + | ** dihydroGGPP |
| − | ** | + | ** dihydrogeranylgeranyl-PP |
| + | ** dihydrogeranylgeranyl pyrophosphate | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[RXN- | + | * [[RXN-7659]] |
| − | + | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[ | + | * [[RXN-7658]] |
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
== External links == | == External links == | ||
| − | {{#set: common name= | + | * PUBCHEM: |
| − | {{#set: common name= | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=90658526 90658526] |
| − | {{#set: consumed by=RXN- | + | {{#set: smiles=CC(=CCCC(=CCCC(CCCC(=CCOP([O-])(=O)OP([O-])(=O)[O-])C)C)C)C}} |
| − | {{#set: produced by= | + | {{#set: inchi key=InChIKey=YJGANOFPASCZBK-WCNZLWBOSA-K}} |
| + | {{#set: common name=dihydrogeranylgeranyl diphosphate}} | ||
| + | {{#set: molecular weight=449.44 }} | ||
| + | {{#set: common name=dihydroGGPP|dihydrogeranylgeranyl-PP|dihydrogeranylgeranyl pyrophosphate}} | ||
| + | {{#set: consumed by=RXN-7659}} | ||
| + | {{#set: produced by=RXN-7658}} | ||
Latest revision as of 19:29, 21 March 2018
Contents
Metabolite CPD-7002
- smiles:
- CC(=CCCC(=CCCC(CCCC(=CCOP([O-])(=O)OP([O-])(=O)[O-])C)C)C)C
- inchi key:
- InChIKey=YJGANOFPASCZBK-WCNZLWBOSA-K
- common name:
- dihydrogeranylgeranyl diphosphate
- molecular weight:
- 449.44
- Synonym(s):
- dihydroGGPP
- dihydrogeranylgeranyl-PP
- dihydrogeranylgeranyl pyrophosphate
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
- PUBCHEM:
"CC(=CCCC(=CCCC(CCCC(=CCOP([O-])(=O)OP([O-])(=O)[O-])C)C)C)C" cannot be used as a page name in this wiki.
