Difference between revisions of "CPD-18"
From metabolic_network
(Created page with "Category:Gene == Gene Ec-20_004590 == * left end position: ** 4686662 * transcription direction: ** POSITIVE * right end position: ** 4692429 * centisome position: ** 90.8...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-18 CPD-18] == * smiles: ** CCCCCC=CCC=CCCCCCCCC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=...") |
||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:Metabolite]] |
| − | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-18 CPD-18] == |
| − | * | + | * smiles: |
| − | ** | + | ** CCCCCC=CCC=CCCCCCCCC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-] |
| − | * | + | * inchi key: |
| − | ** | + | ** InChIKey=YECLLIMZHNYFCK-RRNJGNTNSA-J |
| − | * | + | * common name: |
| − | ** | + | ** linoleoyl-CoA |
| − | * | + | * molecular weight: |
| − | ** | + | ** 1025.937 |
* Synonym(s): | * Synonym(s): | ||
| − | ** | + | ** cis,cis-octadeca-9,12-dienoyl-CoA |
| − | ** | + | ** (9Z,12Z)-octadeca-9,12-dienoyl-CoA |
| + | ** 18:2(n-6) | ||
| − | == | + | == Reaction(s) known to consume the compound == |
| − | * | + | * [[1.14.19.3-RXN]] |
| − | ** | + | * [[RXN-16094]] |
| − | *** | + | * [[LINOLEOYL-RXN]] |
| − | == | + | == Reaction(s) known to produce the compound == |
| + | * [[RXN-16045]] | ||
| + | * [[RXN-9601]] | ||
| + | * [[RXN-9673]] | ||
| + | == Reaction(s) of unknown directionality == | ||
== External links == | == External links == | ||
| − | {{#set: | + | * PUBCHEM: |
| − | {{#set: | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25245440 25245440] |
| − | {{#set: | + | * CHEBI: |
| − | {{#set: | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=57383 57383] |
| − | {{#set: common name= | + | * LIGAND-CPD: |
| − | {{#set: | + | ** [http://www.genome.jp/dbget-bin/www_bget?C02050 C02050] |
| + | * HMDB : HMDB01064 | ||
| + | {{#set: smiles=CCCCCC=CCC=CCCCCCCCC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]}} | ||
| + | {{#set: inchi key=InChIKey=YECLLIMZHNYFCK-RRNJGNTNSA-J}} | ||
| + | {{#set: common name=linoleoyl-CoA}} | ||
| + | {{#set: molecular weight=1025.937 }} | ||
| + | {{#set: common name=cis,cis-octadeca-9,12-dienoyl-CoA|(9Z,12Z)-octadeca-9,12-dienoyl-CoA|18:2(n-6)}} | ||
| + | {{#set: consumed by=1.14.19.3-RXN|RXN-16094|LINOLEOYL-RXN}} | ||
| + | {{#set: produced by=RXN-16045|RXN-9601|RXN-9673}} | ||
Latest revision as of 19:35, 21 March 2018
Contents
Metabolite CPD-18
- smiles:
- CCCCCC=CCC=CCCCCCCCC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]
- inchi key:
- InChIKey=YECLLIMZHNYFCK-RRNJGNTNSA-J
- common name:
- linoleoyl-CoA
- molecular weight:
- 1025.937
- Synonym(s):
- cis,cis-octadeca-9,12-dienoyl-CoA
- (9Z,12Z)-octadeca-9,12-dienoyl-CoA
- 18:2(n-6)
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"CCCCCC=CCC=CCCCCCCCC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-" cannot be used as a page name in this wiki.
