Difference between revisions of "CPD-564"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-10659 RXN-10659] == * direction: ** LEFT-TO-RIGHT * common name: ** NAD(P)-binding domain * ec...")
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-564 CPD-564] == * smiles: ** C(CC([N+])C(=O)[O-])SCC1(OC(O)C(O)C(O)1) * inchi key: ** InChI...")
 
Line 1: Line 1:
−
[[Category:Reaction]]
+
[[Category:Metabolite]]
−
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-10659 RXN-10659] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-564 CPD-564] ==
−
* direction:
+
* smiles:
−
** LEFT-TO-RIGHT
+
** C(CC([N+])C(=O)[O-])SCC1(OC(O)C(O)C(O)1)
 +
* inchi key:
 +
** InChIKey=IQFWYNFDWRYSRA-OEQWSMLSSA-N
 
* common name:
 
* common name:
−
** NAD(P)-binding domain
+
** S-ribosyl-L-homocysteine
−
* ec number:
+
* molecular weight:
−
** [http://enzyme.expasy.org/EC/1.1.1.100 EC-1.1.1.100]
+
** 267.296   
 
* Synonym(s):
 
* Synonym(s):
 +
** S-Ribosylhomocysteine
 +
** Ribose-5-S-homocysteine
 +
** S-D-ribosyl-L-homocysteine
 +
** ribose-5-S-homocysteine
 +
** S-ribosylhomocysteine
 +
** S-(5-deoxy-D-ribos-5-yl)-L-homocysteine
  
−
== Reaction Formula ==
+
== Reaction(s) known to consume the compound ==
−
* With identifiers:
+
== Reaction(s) known to produce the compound ==
−
** 1 [[NADPH]][c] '''+''' 1 [[PROTON]][c] '''+''' 1 [[3-oxo-cis-D9-hexadecenoyl-ACPs]][c] '''=>''' 1 [[NADP]][c] '''+''' 1 [[3-hydroxy-cis-D9-hexaecenoyl-ACPs]][c]
+
* [[ADENOSYLHOMOCYSTEINE-NUCLEOSIDASE-RXN]]
−
* With common name(s):
+
== Reaction(s) of unknown directionality ==
−
** 1 NADPH[c] '''+''' 1 H+[c] '''+''' 1 a 3-oxo-cis-Δ9-hexadecenoyl-[acp][c] '''=>''' 1 NADP+[c] '''+''' 1 a (3R)-3-hydroxy cis Δ9-hexadecenoyl-[acp][c]
+
−
 
+
−
== Genes associated with this reaction  ==
+
−
Genes have been associated with this reaction based on different elements listed below.
+
−
* Gene: [[Ec-01_007100]]
+
−
** Source: [[annotation-esiliculosus_genome]]
+
−
*** Assignment: EC-NUMBER
+
−
== Pathways  ==
+
−
* [[PWY-6282]], palmitoleate biosynthesis I (from (5Z)-dodec-5-enoate): [http://metacyc.org/META/NEW-IMAGE?object=PWY-6282 PWY-6282]
+
−
** '''9''' reactions found over '''9''' reactions in the full pathway
+
−
== Reconstruction information  ==
+
−
* Category: [[annotation]]
+
−
** Source: [[annotation-esiliculosus_genome]]
+
−
*** Tool: [[pathwaytools]]
+
 
== External links  ==
 
== External links  ==
−
{{#set: direction=LEFT-TO-RIGHT}}
+
* CAS : 37558-16-0
−
{{#set: common name=NAD(P)-binding domain}}
+
* PUBCHEM:
−
{{#set: ec number=EC-1.1.1.100}}
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25245776 25245776]
−
{{#set: gene associated=Ec-01_007100}}
+
* CHEBI:
−
{{#set: in pathway=PWY-6282}}
+
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=17575 17575]
−
{{#set: reconstruction category=annotation}}
+
* BIGG : 42044
−
{{#set: reconstruction source=annotation-esiliculosus_genome}}
+
* LIGAND-CPD:
−
{{#set: reconstruction tool=pathwaytools}}
+
** [http://www.genome.jp/dbget-bin/www_bget?C03539 C03539]
 +
{{#set: smiles=C(CC([N+])C(=O)[O-])SCC1(OC(O)C(O)C(O)1)}}
 +
{{#set: inchi key=InChIKey=IQFWYNFDWRYSRA-OEQWSMLSSA-N}}
 +
{{#set: common name=S-ribosyl-L-homocysteine}}
 +
{{#set: molecular weight=267.296    }}
 +
{{#set: common name=S-Ribosylhomocysteine|Ribose-5-S-homocysteine|S-D-ribosyl-L-homocysteine|ribose-5-S-homocysteine|S-ribosylhomocysteine|S-(5-deoxy-D-ribos-5-yl)-L-homocysteine}}
 +
{{#set: produced by=ADENOSYLHOMOCYSTEINE-NUCLEOSIDASE-RXN}}

Latest revision as of 19:35, 21 March 2018

Metabolite CPD-564

  • smiles:
    • C(CC([N+])C(=O)[O-])SCC1(OC(O)C(O)C(O)1)
  • inchi key:
    • InChIKey=IQFWYNFDWRYSRA-OEQWSMLSSA-N
  • common name:
    • S-ribosyl-L-homocysteine
  • molecular weight:
    • 267.296
  • Synonym(s):
    • S-Ribosylhomocysteine
    • Ribose-5-S-homocysteine
    • S-D-ribosyl-L-homocysteine
    • ribose-5-S-homocysteine
    • S-ribosylhomocysteine
    • S-(5-deoxy-D-ribos-5-yl)-L-homocysteine

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"C(CC([N+])C(=O)[O-])SCC1(OC(O)C(O)C(O)1)" cannot be used as a page name in this wiki.



Retrieved from "http://gem-aureme.irisa.fr/ectogem/index.php?title=CPD-564&oldid=27968"