Difference between revisions of "RXN-15200"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-11020 CPD-11020] == * smiles: ** C(=O)([O-])C(=O)CC(O)CCl * inchi key: ** InChIKey=FHWPHVIG...")
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-15200 RXN-15200] == * direction: ** REVERSIBLE * common name: ** phenylpyruvate aminotransferas...")
 
Line 1: Line 1:
[[Category:Metabolite]]
+
[[Category:Reaction]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-11020 CPD-11020] ==
+
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-15200 RXN-15200] ==
* smiles:
+
* direction:
** C(=O)([O-])C(=O)CC(O)CCl
+
** REVERSIBLE
* inchi key:
+
** InChIKey=FHWPHVIGZZAXIQ-VKHMYHEASA-M
+
 
* common name:
 
* common name:
** 5-chloro-4-hydroxy-2-oxopentanoate
+
** phenylpyruvate aminotransferase
* molecular weight:
+
* ec number:
** 165.553   
+
** [http://enzyme.expasy.org/EC/2.6.1 EC-2.6.1]
 
* Synonym(s):
 
* Synonym(s):
** 5-chloro-4-hydroxy-2-oxovalerate
 
  
== Reaction(s) known to consume the compound ==
+
== Reaction Formula ==
== Reaction(s) known to produce the compound ==
+
* With identifiers:
* [[RXN-11717]]
+
** 1 [[TYR]][c] '''+''' 1 [[PHENYL-PYRUVATE]][c] '''<=>''' 1 [[P-HYDROXY-PHENYLPYRUVATE]][c] '''+''' 1 [[PHE]][c]
== Reaction(s) of unknown directionality ==
+
* With common name(s):
 +
** 1 L-tyrosine[c] '''+''' 1 2-oxo-3-phenylpropanoate[c] '''<=>''' 1 4-hydroxyphenylpyruvate[c] '''+''' 1 L-phenylalanine[c]
 +
 
 +
== Genes associated with this reaction  ==
 +
== Pathways  ==
 +
* [[PWY-7432]], L-phenylalanine biosynthesis III (cytosolic, plants): [http://metacyc.org/META/NEW-IMAGE?object=PWY-7432 PWY-7432]
 +
** '''4''' reactions found over '''4''' reactions in the full pathway
 +
== Reconstruction information  ==
 +
* Category: [[gap-filling]]
 +
** Source: [[gap-filling-gapfilling_solution_with_meneco_draft_medium]]
 +
*** Tool: [[meneco]]
 +
**** Comment: [[added for gapfilling]]
 
== External links  ==
 
== External links  ==
* PUBCHEM:
+
{{#set: direction=REVERSIBLE}}
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=49859580 49859580]
+
{{#set: common name=phenylpyruvate aminotransferase}}
{{#set: smiles=C(=O)([O-])C(=O)CC(O)CCl}}
+
{{#set: ec number=EC-2.6.1}}
{{#set: inchi key=InChIKey=FHWPHVIGZZAXIQ-VKHMYHEASA-M}}
+
{{#set: in pathway=PWY-7432}}
{{#set: common name=5-chloro-4-hydroxy-2-oxopentanoate}}
+
{{#set: reconstruction category=gap-filling}}
{{#set: molecular weight=165.553    }}
+
{{#set: reconstruction source=gap-filling-gapfilling_solution_with_meneco_draft_medium}}
{{#set: common name=5-chloro-4-hydroxy-2-oxovalerate}}
+
{{#set: reconstruction tool=meneco}}
{{#set: produced by=RXN-11717}}
+
{{#set: reconstruction comment=added for gapfilling}}

Latest revision as of 19:42, 21 March 2018

Reaction RXN-15200

  • direction:
    • REVERSIBLE
  • common name:
    • phenylpyruvate aminotransferase
  • ec number:
  • Synonym(s):

Reaction Formula

Genes associated with this reaction

Pathways

  • PWY-7432, L-phenylalanine biosynthesis III (cytosolic, plants): PWY-7432
    • 4 reactions found over 4 reactions in the full pathway

Reconstruction information

External links