Difference between revisions of "Ec-10 000640"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-2751 CPD-2751] == * smiles: ** C1(=O)(CCC(O)(N(C)1)C2(=CN=CC=C2)) * inchi key: ** InChIKey=...")
(Created page with "Category:Gene == Gene Ec-10_000640 == * left end position: ** 715343 * transcription direction: ** POSITIVE * right end position: ** 723104 * centisome position: ** 11.003...")
 
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Gene]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-2751 CPD-2751] ==
+
== Gene Ec-10_000640 ==
−
* smiles:
+
* left end position:
−
** C1(=O)(CCC(O)(N(C)1)C2(=CN=CC=C2))
+
** 715343
−
* inchi key:
+
* transcription direction:
−
** InChIKey=BBNHNZGTKSWIHD-SNVBAGLBSA-N
+
** POSITIVE
−
* common name:
+
* right end position:
−
** 5'-hydroxycotinine
+
** 723104
−
* molecular weight:
+
* centisome position:
−
** 192.217    
+
** 11.00361    
 
* Synonym(s):
 
* Synonym(s):
−
** allohydroxycotinine
+
** Esi_0138_0032
 +
** Esi0138_0032
  
−
== Reaction(s) known to consume the compound ==
+
== Reactions associated ==
−
== Reaction(s) known to produce the compound ==
+
* Reaction: [[PROTEIN-KINASE-RXN]]
−
* [[RXN66-163]]
+
** Source: [[annotation-esiliculosus_genome]]
−
== Reaction(s) of unknown directionality ==
+
*** Assignment: go-term
 +
== Pathways associated ==
 
== External links  ==
 
== External links  ==
−
* PUBCHEM:
+
{{#set: left end position=715343}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=9815515 9815515]
+
{{#set: transcription direction=POSITIVE}}
−
* CHEMSPIDER:
+
{{#set: right end position=723104}}
−
** [http://www.chemspider.com/Chemical-Structure.7991265.html 7991265]
+
{{#set: centisome position=11.00361   }}
−
* HMDB : HMDB01427
+
{{#set: common name=Esi_0138_0032|Esi0138_0032}}
−
{{#set: smiles=C1(=O)(CCC(O)(N(C)1)C2(=CN=CC=C2))}}
+
{{#set: reaction associated=PROTEIN-KINASE-RXN}}
−
{{#set: inchi key=InChIKey=BBNHNZGTKSWIHD-SNVBAGLBSA-N}}
+
−
{{#set: common name=5'-hydroxycotinine}}
+
−
{{#set: molecular weight=192.217   }}
+
−
{{#set: common name=allohydroxycotinine}}
+
−
{{#set: produced by=RXN66-163}}
+

Latest revision as of 19:33, 21 March 2018

Gene Ec-10_000640

  • left end position:
    • 715343
  • transcription direction:
    • POSITIVE
  • right end position:
    • 723104
  • centisome position:
    • 11.00361
  • Synonym(s):
    • Esi_0138_0032
    • Esi0138_0032

Reactions associated

Pathways associated

External links

Retrieved from "http://gem-aureme.irisa.fr/ectogem/index.php?title=Ec-10_000640&oldid=27796"