Difference between revisions of "CPD-318"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN0-308 RXN0-308] == * direction: ** LEFT-TO-RIGHT * common name: ** Aminotransferase class V doma...")
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-318 CPD-318] == * smiles: ** C(O)C(O)[CH]1(C(O)=C(O)C(=O)O1) * inchi key: ** InChIKey=LHFJO...")
 
Line 1: Line 1:
[[Category:Reaction]]
+
[[Category:Metabolite]]
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN0-308 RXN0-308] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-318 CPD-318] ==
* direction:
+
* smiles:
** LEFT-TO-RIGHT
+
** C(O)C(O)[CH]1(C(O)=C(O)C(=O)O1)
 +
* inchi key:
 +
** InChIKey=LHFJOBMTAJJOTB-JLAZNSOCSA-N
 
* common name:
 
* common name:
** Aminotransferase class V domain
+
** monodehydroascorbate radical
** Cysteine desulfurase
+
* molecular weight:
* ec number:
+
** 175.118   
** [http://enzyme.expasy.org/EC/2.8.1.7 EC-2.8.1.7]
+
 
* Synonym(s):
 
* Synonym(s):
 +
** monodehydroascorbic acid
 +
** semidehydroascorbic acid
 +
** semidehydroascorbate
 +
** ascorbyl radical
  
== Reaction Formula ==
+
== Reaction(s) known to consume the compound ==
* With identifiers:
+
* [[RXN-3523]]
** 1 [[Cysteine-Desulfurase-L-cysteine]][c] '''+''' 1 [[CYS]][c] '''=>''' 1 [[L-Cysteine-Desulfurase-persulfide]][c] '''+''' 1 [[L-ALPHA-ALANINE]][c]
+
* [[1.6.5.4-RXN]]
* With common name(s):
+
== Reaction(s) known to produce the compound ==
** 1 an [L-cysteine desulfurase]-L-cysteine[c] '''+''' 1 L-cysteine[c] '''=>''' 1 an [L-cysteine desulfurase] L-cysteine persulfide[c] '''+''' 1 L-alanine[c]
+
* [[RXN-10981]]
 
+
* [[RXN-3521]]
== Genes associated with this reaction  ==
+
== Reaction(s) of unknown directionality ==
Genes have been associated with this reaction based on different elements listed below.
+
* Gene: [[Ec-21_005640]]
+
** Source: [[annotation-esiliculosus_genome]]
+
*** Assignment: EC-NUMBER
+
* Gene: [[Ec-22_000950]]
+
** Source: [[annotation-esiliculosus_genome]]
+
*** Assignment: EC-NUMBER
+
* Gene: [[Ec-21_003740]]
+
** Source: [[annotation-esiliculosus_genome]]
+
*** Assignment: EC-NUMBER
+
== Pathways  ==
+
* [[PWY0-1021]], L-alanine biosynthesis III: [http://metacyc.org/META/NEW-IMAGE?object=PWY0-1021 PWY0-1021]
+
** '''1''' reactions found over '''1''' reactions in the full pathway
+
* [[PWY-6823]], molybdenum cofactor biosynthesis: [http://metacyc.org/META/NEW-IMAGE?object=PWY-6823 PWY-6823]
+
** '''7''' reactions found over '''7''' reactions in the full pathway
+
* [[PWY-6892]], thiazole biosynthesis I (facultative anaerobic bacteria): [http://metacyc.org/META/NEW-IMAGE?object=PWY-6892 PWY-6892]
+
** '''3''' reactions found over '''7''' reactions in the full pathway
+
* [[PWY-6891]], thiazole biosynthesis II (aerobic bacteria): [http://metacyc.org/META/NEW-IMAGE?object=PWY-6891 PWY-6891]
+
** '''2''' reactions found over '''7''' reactions in the full pathway
+
== Reconstruction information  ==
+
* Category: [[annotation]]
+
** Source: [[annotation-esiliculosus_genome]]
+
*** Tool: [[pathwaytools]]
+
 
== External links  ==
 
== External links  ==
* LIGAND-RXN:
+
* PUBCHEM:
** [http://www.genome.jp/dbget-bin/www_bget?R07460 R07460]
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=5483640 5483640]
{{#set: direction=LEFT-TO-RIGHT}}
+
* CHEBI:
{{#set: common name=Aminotransferase class V domain}}
+
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=16504 16504]
{{#set: common name=Cysteine desulfurase}}
+
* LIGAND-CPD:
{{#set: ec number=EC-2.8.1.7}}
+
** [http://www.genome.jp/dbget-bin/www_bget?C01041 C01041]
{{#set: gene associated=Ec-21_005640|Ec-22_000950|Ec-21_003740}}
+
{{#set: smiles=C(O)C(O)[CH]1(C(O)=C(O)C(=O)O1)}}
{{#set: in pathway=PWY0-1021|PWY-6823|PWY-6892|PWY-6891}}
+
{{#set: inchi key=InChIKey=LHFJOBMTAJJOTB-JLAZNSOCSA-N}}
{{#set: reconstruction category=annotation}}
+
{{#set: common name=monodehydroascorbate radical}}
{{#set: reconstruction source=annotation-esiliculosus_genome}}
+
{{#set: molecular weight=175.118    }}
{{#set: reconstruction tool=pathwaytools}}
+
{{#set: common name=monodehydroascorbic acid|semidehydroascorbic acid|semidehydroascorbate|ascorbyl radical}}
 +
{{#set: consumed by=RXN-3523|1.6.5.4-RXN}}
 +
{{#set: produced by=RXN-10981|RXN-3521}}

Latest revision as of 19:42, 21 March 2018

Metabolite CPD-318

  • smiles:
    • C(O)C(O)[CH]1(C(O)=C(O)C(=O)O1)
  • inchi key:
    • InChIKey=LHFJOBMTAJJOTB-JLAZNSOCSA-N
  • common name:
    • monodehydroascorbate radical
  • molecular weight:
    • 175.118
  • Synonym(s):
    • monodehydroascorbic acid
    • semidehydroascorbic acid
    • semidehydroascorbate
    • ascorbyl radical

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"C(O)C(O)[CH]1(C(O)=C(O)C(=O)O1)" cannot be used as a page name in this wiki.