Difference between revisions of "CPD-236"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RIBOFLAVINKIN-RXN RIBOFLAVINKIN-RXN] == * direction: ** LEFT-TO-RIGHT * common name: ** riboflavin...")
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-236 CPD-236] == * smiles: ** C=C1(C3(O)(CC4(C1)(C([CH]5(C2(C(=O)OC(CC(O)C2)([CH](CC3)4)5)(C...")
 
Line 1: Line 1:
−
[[Category:Reaction]]
+
[[Category:Metabolite]]
−
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RIBOFLAVINKIN-RXN RIBOFLAVINKIN-RXN] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-236 CPD-236] ==
−
* direction:
+
* smiles:
−
** LEFT-TO-RIGHT
+
** C=C1(C3(O)(CC4(C1)(C([CH]5(C2(C(=O)OC(CC(O)C2)([CH](CC3)4)5)(C)))C([O-])=O)))
 +
* inchi key:
 +
** InChIKey=BKBYHSYZKIAJDA-LPEMZMRWSA-M
 
* common name:
 
* common name:
−
** riboflavin kinase
+
** gibberellin A29
−
* ec number:
+
* molecular weight:
−
** [http://enzyme.expasy.org/EC/2.7.1.26 EC-2.7.1.26]
+
** 347.387   
 
* Synonym(s):
 
* Synonym(s):
 +
** GA29
  
−
== Reaction Formula ==
+
== Reaction(s) known to consume the compound ==
−
* With identifiers:
+
== Reaction(s) known to produce the compound ==
−
** 1 [[RIBOFLAVIN]][c] '''+''' 1 [[ATP]][c] '''=>''' 1 [[ADP]][c] '''+''' 1 [[PROTON]][c] '''+''' 1 [[FMN]][c]
+
* [[RXN-113]]
−
* With common name(s):
+
== Reaction(s) of unknown directionality ==
−
** 1 riboflavin[c] '''+''' 1 ATP[c] '''=>''' 1 ADP[c] '''+''' 1 H+[c] '''+''' 1 FMN[c]
+
−
 
+
−
== Genes associated with this reaction  ==
+
−
Genes have been associated with this reaction based on different elements listed below.
+
−
* Gene: [[Ec-04_001490]]
+
−
** Source: [[orthology-aragem]]
+
−
* Gene: [[Ec-04_004280]]
+
−
** Source: [[annotation-esiliculosus_genome]]
+
−
*** Assignment: GO-TERM
+
−
* Gene: [[Ec-10_002950]]
+
−
** Source: [[annotation-esiliculosus_genome]]
+
−
*** Assignment: GO-TERM
+
−
* Gene: [[Ec-14_005260]]
+
−
** Source: [[annotation-esiliculosus_genome]]
+
−
*** Assignment: GO-TERM
+
−
== Pathways  ==
+
−
* [[PWY66-366]], flavin biosynthesis IV (mammalian): [http://metacyc.org/META/NEW-IMAGE?object=PWY66-366 PWY66-366]
+
−
** '''2''' reactions found over '''2''' reactions in the full pathway
+
−
* [[PWY-6168]], flavin biosynthesis III (fungi): [http://metacyc.org/META/NEW-IMAGE?object=PWY-6168 PWY-6168]
+
−
** '''6''' reactions found over '''9''' reactions in the full pathway
+
−
* [[RIBOSYN2-PWY]], flavin biosynthesis I (bacteria and plants): [http://metacyc.org/META/NEW-IMAGE?object=RIBOSYN2-PWY RIBOSYN2-PWY]
+
−
** '''8''' reactions found over '''9''' reactions in the full pathway
+
−
* [[PWY-5523]], 5,6-dimethylbenzimidazole biosynthesis I (aerobic): [http://metacyc.org/META/NEW-IMAGE?object=PWY-5523 PWY-5523]
+
−
** '''1''' reactions found over '''3''' reactions in the full pathway
+
−
== Reconstruction information  ==
+
−
* Category: [[orthology]]
+
−
** Source: [[orthology-aragem]]
+
−
*** Tool: [[pantograph]]
+
−
* Category: [[annotation]]
+
−
** Source: [[annotation-esiliculosus_genome]]
+
−
*** Tool: [[pathwaytools]]
+
 
== External links  ==
 
== External links  ==
−
* RHEA:
+
* PUBCHEM:
−
** [http://www.ebi.ac.uk/rhea/reaction.xhtml?id=14357 14357]
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25200412 25200412]
−
* LIGAND-RXN:
+
* CHEBI:
−
** [http://www.genome.jp/dbget-bin/www_bget?R00549 R00549]
+
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=28040 28040]
−
* UNIPROT:
+
* LIGAND-CPD:
−
** [http://www.uniprot.org/uniprot/Q9JVY5 Q9JVY5]
+
** [http://www.genome.jp/dbget-bin/www_bget?C06096 C06096]
−
** [http://www.uniprot.org/uniprot/Q9PHS7 Q9PHS7]
+
{{#set: smiles=C=C1(C3(O)(CC4(C1)(C([CH]5(C2(C(=O)OC(CC(O)C2)([CH](CC3)4)5)(C)))C([O-])=O)))}}
−
** [http://www.uniprot.org/uniprot/Q59263 Q59263]
+
{{#set: inchi key=InChIKey=BKBYHSYZKIAJDA-LPEMZMRWSA-M}}
−
{{#set: direction=LEFT-TO-RIGHT}}
+
{{#set: common name=gibberellin A29}}
−
{{#set: common name=riboflavin kinase}}
+
{{#set: molecular weight=347.387    }}
−
{{#set: ec number=EC-2.7.1.26}}
+
{{#set: common name=GA29}}
−
{{#set: gene associated=Ec-04_001490|Ec-04_004280|Ec-10_002950|Ec-14_005260}}
+
{{#set: produced by=RXN-113}}
−
{{#set: in pathway=PWY66-366|PWY-6168|RIBOSYN2-PWY|PWY-5523}}
+
−
{{#set: reconstruction category=orthology|annotation}}
+
−
{{#set: reconstruction source=annotation-esiliculosus_genome|orthology-aragem}}
+
−
{{#set: reconstruction tool=pantograph|pathwaytools}}
+

Latest revision as of 19:37, 21 March 2018

Metabolite CPD-236

  • smiles:
    • C=C1(C3(O)(CC4(C1)(C([CH]5(C2(C(=O)OC(CC(O)C2)([CH](CC3)4)5)(C)))C([O-])=O)))
  • inchi key:
    • InChIKey=BKBYHSYZKIAJDA-LPEMZMRWSA-M
  • common name:
    • gibberellin A29
  • molecular weight:
    • 347.387
  • Synonym(s):
    • GA29

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"C=C1(C3(O)(CC4(C1)(C([CH]5(C2(C(=O)OC(CC(O)C2)([CH](CC3)4)5)(C)))C([O-])=O)))" cannot be used as a page name in this wiki.



Retrieved from "http://gem-aureme.irisa.fr/ectogem/index.php?title=CPD-236&oldid=28249"