Difference between revisions of "GDPRHAMSYN-PWY"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-14443 CPD-14443] == * smiles: ** C1(C(O)CC(=NC1C([O-])=O)C([O-])=O) * inchi key: ** InChIKe...") |
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=GDPRHAMSYN-PWY GDPRHAMSYN-PWY] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?object=TAX...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Pathway]] |
− | == | + | == Pathway [http://metacyc.org/META/NEW-IMAGE?object=GDPRHAMSYN-PWY GDPRHAMSYN-PWY] == |
− | * | + | * taxonomic range: |
− | ** | + | ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-1239 TAX-1239] |
− | * | + | ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-1224 TAX-1224] |
− | * | + | |
* common name: | * common name: | ||
− | ** | + | ** GDP-D-rhamnose biosynthesis |
− | + | ||
− | + | ||
* Synonym(s): | * Synonym(s): | ||
− | ** | + | ** GDP-α-D-rhamnose biosynthesis |
− | == Reaction(s) | + | == Reaction(s) found == |
− | * [[RXN- | + | '''1''' reactions found over '''2''' reactions in the full pathway |
− | + | * [[GDPMANDEHYDRA-RXN]] | |
− | * [[ | + | ** 2 associated gene(s): |
− | == Reaction(s) | + | *** [[Ec-28_003400]] |
+ | *** [[Ec-11_005510]] | ||
+ | ** 2 reconstruction source(s) associated: | ||
+ | *** [[annotation-esiliculosus_genome]] | ||
+ | *** [[orthology-aragem]] | ||
+ | == Reaction(s) not found == | ||
+ | * [http://metacyc.org/META/NEW-IMAGE?object=GDP-4-DEHYDRO-D-RHAMNOSE-REDUCTASE-RXN GDP-4-DEHYDRO-D-RHAMNOSE-REDUCTASE-RXN] | ||
== External links == | == External links == | ||
− | + | {{#set: taxonomic range=TAX-1239}} | |
− | + | {{#set: taxonomic range=TAX-1224}} | |
− | + | {{#set: common name=GDP-D-rhamnose biosynthesis}} | |
− | + | {{#set: common name=GDP-α-D-rhamnose biosynthesis}} | |
− | {{#set: | + | {{#set: reaction found=1}} |
− | {{#set: | + | {{#set: total reaction=2}} |
− | {{#set: common name= | + | {{#set: completion rate=50.0}} |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + |
Latest revision as of 20:29, 21 March 2018
Pathway GDPRHAMSYN-PWY
- taxonomic range:
- common name:
- GDP-D-rhamnose biosynthesis
- Synonym(s):
- GDP-α-D-rhamnose biosynthesis
Reaction(s) found
1 reactions found over 2 reactions in the full pathway
- GDPMANDEHYDRA-RXN
- 2 associated gene(s):
- 2 reconstruction source(s) associated: