Difference between revisions of "CPD-14300"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-67 CPD-67] == * smiles: ** C(OP([O-])(=O)[O-])C([O-])=O * inchi key: ** InChIKey=ASCFNMCAHF...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-14300 CPD-14300] == * smiles: ** CCCCCCCCC=CCCCCCCCC(=O)CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)C...") |
||
Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
− | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD- | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-14300 CPD-14300] == |
* smiles: | * smiles: | ||
− | ** C(OP([O-])(=O)[O-])C([O-]) | + | ** CCCCCCCCC=CCCCCCCCC(=O)CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-] |
* inchi key: | * inchi key: | ||
− | ** InChIKey= | + | ** InChIKey=ASKKPQKSCFYPPP-FVLDFCIYSA-J |
* common name: | * common name: | ||
− | ** | + | ** 3-oxo-(11Z)-eicos-11-enoyl-CoA |
* molecular weight: | * molecular weight: | ||
− | ** | + | ** 1069.99 |
* Synonym(s): | * Synonym(s): | ||
− | |||
− | |||
− | |||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | * [[RXN- | + | * [[RXN-13322]] |
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
== External links == | == External links == | ||
− | |||
* PUBCHEM: | * PUBCHEM: | ||
− | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid= | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=71581100 71581100] |
− | + | ||
− | + | ||
− | + | ||
* CHEBI: | * CHEBI: | ||
− | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId= | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=74011 74011] |
− | + | {{#set: smiles=CCCCCCCCC=CCCCCCCCC(=O)CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]}} | |
− | {{#set: smiles=C(OP([O-])(=O)[O-])C([O-]) | + | {{#set: inchi key=InChIKey=ASKKPQKSCFYPPP-FVLDFCIYSA-J}} |
− | {{#set: inchi key=InChIKey= | + | {{#set: common name=3-oxo-(11Z)-eicos-11-enoyl-CoA}} |
− | {{#set: common name= | + | {{#set: molecular weight=1069.99 }} |
− | {{#set: molecular weight= | + | {{#set: produced by=RXN-13322}} |
− | + | ||
− | + | ||
− | {{#set: produced by=RXN- | + |
Latest revision as of 19:41, 21 March 2018
Contents
Metabolite CPD-14300
- smiles:
- CCCCCCCCC=CCCCCCCCC(=O)CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]
- inchi key:
- InChIKey=ASKKPQKSCFYPPP-FVLDFCIYSA-J
- common name:
- 3-oxo-(11Z)-eicos-11-enoyl-CoA
- molecular weight:
- 1069.99
- Synonym(s):
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"CCCCCCCCC=CCCCCCCCC(=O)CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-" cannot be used as a page name in this wiki.