Difference between revisions of "CPD-14394"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Gene == Gene Ec-26_002590 == * left end position: ** 2892097 * transcription direction: ** POSITIVE * right end position: ** 2908401 * centisome position: ** 43.9...")
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-14394 CPD-14394] == * smiles: ** CCC=CCC=CCC=CCC=CCCCCCCC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)CO...")
 
Line 1: Line 1:
[[Category:Gene]]
+
[[Category:Metabolite]]
== Gene Ec-26_002590 ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-14394 CPD-14394] ==
* left end position:
+
* smiles:
** 2892097
+
** CCC=CCC=CCC=CCC=CCCCCCCC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]
* transcription direction:
+
* inchi key:
** POSITIVE
+
** InChIKey=PLHICYKOPITJJT-QWOXCLFSSA-J
* right end position:
+
* common name:
** 2908401
+
** (8Z,11Z,14Z,17Z)-icosa-8,11,14,17-tetraenoyl-CoA
* centisome position:
+
* molecular weight:
** 43.93049    
+
** 1049.959    
 
* Synonym(s):
 
* Synonym(s):
** Esi_0212_0052
+
** icosatetraenoyl-CoA
** Esi0212_0052
+
** eicosatetraenoyl-CoA
  
== Reactions associated ==
+
== Reaction(s) known to consume the compound ==
* Reaction: [[HEMN-RXN]]
+
* [[RXN-16042]]
** Source: [[annotation-esiliculosus_genome]]
+
== Reaction(s) known to produce the compound ==
*** Assignment: automated-name-match
+
== Reaction(s) of unknown directionality ==
** Source: [[orthology-aragem]]
+
== Pathways associated ==
+
* [[PWY-5531]]
+
* [[HEMESYN2-PWY]]
+
 
== External links  ==
 
== External links  ==
{{#set: left end position=2892097}}
+
* PUBCHEM:
{{#set: transcription direction=POSITIVE}}
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=71581164 71581164]
{{#set: right end position=2908401}}
+
* CHEBI:
{{#set: centisome position=43.93049   }}
+
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=74265 74265]
{{#set: common name=Esi_0212_0052|Esi0212_0052}}
+
{{#set: smiles=CCC=CCC=CCC=CCC=CCCCCCCC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]}}
{{#set: reaction associated=HEMN-RXN}}
+
{{#set: inchi key=InChIKey=PLHICYKOPITJJT-QWOXCLFSSA-J}}
{{#set: pathway associated=PWY-5531|HEMESYN2-PWY}}
+
{{#set: common name=(8Z,11Z,14Z,17Z)-icosa-8,11,14,17-tetraenoyl-CoA}}
 +
{{#set: molecular weight=1049.959   }}
 +
{{#set: common name=icosatetraenoyl-CoA|eicosatetraenoyl-CoA}}
 +
{{#set: consumed by=RXN-16042}}

Latest revision as of 19:35, 21 March 2018

Metabolite CPD-14394

  • smiles:
    • CCC=CCC=CCC=CCC=CCCCCCCC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]
  • inchi key:
    • InChIKey=PLHICYKOPITJJT-QWOXCLFSSA-J
  • common name:
    • (8Z,11Z,14Z,17Z)-icosa-8,11,14,17-tetraenoyl-CoA
  • molecular weight:
    • 1049.959
  • Synonym(s):
    • icosatetraenoyl-CoA
    • eicosatetraenoyl-CoA

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"CCC=CCC=CCC=CCC=CCCCCCCC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-" cannot be used as a page name in this wiki.