Difference between revisions of "Ec-09 002160"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-318 CPD-318] == * smiles: ** C(O)C(O)[CH]1(C(O)=C(O)C(=O)O1) * inchi key: ** InChIKey=LHFJO...")
(Created page with "Category:Gene == Gene Ec-09_002160 == * left end position: ** 2531774 * transcription direction: ** NEGATIVE * right end position: ** 2549731 * centisome position: ** 45.1...")
 
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Gene]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-318 CPD-318] ==
+
== Gene Ec-09_002160 ==
−
* smiles:
+
* left end position:
−
** C(O)C(O)[CH]1(C(O)=C(O)C(=O)O1)
+
** 2531774
−
* inchi key:
+
* transcription direction:
−
** InChIKey=LHFJOBMTAJJOTB-JLAZNSOCSA-N
+
** NEGATIVE
−
* common name:
+
* right end position:
−
** monodehydroascorbate radical
+
** 2549731
−
* molecular weight:
+
* centisome position:
−
** 175.118    
+
** 45.104248    
 
* Synonym(s):
 
* Synonym(s):
−
** monodehydroascorbic acid
+
** Esi_0074_0087
−
** semidehydroascorbic acid
+
** Esi0074_0087
−
** semidehydroascorbate
+
−
** ascorbyl radical
+
  
−
== Reaction(s) known to consume the compound ==
+
== Reactions associated ==
−
* [[RXN-3523]]
+
* Reaction: [[ATPASE-RXN]]
−
* [[1.6.5.4-RXN]]
+
** Source: [[annotation-esiliculosus_genome]]
−
== Reaction(s) known to produce the compound ==
+
*** Assignment: go-term
−
* [[RXN-10981]]
+
== Pathways associated ==
−
* [[RXN-3521]]
+
−
== Reaction(s) of unknown directionality ==
+
 
== External links  ==
 
== External links  ==
−
* PUBCHEM:
+
{{#set: left end position=2531774}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=5483640 5483640]
+
{{#set: transcription direction=NEGATIVE}}
−
* CHEBI:
+
{{#set: right end position=2549731}}
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=16504 16504]
+
{{#set: centisome position=45.104248   }}
−
* LIGAND-CPD:
+
{{#set: common name=Esi_0074_0087|Esi0074_0087}}
−
** [http://www.genome.jp/dbget-bin/www_bget?C01041 C01041]
+
{{#set: reaction associated=ATPASE-RXN}}
−
{{#set: smiles=C(O)C(O)[CH]1(C(O)=C(O)C(=O)O1)}}
+
−
{{#set: inchi key=InChIKey=LHFJOBMTAJJOTB-JLAZNSOCSA-N}}
+
−
{{#set: common name=monodehydroascorbate radical}}
+
−
{{#set: molecular weight=175.118   }}
+
−
{{#set: common name=monodehydroascorbic acid|semidehydroascorbic acid|semidehydroascorbate|ascorbyl radical}}
+
−
{{#set: consumed by=RXN-3523|1.6.5.4-RXN}}
+
−
{{#set: produced by=RXN-10981|RXN-3521}}
+

Latest revision as of 19:42, 21 March 2018

Gene Ec-09_002160

  • left end position:
    • 2531774
  • transcription direction:
    • NEGATIVE
  • right end position:
    • 2549731
  • centisome position:
    • 45.104248
  • Synonym(s):
    • Esi_0074_0087
    • Esi0074_0087

Reactions associated

Pathways associated

External links

Retrieved from "http://gem-aureme.irisa.fr/ectogem/index.php?title=Ec-09_002160&oldid=28775"