Difference between revisions of "CPD-8620"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Non-Glycosylated-sugar-Acceptors Non-Glycosylated-sugar-Acceptors] == * common name: ** a non g...")
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-8620 CPD-8620] == * smiles: ** CC(C)CCCC([CH]4(C1(C)([CH](C2(=C(CC1)C3(C)([CH](CC2)CC(=O)CC...")
 
Line 1: Line 1:
 
[[Category:Metabolite]]
 
[[Category:Metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Non-Glycosylated-sugar-Acceptors Non-Glycosylated-sugar-Acceptors] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-8620 CPD-8620] ==
 +
* smiles:
 +
** CC(C)CCCC([CH]4(C1(C)([CH](C2(=C(CC1)C3(C)([CH](CC2)CC(=O)CC3)))CC4)))C
 +
* inchi key:
 +
** InChIKey=RZSXSHNNQBIPTL-ZSBATXSLSA-N
 
* common name:
 
* common name:
** a non glycosylated sugar acceptor
+
** 5α-cholesta-8-en-3-one
 +
* molecular weight:
 +
** 384.644   
 
* Synonym(s):
 
* Synonym(s):
** a non glycosylated sugar donor
 
  
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[3.2.1.24-RXN]]
+
* [[RXN66-23]]
* [[3.2.1.25-RXN]]
+
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
 
== External links  ==
 
== External links  ==
{{#set: common name=a non glycosylated sugar acceptor}}
+
* PUBCHEM:
{{#set: common name=a non glycosylated sugar donor}}
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25203379 25203379]
{{#set: produced by=3.2.1.24-RXN|3.2.1.25-RXN}}
+
* HMDB : HMDB12178
 +
{{#set: smiles=CC(C)CCCC([CH]4(C1(C)([CH](C2(=C(CC1)C3(C)([CH](CC2)CC(=O)CC3)))CC4)))C}}
 +
{{#set: inchi key=InChIKey=RZSXSHNNQBIPTL-ZSBATXSLSA-N}}
 +
{{#set: common name=5α-cholesta-8-en-3-one}}
 +
{{#set: molecular weight=384.644    }}
 +
{{#set: produced by=RXN66-23}}

Latest revision as of 19:36, 21 March 2018

Metabolite CPD-8620

  • smiles:
    • CC(C)CCCC([CH]4(C1(C)([CH](C2(=C(CC1)C3(C)([CH](CC2)CC(=O)CC3)))CC4)))C
  • inchi key:
    • InChIKey=RZSXSHNNQBIPTL-ZSBATXSLSA-N
  • common name:
    • 5α-cholesta-8-en-3-one
  • molecular weight:
    • 384.644
  • Synonym(s):

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"CC(C)CCCC([CH]4(C1(C)([CH](C2(=C(CC1)C3(C)([CH](CC2)CC(=O)CC3)))CC4)))C" cannot be used as a page name in this wiki.