Difference between revisions of "Ec-08 003340"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD66-21 CPD66-21] == * smiles: ** CCCCCC=CCC=CC=CC=CC(SCC(C(=O)NCC([O-])=O)[N+])C(CCCC([O-])=O...")
 
(Created page with "Category:Gene == Gene Ec-08_003340 == * left end position: ** 3158667 * transcription direction: ** POSITIVE * right end position: ** 3172794 * centisome position: ** 47.1...")
 
(2 intermediate revisions by the same user not shown)
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Gene]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD66-21 CPD66-21] ==
+
== Gene Ec-08_003340 ==
−
* smiles:
+
* left end position:
−
** CCCCCC=CCC=CC=CC=CC(SCC(C(=O)NCC([O-])=O)[N+])C(CCCC([O-])=O)O
+
** 3158667
−
* inchi key:
+
* transcription direction:
−
** InChIKey=YEESKJGWJFYOOK-IJHYULJSSA-M
+
** POSITIVE
−
* common name:
+
* right end position:
−
** leukotriene-D4
+
** 3172794
−
* molecular weight:
+
* centisome position:
−
** 495.653    
+
** 47.164936    
 
* Synonym(s):
 
* Synonym(s):
 +
** Esi_0126_0044
 +
** Esi0126_0044
  
−
== Reaction(s) known to consume the compound ==
+
== Reactions associated ==
−
== Reaction(s) known to produce the compound ==
+
* Reaction: [[5.99.1.2-RXN]]
−
* [[RXN66-336]]
+
** Source: [[annotation-esiliculosus_genome]]
−
== Reaction(s) of unknown directionality ==
+
*** Assignment: go-term
 +
== Pathways associated ==
 
== External links  ==
 
== External links  ==
−
* PUBCHEM:
+
{{#set: left end position=3158667}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=52940265 52940265]
+
{{#set: transcription direction=POSITIVE}}
−
* CHEBI:
+
{{#set: right end position=3172794}}
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=63166 63166]
+
{{#set: centisome position=47.164936    }}
−
{{#set: smiles=CCCCCC=CCC=CC=CC=CC(SCC(C(=O)NCC([O-])=O)[N+])C(CCCC([O-])=O)O}}
+
{{#set: common name=Esi_0126_0044|Esi0126_0044}}
−
{{#set: inchi key=InChIKey=YEESKJGWJFYOOK-IJHYULJSSA-M}}
+
{{#set: reaction associated=5.99.1.2-RXN}}
−
{{#set: common name=leukotriene-D4}}
+
−
{{#set: molecular weight=495.653    }}
+
−
{{#set: produced by=RXN66-336}}
+

Latest revision as of 19:15, 21 March 2018

Gene Ec-08_003340

  • left end position:
    • 3158667
  • transcription direction:
    • POSITIVE
  • right end position:
    • 3172794
  • centisome position:
    • 47.164936
  • Synonym(s):
    • Esi_0126_0044
    • Esi0126_0044

Reactions associated

Pathways associated

External links

Retrieved from "http://gem-aureme.irisa.fr/ectogem/index.php?title=Ec-08_003340&oldid=25675"