Difference between revisions of "CPD-13188"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD0-2117 CPD0-2117] == * smiles: ** CCCCCCCCCCCCCC=CC(=O)SCCNC(=O)CCNC(C(O)C(C)(C)COP([O-])(=O...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-13188 CPD-13188] == * smiles: ** CC2(OC(OC1(C(O)C(O)OC(CO)C(O)1))C(O)C(O)C2OC3(OC(CO)C(C(O)...") |
||
Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
− | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-13188 CPD-13188] == |
* smiles: | * smiles: | ||
− | ** | + | ** CC2(OC(OC1(C(O)C(O)OC(CO)C(O)1))C(O)C(O)C2OC3(OC(CO)C(C(O)C(O)3)O)) |
* inchi key: | * inchi key: | ||
− | ** InChIKey= | + | ** InChIKey=CWVRQJBCBCTFLT-XXFCETQUSA-N |
* common name: | * common name: | ||
− | ** | + | ** β-D-Glcp-(1→4)-α-L-Rhap-(1→3)-β-D-Glcp |
* molecular weight: | * molecular weight: | ||
− | ** | + | ** 488.442 |
* Synonym(s): | * Synonym(s): | ||
− | |||
− | |||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
+ | * [[RXN-12270]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
== External links == | == External links == | ||
− | |||
− | |||
− | |||
− | |||
* LIGAND-CPD: | * LIGAND-CPD: | ||
− | ** [http://www.genome.jp/dbget-bin/www_bget? | + | ** [http://www.genome.jp/dbget-bin/www_bget?C19966 C19966] |
* CHEBI: | * CHEBI: | ||
− | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId= | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=63259 63259] |
− | * | + | * PUBCHEM: |
− | {{#set: smiles= | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=52940204 52940204] |
− | {{#set: inchi key=InChIKey= | + | {{#set: smiles=CC2(OC(OC1(C(O)C(O)OC(CO)C(O)1))C(O)C(O)C2OC3(OC(CO)C(C(O)C(O)3)O))}} |
− | {{#set: common name= | + | {{#set: inchi key=InChIKey=CWVRQJBCBCTFLT-XXFCETQUSA-N}} |
− | {{#set: molecular weight= | + | {{#set: common name=β-D-Glcp-(1→4)-α-L-Rhap-(1→3)-β-D-Glcp}} |
− | {{#set: | + | {{#set: molecular weight=488.442 }} |
− | + | {{#set: produced by=RXN-12270}} |
Latest revision as of 19:36, 21 March 2018
Contents
Metabolite CPD-13188
- smiles:
- CC2(OC(OC1(C(O)C(O)OC(CO)C(O)1))C(O)C(O)C2OC3(OC(CO)C(C(O)C(O)3)O))
- inchi key:
- InChIKey=CWVRQJBCBCTFLT-XXFCETQUSA-N
- common name:
- β-D-Glcp-(1→4)-α-L-Rhap-(1→3)-β-D-Glcp
- molecular weight:
- 488.442
- Synonym(s):
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links