Difference between revisions of "DNA-LIGASE-ATP-RXN"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD1F-95 CPD1F-95] == * smiles: ** C=C1(C2(CC3(C1)(C([CH]4(C(C)(CCCC(C)([CH](CC2)3)4)C([O-])=O)...")
 
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=DNA-LIGASE-ATP-RXN DNA-LIGASE-ATP-RXN] == * direction: ** LEFT-TO-RIGHT * common name: ** DNA ligas...")
 
(2 intermediate revisions by the same user not shown)
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Reaction]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD1F-95 CPD1F-95] ==
+
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=DNA-LIGASE-ATP-RXN DNA-LIGASE-ATP-RXN] ==
−
* smiles:
+
* direction:
−
** C=C1(C2(CC3(C1)(C([CH]4(C(C)(CCCC(C)([CH](CC2)3)4)C([O-])=O))C([O-])=O)))
+
** LEFT-TO-RIGHT
−
* inchi key:
+
−
** InChIKey=UJFQJDAESQJXTG-UFUZVNNQSA-L
+
 
* common name:
 
* common name:
−
** gibberellin A12
+
** DNA ligase (ATP)
−
* molecular weight:
+
* ec number:
−
** 330.423   
+
** [http://enzyme.expasy.org/EC/6.5.1.7 EC-6.5.1.7]
 +
** [http://enzyme.expasy.org/EC/6.5.1.1 EC-6.5.1.1]
 +
** [http://enzyme.expasy.org/EC/6.5.1.6 EC-6.5.1.6]
 
* Synonym(s):
 
* Synonym(s):
−
** C20-GAs
 
−
** open lactone gibberrellin skeleton
 
−
** C20 skeleton
 
−
** C20-GA skeleton
 
−
** C20-gibberellin skeleton
 
−
** GA12
 
  
−
== Reaction(s) known to consume the compound ==
+
== Reaction Formula ==
−
* [[RXN1F-162]]
+
* With identifiers:
−
== Reaction(s) known to produce the compound ==
+
** 1 [[DNA-N]][c] '''+''' 1 [[DEOXYNUCLEOTIDESM]][c] '''+''' 1 [[ATP]][c] '''=>''' 1 [[PPI]][c] '''+''' 1 [[DEOXYNUCLEOTIDESM]][c] '''+''' 1 [[AMP]][c]
−
* [[RXN1F-161]]
+
* With common name(s):
−
== Reaction(s) of unknown directionality ==
+
** 1 DNAn[c] '''+''' 1 (deoxynucleotides)(m)[c] '''+''' 1 ATP[c] '''=>''' 1 diphosphate[c] '''+''' 1 (deoxynucleotides)(m)[c] '''+''' 1 AMP[c]
 +
 
 +
== Genes associated with this reaction  ==
 +
Genes have been associated with this reaction based on different elements listed below.
 +
* Gene: [[Ec-01_011680]]
 +
** Source: [[annotation-esiliculosus_genome]]
 +
*** Assignment: GO-TERM
 +
* Gene: [[Ec-07_005930]]
 +
** Source: [[annotation-esiliculosus_genome]]
 +
*** Assignment: GO-TERM
 +
== Pathways  ==
 +
== Reconstruction information  ==
 +
* Category: [[annotation]]
 +
** Source: [[annotation-esiliculosus_genome]]
 +
*** Tool: [[pathwaytools]]
 
== External links  ==
 
== External links  ==
−
* LIPID_MAPS : LMPR0104170014
+
* LIGAND-RXN:
−
* PUBCHEM:
+
** [http://www.genome.jp/dbget-bin/www_bget?R00381 R00381]
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25244528 25244528]
+
* UNIPROT:
−
* CHEBI:
+
** [http://www.uniprot.org/uniprot/P12000 P12000]
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=58627 58627]
+
** [http://www.uniprot.org/uniprot/P18858 P18858]
−
* LIGAND-CPD:
+
** [http://www.uniprot.org/uniprot/P35970 P35970]
−
** [http://www.genome.jp/dbget-bin/www_bget?C11857 C11857]
+
** [http://www.uniprot.org/uniprot/Q9QNG8 Q9QNG8]
−
{{#set: smiles=C=C1(C2(CC3(C1)(C([CH]4(C(C)(CCCC(C)([CH](CC2)3)4)C([O-])=O))C([O-])=O)))}}
+
** [http://www.uniprot.org/uniprot/Q9PM08 Q9PM08]
−
{{#set: inchi key=InChIKey=UJFQJDAESQJXTG-UFUZVNNQSA-L}}
+
** [http://www.uniprot.org/uniprot/Q57635 Q57635]
−
{{#set: common name=gibberellin A12}}
+
** [http://www.uniprot.org/uniprot/P49917 P49917]
−
{{#set: molecular weight=330.423    }}
+
** [http://www.uniprot.org/uniprot/P49916 P49916]
−
{{#set: common name=C20-GAs|open lactone gibberrellin skeleton|C20 skeleton|C20-GA skeleton|C20-gibberellin skeleton|GA12}}
+
** [http://www.uniprot.org/uniprot/P37913 P37913]
−
{{#set: consumed by=RXN1F-162}}
+
** [http://www.uniprot.org/uniprot/P51892 P51892]
−
{{#set: produced by=RXN1F-161}}
+
** [http://www.uniprot.org/uniprot/P16272 P16272]
 +
** [http://www.uniprot.org/uniprot/P33798 P33798]
 +
** [http://www.uniprot.org/uniprot/P00970 P00970]
 +
** [http://www.uniprot.org/uniprot/P00969 P00969]
 +
** [http://www.uniprot.org/uniprot/P04819 P04819]
 +
** [http://www.uniprot.org/uniprot/P19088 P19088]
 +
** [http://www.uniprot.org/uniprot/P07717 P07717]
 +
** [http://www.uniprot.org/uniprot/P26813 P26813]
 +
** [http://www.uniprot.org/uniprot/Q02093 Q02093]
 +
** [http://www.uniprot.org/uniprot/Q23694 Q23694]
 +
** [http://www.uniprot.org/uniprot/Q67480 Q67480]
 +
** [http://www.uniprot.org/uniprot/Q42572 Q42572]
 +
** [http://www.uniprot.org/uniprot/P20492 P20492]
 +
{{#set: direction=LEFT-TO-RIGHT}}
 +
{{#set: common name=DNA ligase (ATP)}}
 +
{{#set: ec number=EC-6.5.1.7}}
 +
{{#set: ec number=EC-6.5.1.1}}
 +
{{#set: ec number=EC-6.5.1.6}}
 +
{{#set: gene associated=Ec-01_011680|Ec-07_005930}}
 +
{{#set: in pathway=}}
 +
{{#set: reconstruction category=annotation}}
 +
{{#set: reconstruction source=annotation-esiliculosus_genome}}
 +
{{#set: reconstruction tool=pathwaytools}}

Latest revision as of 19:00, 21 March 2018

Reaction DNA-LIGASE-ATP-RXN

Reaction Formula

  • With identifiers:
  • With common name(s):
    • 1 DNAn[c] + 1 (deoxynucleotides)(m)[c] + 1 ATP[c] => 1 diphosphate[c] + 1 (deoxynucleotides)(m)[c] + 1 AMP[c]

Genes associated with this reaction

Genes have been associated with this reaction based on different elements listed below.

Pathways

Reconstruction information

External links






Retrieved from "http://gem-aureme.irisa.fr/ectogem/index.php?title=DNA-LIGASE-ATP-RXN&oldid=23835"