Difference between revisions of "CPD-17049"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Gene == Gene Ec-22_002850 == * left end position: ** 3067633 * transcription direction: ** POSITIVE * right end position: ** 3074449 * centisome position: ** 67.9...")
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-17049 CPD-17049] == * smiles: ** C(O)C2(S)(NC(=O)C(S)(CC1(=CC=CC=C1))NC(=O)2) * inchi key:...")
 
Line 1: Line 1:
[[Category:Gene]]
+
[[Category:Metabolite]]
== Gene Ec-22_002850 ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-17049 CPD-17049] ==
* left end position:
+
* smiles:
** 3067633
+
** C(O)C2(S)(NC(=O)C(S)(CC1(=CC=CC=C1))NC(=O)2)
* transcription direction:
+
* inchi key:
** POSITIVE
+
** InChIKey=VZGSJJJQZPTKGR-VXGBXAGGSA-N
* right end position:
+
* common name:
** 3074449
+
** 3-benzyl-3,6 -dithio-6-(hydroxymethyl)-diketopiperazine
* centisome position:
+
* molecular weight:
** 67.93034    
+
** 298.374    
 
* Synonym(s):
 
* Synonym(s):
** Esi_0091_0098
+
** 3-benzyl-3,6 -dithio-6-(hydroxymethyl)-DKP
** Esi0091_0098
+
** 3-benzyl-3,6 -dithio-6-(hydroxymethyl)piperazine-2,5-dione
** ACAT1
+
** 3-benzyl-3,6 -disulfanyl- 6-(hydroxymethyl)-diketopiperazine
 +
** 3-benzyl-3,6 -disulfanyl- 6-(hydroxymethyl)-DKP
 +
** 3-benzyl-3,6 -disulfanyl- 6-(hydroxymethyl)piperazine-2,5-dione
  
== Reactions associated ==
+
== Reaction(s) known to consume the compound ==
* Reaction: [[ACETYL-COA-ACETYLTRANSFER-RXN]]
+
* [[RXN-15684]]
** Source: [[annotation-esiliculosus_genome]]
+
== Reaction(s) known to produce the compound ==
*** Assignment: ec-number
+
== Reaction(s) of unknown directionality ==
** Source: [[orthology-aragem]]
+
** Source: [[orthology-aragem]]
+
** Source: [[orthology-aragem]]
+
** Source: [[orthology-aragem]]
+
* Reaction: [[METHYLACETOACETYLCOATHIOL-RXN]]
+
** Source: [[annotation-esiliculosus_genome]]
+
*** Assignment: ec-number
+
* Reaction: [[RXN-12561]]
+
** Source: [[annotation-esiliculosus_genome]]
+
*** Assignment: ec-number
+
* Reaction: [[RXN-12565]]
+
** Source: [[orthology-aragem]]
+
== Pathways associated ==
+
* [[P162-PWY]]
+
* [[PWY-5177]]
+
* [[PWY-6583]]
+
* [[P163-PWY]]
+
* [[PWY-6883]]
+
* [[PWY-5676]]
+
* [[PWY-6588]]
+
* [[PWY-7779]]
+
* [[PWY-7778]]
+
* [[PWY1-3]]
+
* [[PWY-5789]]
+
* [[PWY-6876]]
+
* [[CENTFERM-PWY]]
+
* [[PWY-7391]]
+
* [[PWY-5741]]
+
* [[PWY-5109]]
+
* [[PWY-6174]]
+
* [[ACETOACETATE-DEG-PWY]]
+
* [[PWY66-367]]
+
* [[ILEUDEG-PWY]]
+
* [[PWY-7216]]
+
* [[PWY-922]]
+
* [[PWY66-368]]
+
* [[PWY-7401]]
+
* [[PWY-6863]]
+
* [[PWY-7524]]
+
 
== External links  ==
 
== External links  ==
{{#set: left end position=3067633}}
+
* PUBCHEM:
{{#set: transcription direction=POSITIVE}}
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=90658023 90658023]
{{#set: right end position=3074449}}
+
{{#set: smiles=C(O)C2(S)(NC(=O)C(S)(CC1(=CC=CC=C1))NC(=O)2)}}
{{#set: centisome position=67.93034   }}
+
{{#set: inchi key=InChIKey=VZGSJJJQZPTKGR-VXGBXAGGSA-N}}
{{#set: common name=Esi_0091_0098|Esi0091_0098|ACAT1}}
+
{{#set: common name=3-benzyl-3,6 -dithio-6-(hydroxymethyl)-diketopiperazine}}
{{#set: reaction associated=ACETYL-COA-ACETYLTRANSFER-RXN|METHYLACETOACETYLCOATHIOL-RXN|RXN-12561|RXN-12565}}
+
{{#set: molecular weight=298.374   }}
{{#set: pathway associated=P162-PWY|PWY-5177|PWY-6583|P163-PWY|PWY-6883|PWY-5676|PWY-6588|PWY-7779|PWY-7778|PWY1-3|PWY-5789|PWY-6876|CENTFERM-PWY|PWY-7391|PWY-5741|PWY-5109|PWY-6174|ACETOACETATE-DEG-PWY|PWY66-367|ILEUDEG-PWY|PWY-7216|PWY-922|PWY66-368|PWY-7401|PWY-6863|PWY-7524}}
+
{{#set: common name=3-benzyl-3,6 -dithio-6-(hydroxymethyl)-DKP|3-benzyl-3,6 -dithio-6-(hydroxymethyl)piperazine-2,5-dione|3-benzyl-3,6 -disulfanyl- 6-(hydroxymethyl)-diketopiperazine|3-benzyl-3,6 -disulfanyl- 6-(hydroxymethyl)-DKP|3-benzyl-3,6 -disulfanyl- 6-(hydroxymethyl)piperazine-2,5-dione}}
 +
{{#set: consumed by=RXN-15684}}

Latest revision as of 19:38, 21 March 2018

Metabolite CPD-17049

  • smiles:
    • C(O)C2(S)(NC(=O)C(S)(CC1(=CC=CC=C1))NC(=O)2)
  • inchi key:
    • InChIKey=VZGSJJJQZPTKGR-VXGBXAGGSA-N
  • common name:
    • 3-benzyl-3,6 -dithio-6-(hydroxymethyl)-diketopiperazine
  • molecular weight:
    • 298.374
  • Synonym(s):
    • 3-benzyl-3,6 -dithio-6-(hydroxymethyl)-DKP
    • 3-benzyl-3,6 -dithio-6-(hydroxymethyl)piperazine-2,5-dione
    • 3-benzyl-3,6 -disulfanyl- 6-(hydroxymethyl)-diketopiperazine
    • 3-benzyl-3,6 -disulfanyl- 6-(hydroxymethyl)-DKP
    • 3-benzyl-3,6 -disulfanyl- 6-(hydroxymethyl)piperazine-2,5-dione

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links