Difference between revisions of "CPD-15677"
From metabolic_network
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=6.2.1.34-RXN 6.2.1.34-RXN] == * direction: ** LEFT-TO-RIGHT * ec number: ** [http://enzyme.expasy.o...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-15677 CPD-15677] == * smiles: ** CCCCCCC=CCCC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)...") |
||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:Metabolite]] |
| − | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-15677 CPD-15677] == |
| − | * | + | * smiles: |
| − | ** | + | ** CCCCCCC=CCCC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-] |
| − | * | + | * inchi key: |
| − | ** | + | ** InChIKey=AFMMIIQKXQNEDN-DUPKWVSKSA-J |
| + | * common name: | ||
| + | ** 4-trans-undecenoyl-CoA | ||
| + | * molecular weight: | ||
| + | ** 929.765 | ||
* Synonym(s): | * Synonym(s): | ||
| + | ** 4E-undecenoyl-CoA | ||
| − | == Reaction | + | == Reaction(s) known to consume the compound == |
| − | + | * [[RXN-14789]] | |
| − | + | == Reaction(s) known to produce the compound == | |
| − | + | == Reaction(s) of unknown directionality == | |
| − | + | ||
| − | + | ||
| − | = | + | |
| − | + | ||
| − | * | + | |
| − | + | ||
| − | + | ||
| − | + | ||
| − | == | + | |
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | == | + | |
| − | + | ||
| − | + | ||
| − | + | ||
== External links == | == External links == | ||
| − | * | + | * PUBCHEM: |
| − | ** [http:// | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=90658640 90658640] |
| − | {{#set: | + | {{#set: smiles=CCCCCCC=CCCC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]}} |
| − | + | {{#set: inchi key=InChIKey=AFMMIIQKXQNEDN-DUPKWVSKSA-J}} | |
| − | {{#set: | + | {{#set: common name=4-trans-undecenoyl-CoA}} |
| − | {{#set: | + | {{#set: molecular weight=929.765 }} |
| − | {{#set: | + | {{#set: common name=4E-undecenoyl-CoA}} |
| − | {{#set: | + | {{#set: consumed by=RXN-14789}} |
| − | {{#set: | + | |
Latest revision as of 19:33, 21 March 2018
Contents
Metabolite CPD-15677
- smiles:
- CCCCCCC=CCCC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]
- inchi key:
- InChIKey=AFMMIIQKXQNEDN-DUPKWVSKSA-J
- common name:
- 4-trans-undecenoyl-CoA
- molecular weight:
- 929.765
- Synonym(s):
- 4E-undecenoyl-CoA
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
- PUBCHEM:
"CCCCCCC=CCCC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-" cannot be used as a page name in this wiki.
