Difference between revisions of "RXN-3523"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=L-SELENOCYSTEINE L-SELENOCYSTEINE] == * smiles: ** C([Se])C([N+])C([O-])=O * inchi key: ** InCh...")
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-3523 RXN-3523] == * direction: ** LEFT-TO-RIGHT * common name: ** L-ascorbate peroxidase * Syno...")
 
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Reaction]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=L-SELENOCYSTEINE L-SELENOCYSTEINE] ==
+
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-3523 RXN-3523] ==
−
* smiles:
+
* direction:
−
** C([Se])C([N+])C([O-])=O
+
** LEFT-TO-RIGHT
−
* inchi key:
+
−
** InChIKey=ZKZBPNGNEQAJSX-REOHCLBHSA-N
+
 
* common name:
 
* common name:
−
** L-selenocysteine
+
** L-ascorbate peroxidase
−
* molecular weight:
+
−
** 168.054   
+
 
* Synonym(s):
 
* Synonym(s):
−
** U
+
** L-ascorbic acid peroxidase
 +
** L-ascorbic acid-specific peroxidase
 +
** ascorbate peroxidase
 +
** ascorbic acid peroxidase
  
−
== Reaction(s) known to consume the compound ==
+
== Reaction Formula ==
−
== Reaction(s) known to produce the compound ==
+
* With identifiers:
−
* [[RXN-12726]]
+
** 2 [[CPD-318]][c] '''=>''' 1 [[L-DEHYDRO-ASCORBATE]][c] '''+''' 1 [[PROTON]][c] '''+''' 1 [[ASCORBATE]][c]
−
== Reaction(s) of unknown directionality ==
+
* With common name(s):
 +
** 2 monodehydroascorbate radical[c] '''=>''' 1 L-dehydro-ascorbate[c] '''+''' 1 H+[c] '''+''' 1 L-ascorbate[c]
 +
 
 +
== Genes associated with this reaction  ==
 +
== Pathways  ==
 +
* [[PWY-6370]], ascorbate recycling (cytosolic): [http://metacyc.org/META/NEW-IMAGE?object=PWY-6370 PWY-6370]
 +
** '''4''' reactions found over '''6''' reactions in the full pathway
 +
* [[PWY-2261]], ascorbate glutathione cycle: [http://metacyc.org/META/NEW-IMAGE?object=PWY-2261 PWY-2261]
 +
** '''3''' reactions found over '''4''' reactions in the full pathway
 +
== Reconstruction information  ==
 +
* Category: [[annotation]]
 +
** Source: [[annotation-esiliculosus_genome]]
 +
*** Tool: [[pathwaytools]]
 
== External links  ==
 
== External links  ==
−
* LIGAND-CPD:
+
* RHEA:
−
** [http://www.genome.jp/dbget-bin/www_bget?C05688 C05688]
+
** [http://www.ebi.ac.uk/rhea/reaction.xhtml?id=30270 30270]
−
* CHEBI:
+
* LIGAND-RXN:
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=57843 57843]
+
** [http://www.genome.jp/dbget-bin/www_bget?R03186 R03186]
−
* METABOLIGHTS : MTBLC57843
+
{{#set: direction=LEFT-TO-RIGHT}}
−
* PUBCHEM:
+
{{#set: common name=L-ascorbate peroxidase}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25245418 25245418]
+
{{#set: common name=L-ascorbic acid peroxidase|L-ascorbic acid-specific peroxidase|ascorbate peroxidase|ascorbic acid peroxidase}}
−
* HMDB : HMDB03288
+
{{#set: in pathway=PWY-6370|PWY-2261}}
−
{{#set: smiles=C([Se])C([N+])C([O-])=O}}
+
{{#set: reconstruction category=annotation}}
−
{{#set: inchi key=InChIKey=ZKZBPNGNEQAJSX-REOHCLBHSA-N}}
+
{{#set: reconstruction source=annotation-esiliculosus_genome}}
−
{{#set: common name=L-selenocysteine}}
+
{{#set: reconstruction tool=pathwaytools}}
−
{{#set: molecular weight=168.054    }}
+
−
{{#set: common name=U}}
+
−
{{#set: produced by=RXN-12726}}
+

Latest revision as of 20:31, 21 March 2018

Reaction RXN-3523

  • direction:
    • LEFT-TO-RIGHT
  • common name:
    • L-ascorbate peroxidase
  • Synonym(s):
    • L-ascorbic acid peroxidase
    • L-ascorbic acid-specific peroxidase
    • ascorbate peroxidase
    • ascorbic acid peroxidase

Reaction Formula

Genes associated with this reaction

Pathways

  • PWY-6370, ascorbate recycling (cytosolic): PWY-6370
    • 4 reactions found over 6 reactions in the full pathway
  • PWY-2261, ascorbate glutathione cycle: PWY-2261
    • 3 reactions found over 4 reactions in the full pathway

Reconstruction information

External links




Retrieved from "http://gem-aureme.irisa.fr/ectogem/index.php?title=RXN-3523&oldid=27524"