Difference between revisions of "CPD-15301"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-14900 CPD-14900] == * smiles: ** CCC(C(C)C)CCC(C)[CH]3(CC[CH]4(C2(=CC=C1(CC(O)CCC(C)1[CH]2C...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-15301 CPD-15301] == * smiles: ** CC(C)CCCC(C)CCCC(C)CCCC(C)CCCC(C)CCCC(C)CCC2(C(SC)=C(O)C1(...") |
||
| Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
| − | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD- | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-15301 CPD-15301] == |
* smiles: | * smiles: | ||
| − | ** | + | ** CC(C)CCCC(C)CCCC(C)CCCC(C)CCCC(C)CCCC(C)CCC2(C(SC)=C(O)C1(=C(SC=C1)C(O)=2)) |
* inchi key: | * inchi key: | ||
| − | ** InChIKey= | + | ** InChIKey=UVCQOKDZGIAHDG-UHFFFAOYSA-N |
* common name: | * common name: | ||
| − | ** | + | ** caldariellaquinol |
* molecular weight: | * molecular weight: | ||
| − | ** | + | ** 633.085 |
* Synonym(s): | * Synonym(s): | ||
| − | |||
| − | |||
| − | |||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[RXN- | + | * [[RXN-14451]] |
| + | * [[RXN-15378]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
== External links == | == External links == | ||
| − | * | + | * LIGAND-CPD: |
| + | ** [http://www.genome.jp/dbget-bin/www_bget?C20623 C20623] | ||
| + | * CHEBI: | ||
| + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=73388 73388] | ||
| + | * METABOLIGHTS : MTBLC73388 | ||
* PUBCHEM: | * PUBCHEM: | ||
| − | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid= | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=71464569 71464569] |
| − | {{#set: smiles= | + | {{#set: smiles=CC(C)CCCC(C)CCCC(C)CCCC(C)CCCC(C)CCCC(C)CCC2(C(SC)=C(O)C1(=C(SC=C1)C(O)=2))}} |
| − | {{#set: inchi key=InChIKey= | + | {{#set: inchi key=InChIKey=UVCQOKDZGIAHDG-UHFFFAOYSA-N}} |
| − | {{#set: common name= | + | {{#set: common name=caldariellaquinol}} |
| − | {{#set: molecular weight= | + | {{#set: molecular weight=633.085 }} |
| − | {{#set: | + | {{#set: produced by=RXN-14451|RXN-15378}} |
| − | + | ||
Latest revision as of 19:39, 21 March 2018
Contents
Metabolite CPD-15301
- smiles:
- CC(C)CCCC(C)CCCC(C)CCCC(C)CCCC(C)CCCC(C)CCC2(C(SC)=C(O)C1(=C(SC=C1)C(O)=2))
- inchi key:
- InChIKey=UVCQOKDZGIAHDG-UHFFFAOYSA-N
- common name:
- caldariellaquinol
- molecular weight:
- 633.085
- Synonym(s):
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
