Difference between revisions of "HEXOKINASE-RXN"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-14705 CPD-14705] == * smiles: ** CCCCCC(O)C(C[CH]=O)SCC([N+])C(=O)NCC([O-])=O * inchi key:...") |
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=HEXOKINASE-RXN HEXOKINASE-RXN] == * direction: ** REVERSIBLE * common name: ** Glucokinase * ec num...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Reaction]] |
− | == | + | == Reaction [http://metacyc.org/META/NEW-IMAGE?object=HEXOKINASE-RXN HEXOKINASE-RXN] == |
− | * | + | * direction: |
− | ** | + | ** REVERSIBLE |
− | + | ||
− | + | ||
* common name: | * common name: | ||
− | ** | + | ** Glucokinase |
− | * | + | * ec number: |
− | ** | + | ** [http://enzyme.expasy.org/EC/2.7.1.1 EC-2.7.1.1] |
* Synonym(s): | * Synonym(s): | ||
− | == Reaction(s) | + | == Reaction Formula == |
− | * [[ | + | * With identifiers: |
− | == | + | ** 1 [[ATP]][c] '''+''' 1 [[D-Hexoses]][c] '''<=>''' 1 [[PROTON]][c] '''+''' 1 [[ADP]][c] '''+''' 1 [[D-HEXOSE-6-PHOSPHATE]][c] |
− | == | + | * With common name(s): |
+ | ** 1 ATP[c] '''+''' 1 a D-hexose[c] '''<=>''' 1 H+[c] '''+''' 1 ADP[c] '''+''' 1 D-hexose 6-phosphate[c] | ||
+ | |||
+ | == Genes associated with this reaction == | ||
+ | Genes have been associated with this reaction based on different elements listed below. | ||
+ | * Gene: [[Ec-27_005030]] | ||
+ | ** Source: [[annotation-esiliculosus_genome]] | ||
+ | *** Assignment: AUTOMATED-NAME-MATCH | ||
+ | == Pathways == | ||
+ | == Reconstruction information == | ||
+ | * Category: [[annotation]] | ||
+ | ** Source: [[annotation-esiliculosus_genome]] | ||
+ | *** Tool: [[pathwaytools]] | ||
== External links == | == External links == | ||
− | * | + | * RHEA: |
− | ** [http:// | + | ** [http://www.ebi.ac.uk/rhea/reaction.xhtml?id=22740 22740] |
− | + | * LIGAND-RXN: | |
− | {{#set: | + | ** [http://www.genome.jp/dbget-bin/www_bget?R02848 R02848] |
− | {{#set: | + | * UNIPROT: |
− | {{#set: | + | ** [http://www.uniprot.org/uniprot/P17712 P17712] |
− | {{#set: | + | ** [http://www.uniprot.org/uniprot/P19367 P19367] |
+ | ** [http://www.uniprot.org/uniprot/P05708 P05708] | ||
+ | ** [http://www.uniprot.org/uniprot/P35557 P35557] | ||
+ | ** [http://www.uniprot.org/uniprot/P33284 P33284] | ||
+ | ** [http://www.uniprot.org/uniprot/Q02155 Q02155] | ||
+ | ** [http://www.uniprot.org/uniprot/P52789 P52789] | ||
+ | ** [http://www.uniprot.org/uniprot/P04806 P04806] | ||
+ | ** [http://www.uniprot.org/uniprot/P04807 P04807] | ||
+ | ** [http://www.uniprot.org/uniprot/Q64596 Q64596] | ||
+ | ** [http://www.uniprot.org/uniprot/P27926 P27926] | ||
+ | ** [http://www.uniprot.org/uniprot/P27881 P27881] | ||
+ | ** [http://www.uniprot.org/uniprot/P50521 P50521] | ||
+ | ** [http://www.uniprot.org/uniprot/Q09756 Q09756] | ||
+ | ** [http://www.uniprot.org/uniprot/Q42525 Q42525] | ||
+ | ** [http://www.uniprot.org/uniprot/O64390 O64390] | ||
+ | ** [http://www.uniprot.org/uniprot/P78848 P78848] | ||
+ | {{#set: direction=REVERSIBLE}} | ||
+ | {{#set: common name=Glucokinase}} | ||
+ | {{#set: ec number=EC-2.7.1.1}} | ||
+ | {{#set: gene associated=Ec-27_005030}} | ||
+ | {{#set: in pathway=}} | ||
+ | {{#set: reconstruction category=annotation}} | ||
+ | {{#set: reconstruction source=annotation-esiliculosus_genome}} | ||
+ | {{#set: reconstruction tool=pathwaytools}} |
Latest revision as of 19:34, 21 March 2018
Contents
Reaction HEXOKINASE-RXN
- direction:
- REVERSIBLE
- common name:
- Glucokinase
- ec number:
- Synonym(s):
Reaction Formula
- With identifiers:
- 1 ATP[c] + 1 D-Hexoses[c] <=> 1 PROTON[c] + 1 ADP[c] + 1 D-HEXOSE-6-PHOSPHATE[c]
- With common name(s):
- 1 ATP[c] + 1 a D-hexose[c] <=> 1 H+[c] + 1 ADP[c] + 1 D-hexose 6-phosphate[c]
Genes associated with this reaction
Genes have been associated with this reaction based on different elements listed below.
- Gene: Ec-27_005030
- Source: annotation-esiliculosus_genome
- Assignment: AUTOMATED-NAME-MATCH
- Source: annotation-esiliculosus_genome
Pathways
Reconstruction information
- Category: annotation
- Source: annotation-esiliculosus_genome
- Tool: pathwaytools
- Source: annotation-esiliculosus_genome
External links
- RHEA:
- LIGAND-RXN:
- UNIPROT: