Difference between revisions of "Ec-15 004110"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=C-DI-GMP C-DI-GMP] == * smiles: ** C1(C7(C(OP([O-])(=O)OCC4(C(OP([O-])(=O)O1)C(O)C(N3(C2(N=C(N)...")
(Created page with "Category:Gene == Gene Ec-15_004110 == * left end position: ** 4395867 * transcription direction: ** POSITIVE * right end position: ** 4400839 * centisome position: ** 81.4...")
 
Line 1: Line 1:
[[Category:Metabolite]]
+
[[Category:Gene]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=C-DI-GMP C-DI-GMP] ==
+
== Gene Ec-15_004110 ==
* smiles:
+
* left end position:
** C1(C7(C(OP([O-])(=O)OCC4(C(OP([O-])(=O)O1)C(O)C(N3(C2(N=C(N)NC(=O)C=2N=C3)))O4))C(O)C(N6(C5(N=C(N)NC(=O)C=5N=C6)))O7))
+
** 4395867
* inchi key:
+
* transcription direction:
** InChIKey=PKFDLKSEZWEFGL-MHARETSRSA-L
+
** POSITIVE
* common name:
+
* right end position:
** cyclic di-3',5'-guanylate
+
** 4400839
* molecular weight:
+
* centisome position:
** 688.4    
+
** 81.43129    
 
* Synonym(s):
 
* Synonym(s):
** cyclic di-3',5'-GMP
+
** Esi_0188_0005
** c-di-GMP
+
** Esi0188_0005
** c-di-guanylate
+
** cyclic bis(3' -> 5') dimeric GMP
+
  
== Reaction(s) known to consume the compound ==
+
== Reactions associated ==
== Reaction(s) known to produce the compound ==
+
* Reaction: [[GLUTAMINESYN-RXN]]
* [[RXN0-5359]]
+
** Source: [[annotation-esiliculosus_genome]]
== Reaction(s) of unknown directionality ==
+
*** Assignment: ec-number
 +
** Source: [[orthology-aragem]]
 +
** Source: [[orthology-aragem]]
 +
** Source: [[orthology-aragem]]
 +
== Pathways associated ==
 +
* [[GLNSYN-PWY]]
 +
* [[PWY-5675]]
 +
* [[PWY-381]]
 +
* [[PWY-6549]]
 +
* [[PWY-6964]]
 +
* [[PWY-6963]]
 +
* [[PWY490-3]]
 
== External links  ==
 
== External links  ==
* PUBCHEM:
+
{{#set: left end position=4395867}}
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25245336 25245336]
+
{{#set: transcription direction=POSITIVE}}
* CHEBI:
+
{{#set: right end position=4400839}}
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=58805 58805]
+
{{#set: centisome position=81.43129    }}
* LIGAND-CPD:
+
{{#set: common name=Esi_0188_0005|Esi0188_0005}}
** [http://www.genome.jp/dbget-bin/www_bget?C16463 C16463]
+
{{#set: reaction associated=GLUTAMINESYN-RXN}}
{{#set: smiles=C1(C7(C(OP([O-])(=O)OCC4(C(OP([O-])(=O)O1)C(O)C(N3(C2(N=C(N)NC(=O)C=2N=C3)))O4))C(O)C(N6(C5(N=C(N)NC(=O)C=5N=C6)))O7))}}
+
{{#set: pathway associated=GLNSYN-PWY|PWY-5675|PWY-381|PWY-6549|PWY-6964|PWY-6963|PWY490-3}}
{{#set: inchi key=InChIKey=PKFDLKSEZWEFGL-MHARETSRSA-L}}
+
{{#set: common name=cyclic di-3',5'-guanylate}}
+
{{#set: molecular weight=688.4    }}
+
{{#set: common name=cyclic di-3',5'-GMP|c-di-GMP|c-di-guanylate|cyclic bis(3' -> 5') dimeric GMP}}
+
{{#set: produced by=RXN0-5359}}
+

Latest revision as of 19:41, 21 March 2018

Gene Ec-15_004110

  • left end position:
    • 4395867
  • transcription direction:
    • POSITIVE
  • right end position:
    • 4400839
  • centisome position:
    • 81.43129
  • Synonym(s):
    • Esi_0188_0005
    • Esi0188_0005

Reactions associated

Pathways associated

External links