Difference between revisions of "CPD-9610"
From metabolic_network
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-11057 RXN-11057] == * direction: ** LEFT-TO-RIGHT * common name: ** Aromatic-ring hydroxylase-l...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-9610 CPD-9610] == * smiles: ** CC(=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=...") |
||
| (2 intermediate revisions by the same user not shown) | |||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:Metabolite]] |
| − | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-9610 CPD-9610] == |
| − | * | + | * smiles: |
| − | ** | + | ** CC(=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCOP(=O)([O-])OP(=O)([O-])[O-])C |
| + | * inchi key: | ||
| + | ** InChIKey=FSCYHDCTHRVSKN-CMVHWAPMSA-K | ||
* common name: | * common name: | ||
| − | ** | + | ** all-trans-decaprenyl diphosphate |
| − | * | + | * molecular weight: |
| − | + | ** 856.133 | |
| − | ** | + | |
* Synonym(s): | * Synonym(s): | ||
| − | == Reaction | + | == Reaction(s) known to consume the compound == |
| − | + | * [[RXN-9230]] | |
| − | + | == Reaction(s) known to produce the compound == | |
| − | + | == Reaction(s) of unknown directionality == | |
| − | + | ||
| − | + | ||
| − | = | + | |
| − | + | ||
| − | * [[ | + | |
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | == | + | |
| − | + | ||
| − | + | ||
| − | == | + | |
| − | + | ||
| − | + | ||
| − | + | ||
== External links == | == External links == | ||
| − | + | * LIGAND-CPD: | |
| − | + | ** [http://www.genome.jp/dbget-bin/www_bget?C17432 C17432] | |
| − | + | * CHEBI: | |
| − | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=60721 60721] | |
| − | {{#set: | + | * PUBCHEM: |
| − | {{#set: | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25245574 25245574] |
| − | {{#set: | + | * HMDB : HMDB59616 |
| − | {{#set: | + | {{#set: smiles=CC(=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCOP(=O)([O-])OP(=O)([O-])[O-])C}} |
| − | {{#set: | + | {{#set: inchi key=InChIKey=FSCYHDCTHRVSKN-CMVHWAPMSA-K}} |
| + | {{#set: common name=all-trans-decaprenyl diphosphate}} | ||
| + | {{#set: molecular weight=856.133 }} | ||
| + | {{#set: consumed by=RXN-9230}} | ||
Latest revision as of 19:15, 21 March 2018
Contents
Metabolite CPD-9610
- smiles:
- CC(=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCOP(=O)([O-])OP(=O)([O-])[O-])C
- inchi key:
- InChIKey=FSCYHDCTHRVSKN-CMVHWAPMSA-K
- common name:
- all-trans-decaprenyl diphosphate
- molecular weight:
- 856.133
- Synonym(s):
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"CC(=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCOP(=O)([O-])OP(=O)([O-])[O-])C" cannot be used as a page name in this wiki.
