Difference between revisions of "SECOLOGANIN-CPD"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-15301 CPD-15301] == * smiles: ** CC(C)CCCC(C)CCCC(C)CCCC(C)CCCC(C)CCCC(C)CCC2(C(SC)=C(O)C1(...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=SECOLOGANIN-CPD SECOLOGANIN-CPD] == * smiles: ** C=C[CH]1(C(OC=C(C(=O)OC)[CH](CC=O)1)OC2(OC(CO)...") |
||
Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
− | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=SECOLOGANIN-CPD SECOLOGANIN-CPD] == |
* smiles: | * smiles: | ||
− | ** | + | ** C=C[CH]1(C(OC=C(C(=O)OC)[CH](CC=O)1)OC2(OC(CO)C(O)C(O)C(O)2)) |
* inchi key: | * inchi key: | ||
− | ** InChIKey= | + | ** InChIKey=CSKKDSFETGLMSB-NRZPKYKESA-N |
* common name: | * common name: | ||
− | ** | + | ** secologanin |
* molecular weight: | * molecular weight: | ||
− | ** | + | ** 388.371 |
* Synonym(s): | * Synonym(s): | ||
+ | ** (-)-secologanin | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
+ | * [[STRICTOSIDINE-SYNTHASE-RXN]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | |||
− | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
== External links == | == External links == | ||
− | * | + | * LIPID_MAPS : LMPR0102070002 |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
* PUBCHEM: | * PUBCHEM: | ||
− | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid= | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=161276 161276] |
− | {{#set: smiles= | + | * CHEMSPIDER: |
− | {{#set: inchi key=InChIKey= | + | ** [http://www.chemspider.com/Chemical-Structure.141670.html 141670] |
− | {{#set: common name= | + | * CHEBI: |
− | {{#set: molecular weight= | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=18002 18002] |
− | {{#set: | + | * LIGAND-CPD: |
+ | ** [http://www.genome.jp/dbget-bin/www_bget?C01852 C01852] | ||
+ | {{#set: smiles=C=C[CH]1(C(OC=C(C(=O)OC)[CH](CC=O)1)OC2(OC(CO)C(O)C(O)C(O)2))}} | ||
+ | {{#set: inchi key=InChIKey=CSKKDSFETGLMSB-NRZPKYKESA-N}} | ||
+ | {{#set: common name=secologanin}} | ||
+ | {{#set: molecular weight=388.371 }} | ||
+ | {{#set: common name=(-)-secologanin}} | ||
+ | {{#set: consumed by=STRICTOSIDINE-SYNTHASE-RXN}} |
Latest revision as of 19:38, 21 March 2018
Contents
Metabolite SECOLOGANIN-CPD
- smiles:
- C=C[CH]1(C(OC=C(C(=O)OC)[CH](CC=O)1)OC2(OC(CO)C(O)C(O)C(O)2))
- inchi key:
- InChIKey=CSKKDSFETGLMSB-NRZPKYKESA-N
- common name:
- secologanin
- molecular weight:
- 388.371
- Synonym(s):
- (-)-secologanin
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"C=C[CH]1(C(OC=C(C(=O)OC)[CH](CC=O)1)OC2(OC(CO)C(O)C(O)C(O)2))" cannot be used as a page name in this wiki.