Difference between revisions of "Ec-00 002050"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-19153 CPD-19153] == * smiles: ** CCCCCCC=CCC(=O)CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(O...")
(Created page with "Category:Gene == Gene Ec-00_002050 == * left end position: ** 2273622 * transcription direction: ** POSITIVE * right end position: ** 2285801 * centisome position: ** 12.0...")
 
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Gene]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-19153 CPD-19153] ==
+
== Gene Ec-00_002050 ==
−
* smiles:
+
* left end position:
−
** CCCCCCC=CCC(=O)CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]
+
** 2273622
−
* inchi key:
+
* transcription direction:
−
** InChIKey=VKLHSLOWDWGVGP-CGGPSVLLSA-J
+
** POSITIVE
−
* common name:
+
* right end position:
−
** 3-oxo-(5Z)-dodecenoyl-CoA
+
** 2285801
−
* molecular weight:
+
* centisome position:
−
** 957.775    
+
** 12.000265    
 
* Synonym(s):
 
* Synonym(s):
−
** 3-oxo-12:1-Δ5-CoA
+
** Esi_0013_0201
−
** 3-oxo-5-cis-dodecenoyl-CoA
+
** Esi0013_0201
 +
** CAMK
  
−
== Reaction(s) known to consume the compound ==
+
== Reactions associated ==
−
== Reaction(s) known to produce the compound ==
+
* Reaction: [[PROTEIN-KINASE-RXN]]
−
* [[RXN-17798]]
+
** Source: [[annotation-esiliculosus_genome]]
−
== Reaction(s) of unknown directionality ==
+
*** Assignment: go-term
 +
== Pathways associated ==
 
== External links  ==
 
== External links  ==
−
{{#set: smiles=CCCCCCC=CCC(=O)CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]}}
+
{{#set: left end position=2273622}}
−
{{#set: inchi key=InChIKey=VKLHSLOWDWGVGP-CGGPSVLLSA-J}}
+
{{#set: transcription direction=POSITIVE}}
−
{{#set: common name=3-oxo-(5Z)-dodecenoyl-CoA}}
+
{{#set: right end position=2285801}}
−
{{#set: molecular weight=957.775   }}
+
{{#set: centisome position=12.000265   }}
−
{{#set: common name=3-oxo-12:1-Δ5-CoA|3-oxo-5-cis-dodecenoyl-CoA}}
+
{{#set: common name=Esi_0013_0201|Esi0013_0201|CAMK}}
−
{{#set: produced by=RXN-17798}}
+
{{#set: reaction associated=PROTEIN-KINASE-RXN}}

Latest revision as of 19:37, 21 March 2018

Gene Ec-00_002050

  • left end position:
    • 2273622
  • transcription direction:
    • POSITIVE
  • right end position:
    • 2285801
  • centisome position:
    • 12.000265
  • Synonym(s):
    • Esi_0013_0201
    • Esi0013_0201
    • CAMK

Reactions associated

Pathways associated

External links

Retrieved from "http://gem-aureme.irisa.fr/ectogem/index.php?title=Ec-00_002050&oldid=28286"