Difference between revisions of "Ec-06 009490"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=SN-GLYCEROL-1-PHOSPHATE SN-GLYCEROL-1-PHOSPHATE] == * smiles: ** C(OP([O-])(=O)[O-])C(O)CO * in...") |
(Created page with "Category:Gene == Gene Ec-06_009490 == * left end position: ** 7307898 * transcription direction: ** NEGATIVE * right end position: ** 7315576 * centisome position: ** 83.4...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Gene]] |
− | == | + | == Gene Ec-06_009490 == |
− | * | + | * left end position: |
− | ** | + | ** 7307898 |
− | * | + | * transcription direction: |
− | ** | + | ** NEGATIVE |
− | * | + | * right end position: |
− | ** | + | ** 7315576 |
− | * | + | * centisome position: |
− | ** | + | ** 83.444855 |
* Synonym(s): | * Synonym(s): | ||
− | ** | + | ** Esi_0086_0039 |
− | ** | + | ** Esi0086_0039 |
− | == | + | == Reactions associated == |
− | * [[ | + | * Reaction: [[RXN0-5021]] |
− | + | ** Source: [[annotation-esiliculosus_genome]] | |
− | == | + | *** Assignment: automated-name-match |
+ | == Pathways associated == | ||
== External links == | == External links == | ||
− | + | {{#set: left end position=7307898}} | |
− | + | {{#set: transcription direction=NEGATIVE}} | |
− | + | {{#set: right end position=7315576}} | |
− | + | {{#set: centisome position=83.444855 }} | |
− | + | {{#set: common name=Esi_0086_0039|Esi0086_0039}} | |
− | + | {{#set: reaction associated=RXN0-5021}} | |
− | + | ||
− | + | ||
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: common name= | + | |
− | {{#set: | + |
Latest revision as of 19:41, 21 March 2018
Gene Ec-06_009490
- left end position:
- 7307898
- transcription direction:
- NEGATIVE
- right end position:
- 7315576
- centisome position:
- 83.444855
- Synonym(s):
- Esi_0086_0039
- Esi0086_0039
Reactions associated
- Reaction: RXN0-5021
- Source: annotation-esiliculosus_genome
- Assignment: automated-name-match
- Source: annotation-esiliculosus_genome