Difference between revisions of "CPD-7006"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN6666-4 RXN6666-4] == * direction: ** LEFT-TO-RIGHT * ec number: ** [http://enzyme.expasy.org/EC/...")
 
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-7006 CPD-7006] == * smiles: ** C=CC2(C(C)=C4(C=C9(C(C)C(CCC(=O)OCC=C(C)CCCC(C)CCCC(C)CCC=C(...")
 
(2 intermediate revisions by the same user not shown)
Line 1: Line 1:
−
[[Category:Reaction]]
+
[[Category:Metabolite]]
−
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN6666-4 RXN6666-4] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-7006 CPD-7006] ==
−
* direction:
+
* smiles:
−
** LEFT-TO-RIGHT
+
** C=CC2(C(C)=C4(C=C9(C(C)C(CCC(=O)OCC=C(C)CCCC(C)CCCC(C)CCC=C(C)C)C5(=[N+]([Mg--]36([N+]1(=C(C(CC)=C(C)C1=CC=2N34)C=C7(C(C)=C8(C(=O)[C-](C(OC)=O)C5=C(N67)8)))))9))))
−
* ec number:
+
* inchi key:
−
** [http://enzyme.expasy.org/EC/1.4.3.4 EC-1.4.3.4]
+
** InChIKey=NVDIDZKEPDPXJJ-ONWAGYJKSA-M
 +
* common name:
 +
** tetrahydrogeranylgeranyl chlorophyll a
 +
* molecular weight:
 +
** 890.479   
 
* Synonym(s):
 
* Synonym(s):
 +
** tetrahydroGG-chlorophyll a
 +
** tetrahydroGG-chl a
 +
** tetrahydrogeranylgeranyl-chl a
  
−
== Reaction Formula ==
+
== Reaction(s) known to consume the compound ==
−
* With identifiers:
+
* [[RXN-7666]]
−
** 1 [[DOPAMINE]][c] '''+''' 1 [[WATER]][c] '''+''' 1 [[OXYGEN-MOLECULE]][c] '''=>''' 1 [[AMMONIUM]][c] '''+''' 1 [[HYDROGEN-PEROXIDE]][c] '''+''' 1 [[34-DIHYDROXYPHENYLACETALDEHYDE]][c]
+
== Reaction(s) known to produce the compound ==
−
* With common name(s):
+
* [[RXN-7665]]
−
** 1 dopamine[c] '''+''' 1 H2O[c] '''+''' 1 oxygen[c] '''=>''' 1 ammonium[c] '''+''' 1 hydrogen peroxide[c] '''+''' 1 3,4-dihydroxyphenylacetaldehyde[c]
+
== Reaction(s) of unknown directionality ==
−
 
+
−
== Genes associated with this reaction  ==
+
−
Genes have been associated with this reaction based on different elements listed below.
+
−
* [[Ec-15_002910]]
+
−
** [[pantograph]]-[[aragem]]
+
−
* [[Ec-15_002920]]
+
−
** [[pantograph]]-[[aragem]]
+
−
== Pathways  ==
+
−
* [[PWY-7431]], aromatic biogenic amine degradation (bacteria): [http://metacyc.org/META/NEW-IMAGE?object=PWY-7431 PWY-7431]
+
−
** '''2''' reactions found over '''8''' reactions in the full pathway
+
−
* [[PWY6666-2]], dopamine degradation: [http://metacyc.org/META/NEW-IMAGE?object=PWY6666-2 PWY6666-2]
+
−
** '''2''' reactions found over '''5''' reactions in the full pathway
+
−
== Reconstruction information  ==
+
−
* [[orthology]]:
+
−
** [[pantograph]]:
+
−
*** [[aragem]]
+
 
== External links  ==
 
== External links  ==
−
* RHEA:
+
* PUBCHEM:
−
** [http://www.ebi.ac.uk/rhea/reaction.xhtml?id=27946 27946]
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=46926313 46926313]
−
* LIGAND-RXN:
+
{{#set: smiles=C=CC2(C(C)=C4(C=C9(C(C)C(CCC(=O)OCC=C(C)CCCC(C)CCCC(C)CCC=C(C)C)C5(=[N+]([Mg--]36([N+]1(=C(C(CC)=C(C)C1=CC=2N34)C=C7(C(C)=C8(C(=O)[C-](C(OC)=O)C5=C(N67)8)))))9))))}}
−
** [http://www.genome.jp/dbget-bin/www_bget?R04300 R04300]
+
{{#set: inchi key=InChIKey=NVDIDZKEPDPXJJ-ONWAGYJKSA-M}}
−
{{#set: direction=LEFT-TO-RIGHT}}
+
{{#set: common name=tetrahydrogeranylgeranyl chlorophyll a}}
−
{{#set: ec number=EC-1.4.3.4}}
+
{{#set: molecular weight=890.479    }}
−
{{#set: gene associated=Ec-15_002910|Ec-15_002920}}
+
{{#set: common name=tetrahydroGG-chlorophyll a|tetrahydroGG-chl a|tetrahydrogeranylgeranyl-chl a}}
−
{{#set: in pathway=PWY-7431|PWY6666-2}}
+
{{#set: consumed by=RXN-7666}}
−
{{#set: reconstruction category=orthology}}
+
{{#set: produced by=RXN-7665}}
−
{{#set: reconstruction tool=pantograph}}
+
−
{{#set: reconstruction source=aragem}}
+

Latest revision as of 19:16, 21 March 2018

Metabolite CPD-7006

  • smiles:
    • C=CC2(C(C)=C4(C=C9(C(C)C(CCC(=O)OCC=C(C)CCCC(C)CCCC(C)CCC=C(C)C)C5(=[N+]([Mg--]36([N+]1(=C(C(CC)=C(C)C1=CC=2N34)C=C7(C(C)=C8(C(=O)[C-](C(OC)=O)C5=C(N67)8)))))9))))
  • inchi key:
    • InChIKey=NVDIDZKEPDPXJJ-ONWAGYJKSA-M
  • common name:
    • tetrahydrogeranylgeranyl chlorophyll a
  • molecular weight:
    • 890.479
  • Synonym(s):
    • tetrahydroGG-chlorophyll a
    • tetrahydroGG-chl a
    • tetrahydrogeranylgeranyl-chl a

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"C=CC2(C(C)=C4(C=C9(C(C)C(CCC(=O)OCC=C(C)CCCC(C)CCCC(C)CCC=C(C)C)C5(=[N+]([Mg--]36([N+]1(=C(C(CC)=C(C)C1=CC=2N34)C=C7(C(C)=C8(C(=O)[C-](C(OC)=O)C5=C(N67)8)))))9))))" cannot be used as a page name in this wiki.




Retrieved from "http://gem-aureme.irisa.fr/ectogem/index.php?title=CPD-7006&oldid=25743"