Difference between revisions of "CPD-7003"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=3.4.21.53-RXN 3.4.21.53-RXN] == * direction: ** LEFT-TO-RIGHT * common name: ** putative ATP-depend...")
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-7003 CPD-7003] == * smiles: ** CC(=CCCC(CCCC(CCCC(=CCOP([O-])(=O)OP([O-])(=O)[O-])C)C)C)C *...")
 
Line 1: Line 1:
−
[[Category:Reaction]]
+
[[Category:Metabolite]]
−
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=3.4.21.53-RXN 3.4.21.53-RXN] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-7003 CPD-7003] ==
−
* direction:
+
* smiles:
−
** LEFT-TO-RIGHT
+
** CC(=CCCC(CCCC(CCCC(=CCOP([O-])(=O)OP([O-])(=O)[O-])C)C)C)C
 +
* inchi key:
 +
** InChIKey=VZBGWADXUJSBTI-PYDDKJGSSA-K
 
* common name:
 
* common name:
−
** putative ATP-dependent proteinase, possible LON protease
+
** tetrahydrogeranylgeranyl diphosphate
−
* ec number:
+
* molecular weight:
−
** [http://enzyme.expasy.org/EC/3.4.21.53 EC-3.4.21.53]
+
** 451.456   
 
* Synonym(s):
 
* Synonym(s):
 +
** tetrahydroGGPP
 +
** tetrahydrogeranylgeranyl pyrophosphate
 +
** tetrahydrogeranylgeranyl-PP
  
−
== Reaction Formula ==
+
== Reaction(s) known to consume the compound ==
−
* With identifiers:
+
* [[RXN-7660]]
−
** 1 [[General-Protein-Substrates]][c] '''+''' 1 [[WATER]][c] '''=>''' 1 [[Peptides-holder]][c]
+
== Reaction(s) known to produce the compound ==
−
* With common name(s):
+
* [[RXN-7659]]
−
** 1 a protein[c] '''+''' 1 H2O[c] '''=>''' 1 a peptide[c]
+
== Reaction(s) of unknown directionality ==
−
 
+
−
== Genes associated with this reaction  ==
+
−
Genes have been associated with this reaction based on different elements listed below.
+
−
* Gene: [[Ec-25_003740]]
+
−
** Source: [[annotation-esiliculosus_genome]]
+
−
*** Assignment: AUTOMATED-NAME-MATCH
+
−
== Pathways  ==
+
−
== Reconstruction information  ==
+
−
* Category: [[annotation]]
+
−
** Source: [[annotation-esiliculosus_genome]]
+
−
*** Tool: [[pathwaytools]]
+
 
== External links  ==
 
== External links  ==
−
* UNIPROT:
+
* PUBCHEM:
−
** [http://www.uniprot.org/uniprot/P36774 P36774]
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=90657275 90657275]
−
** [http://www.uniprot.org/uniprot/P36773 P36773]
+
{{#set: smiles=CC(=CCCC(CCCC(CCCC(=CCOP([O-])(=O)OP([O-])(=O)[O-])C)C)C)C}}
−
** [http://www.uniprot.org/uniprot/P43864 P43864]
+
{{#set: inchi key=InChIKey=VZBGWADXUJSBTI-PYDDKJGSSA-K}}
−
** [http://www.uniprot.org/uniprot/O66605 O66605]
+
{{#set: common name=tetrahydrogeranylgeranyl diphosphate}}
−
** [http://www.uniprot.org/uniprot/Q9ZD92 Q9ZD92]
+
{{#set: molecular weight=451.456    }}
−
** [http://www.uniprot.org/uniprot/Q9ZJL3 Q9ZJL3]
+
{{#set: common name=tetrahydroGGPP|tetrahydrogeranylgeranyl pyrophosphate|tetrahydrogeranylgeranyl-PP}}
−
** [http://www.uniprot.org/uniprot/Q9X1W8 Q9X1W8]
+
{{#set: consumed by=RXN-7660}}
−
** [http://www.uniprot.org/uniprot/O83536 O83536]
+
{{#set: produced by=RXN-7659}}
−
** [http://www.uniprot.org/uniprot/Q9Z9F4 Q9Z9F4]
+
−
** [http://www.uniprot.org/uniprot/P55995 P55995]
+
−
** [http://www.uniprot.org/uniprot/O84348 O84348]
+
−
** [http://www.uniprot.org/uniprot/P47481 P47481]
+
−
** [http://www.uniprot.org/uniprot/O51558 O51558]
+
−
** [http://www.uniprot.org/uniprot/O69300 O69300]
+
−
** [http://www.uniprot.org/uniprot/Q59185 Q59185]
+
−
** [http://www.uniprot.org/uniprot/Q9JUC0 Q9JUC0]
+
−
** [http://www.uniprot.org/uniprot/P37945 P37945]
+
−
** [http://www.uniprot.org/uniprot/P77810 P77810]
+
−
** [http://www.uniprot.org/uniprot/P46067 P46067]
+
−
** [http://www.uniprot.org/uniprot/P78025 P78025]
+
−
** [http://www.uniprot.org/uniprot/Q59511 Q59511]
+
−
** [http://www.uniprot.org/uniprot/P0A9M0 P0A9M0]
+
−
{{#set: direction=LEFT-TO-RIGHT}}
+
−
{{#set: common name=putative ATP-dependent proteinase, possible LON protease}}
+
−
{{#set: ec number=EC-3.4.21.53}}
+
−
{{#set: gene associated=Ec-25_003740}}
+
−
{{#set: in pathway=}}
+
−
{{#set: reconstruction category=annotation}}
+
−
{{#set: reconstruction source=annotation-esiliculosus_genome}}
+
−
{{#set: reconstruction tool=pathwaytools}}
+

Latest revision as of 19:37, 21 March 2018

Metabolite CPD-7003

  • smiles:
    • CC(=CCCC(CCCC(CCCC(=CCOP([O-])(=O)OP([O-])(=O)[O-])C)C)C)C
  • inchi key:
    • InChIKey=VZBGWADXUJSBTI-PYDDKJGSSA-K
  • common name:
    • tetrahydrogeranylgeranyl diphosphate
  • molecular weight:
    • 451.456
  • Synonym(s):
    • tetrahydroGGPP
    • tetrahydrogeranylgeranyl pyrophosphate
    • tetrahydrogeranylgeranyl-PP

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"CC(=CCCC(CCCC(CCCC(=CCOP([O-])(=O)OP([O-])(=O)[O-])C)C)C)C" cannot be used as a page name in this wiki.




Retrieved from "http://gem-aureme.irisa.fr/ectogem/index.php?title=CPD-7003&oldid=28288"