Difference between revisions of "CPD-17347"
From metabolic_network
(Created page with "Category:Gene == Gene Ec-11_004330 == * left end position: ** 4407159 * transcription direction: ** NEGATIVE * right end position: ** 4410803 * centisome position: ** 70.0...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-17347 CPD-17347] == * smiles: ** CCCCCC=CCC=CCCCCCCCC(O)CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)C...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Metabolite]] |
− | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-17347 CPD-17347] == |
− | * | + | * smiles: |
− | ** | + | ** CCCCCC=CCC=CCCCCCCCC(O)CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-] |
− | * | + | * common name: |
− | ** | + | ** (3R)-hydroxy-(11Z,14Z)-icosa-11,14-dienoyl-CoA |
− | * | + | * inchi key: |
− | ** | + | ** InChIKey=MNTSLNSVZACNCX-JPDDAYGWSA-J |
− | * | + | * molecular weight: |
− | ** | + | ** 1069.99 |
* Synonym(s): | * Synonym(s): | ||
− | ** | + | ** (3R)-hydroxy-20:2Δ11,14 |
− | + | ||
− | + | ||
− | == | + | == Reaction(s) known to consume the compound == |
− | * | + | * [[RXN-16096]] |
− | + | == Reaction(s) known to produce the compound == | |
− | + | * [[RXN-16095]] | |
− | + | == Reaction(s) of unknown directionality == | |
− | + | ||
− | * | + | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | == | + | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
== External links == | == External links == | ||
− | {{#set: | + | * PUBCHEM: |
− | {{#set: | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=72193805 72193805] |
− | {{#set: | + | * CHEBI: |
− | {{#set: | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=76408 76408] |
− | {{#set: common name= | + | {{#set: smiles=CCCCCC=CCC=CCCCCCCCC(O)CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]}} |
− | {{#set: | + | {{#set: common name=(3R)-hydroxy-(11Z,14Z)-icosa-11,14-dienoyl-CoA}} |
− | {{#set: | + | {{#set: inchi key=InChIKey=MNTSLNSVZACNCX-JPDDAYGWSA-J}} |
+ | {{#set: molecular weight=1069.99 }} | ||
+ | {{#set: common name=(3R)-hydroxy-20:2Δ11,14}} | ||
+ | {{#set: consumed by=RXN-16096}} | ||
+ | {{#set: produced by=RXN-16095}} |
Latest revision as of 19:33, 21 March 2018
Contents
Metabolite CPD-17347
- smiles:
- CCCCCC=CCC=CCCCCCCCC(O)CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]
- common name:
- (3R)-hydroxy-(11Z,14Z)-icosa-11,14-dienoyl-CoA
- inchi key:
- InChIKey=MNTSLNSVZACNCX-JPDDAYGWSA-J
- molecular weight:
- 1069.99
- Synonym(s):
- (3R)-hydroxy-20:2Δ11,14
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"CCCCCC=CCC=CCCCCCCCC(O)CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-" cannot be used as a page name in this wiki.