Difference between revisions of "OXALO-SUCCINATE"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD1F-126 CPD1F-126] == * smiles: ** CC(=CCCC(=CC=CC(=CC=CC(=CC=CC=C(C=CC=C(C=CC1(C(C)(C)CCCC=1...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=OXALO-SUCCINATE OXALO-SUCCINATE] == * smiles: ** C(C([O-])=O)C(C(C(=O)[O-])=O)C([O-])=O * inchi...") |
||
| Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
| − | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=OXALO-SUCCINATE OXALO-SUCCINATE] == |
* smiles: | * smiles: | ||
| − | ** | + | ** C(C([O-])=O)C(C(C(=O)[O-])=O)C([O-])=O |
* inchi key: | * inchi key: | ||
| − | ** InChIKey= | + | ** InChIKey=UFSCUAXLTRFIDC-UHFFFAOYSA-K |
* common name: | * common name: | ||
| − | ** | + | ** oxalosuccinate |
* molecular weight: | * molecular weight: | ||
| − | ** | + | ** 187.085 |
* Synonym(s): | * Synonym(s): | ||
| − | ** | + | ** oxalo-succ |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| + | * [[RXN-8642]] | ||
| + | * [[RXN-9951]] | ||
== External links == | == External links == | ||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
* LIGAND-CPD: | * LIGAND-CPD: | ||
| − | ** [http://www.genome.jp/dbget-bin/www_bget? | + | ** [http://www.genome.jp/dbget-bin/www_bget?C05379 C05379] |
| − | {{#set: smiles | + | * CHEBI: |
| − | {{#set: inchi key=InChIKey= | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=58931 58931] |
| − | {{#set: common name= | + | * METABOLIGHTS : MTBLC58931 |
| − | {{#set: molecular weight= | + | * PUBCHEM: |
| − | {{#set: common name= | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25244267 25244267] |
| − | {{#set: | + | * HMDB : HMDB03974 |
| − | + | {{#set: smiles=C(C([O-])=O)C(C(C(=O)[O-])=O)C([O-])=O}} | |
| + | {{#set: inchi key=InChIKey=UFSCUAXLTRFIDC-UHFFFAOYSA-K}} | ||
| + | {{#set: common name=oxalosuccinate}} | ||
| + | {{#set: molecular weight=187.085 }} | ||
| + | {{#set: common name=oxalo-succ}} | ||
| + | {{#set: reversible reaction associated=RXN-8642|RXN-9951}} | ||
Latest revision as of 19:40, 21 March 2018
Contents
Metabolite OXALO-SUCCINATE
- smiles:
- C(C([O-])=O)C(C(C(=O)[O-])=O)C([O-])=O
- inchi key:
- InChIKey=UFSCUAXLTRFIDC-UHFFFAOYSA-K
- common name:
- oxalosuccinate
- molecular weight:
- 187.085
- Synonym(s):
- oxalo-succ
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"C(C([O-])=O)C(C(C(=O)[O-])=O)C([O-])=O" cannot be used as a page name in this wiki.
