Difference between revisions of "RXN-16378"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-15675 CPD-15675] == * smiles: ** CCCCCCC=CCCC=CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(...")
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-16378 RXN-16378] == * direction: ** REVERSIBLE * common name: ** Fatty acid hydroxylase * ec nu...")
 
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Reaction]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-15675 CPD-15675] ==
+
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-16378 RXN-16378] ==
−
* smiles:
+
* direction:
−
** CCCCCCC=CCCC=CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]
+
** REVERSIBLE
−
* inchi key:
+
−
** InChIKey=OOSDLBAXVXKFIB-BJBRNGJVSA-J
+
 
* common name:
 
* common name:
−
** 2-trans-6-trans-tridecadienoyl-CoA
+
** Fatty acid hydroxylase
−
* molecular weight:
+
* ec number:
−
** 955.803   
+
** [http://enzyme.expasy.org/EC/1.14.19.20 EC-1.14.19.20]
 
* Synonym(s):
 
* Synonym(s):
−
** 2E, 6E-tridecadienoyl-CoA
 
  
−
== Reaction(s) known to consume the compound ==
+
== Reaction Formula ==
−
== Reaction(s) known to produce the compound ==
+
* With identifiers:
−
* [[RXN-14785]]
+
** 1 [[OXYGEN-MOLECULE]][c] '''+''' 2 [[PROTON]][c] '''+''' 2 [[FERROCYTOCHROME-B5]][c] '''+''' 1 [[Delta7-Steroids]][c] '''<=>''' 2 [[FERRICYTOCHROME-B5]][c] '''+''' 2 [[WATER]][c] '''+''' 1 [[Delta5-Delta7-Steroids]][c]
−
== Reaction(s) of unknown directionality ==
+
* With common name(s):
 +
** 1 oxygen[c] '''+''' 2 H+[c] '''+''' 2 a ferrocytochrome b5[c] '''+''' 1 a &Delta;7-sterol[c] '''<=>''' 2 a ferricytochrome b5[c] '''+''' 2 H2O[c] '''+''' 1 a &Delta;5,7-sterol[c]
 +
 
 +
== Genes associated with this reaction  ==
 +
Genes have been associated with this reaction based on different elements listed below.
 +
* Gene: [[Ec-01_003780]]
 +
** Source: [[annotation-esiliculosus_genome]]
 +
*** Assignment: EC-NUMBER
 +
== Pathways  ==
 +
== Reconstruction information  ==
 +
* Category: [[annotation]]
 +
** Source: [[annotation-esiliculosus_genome]]
 +
*** Tool: [[pathwaytools]]
 
== External links  ==
 
== External links  ==
−
* PUBCHEM:
+
{{#set: direction=REVERSIBLE}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=90658431 90658431]
+
{{#set: common name=Fatty acid hydroxylase}}
−
{{#set: smiles=CCCCCCC=CCCC=CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]}}
+
{{#set: ec number=EC-1.14.19.20}}
−
{{#set: inchi key=InChIKey=OOSDLBAXVXKFIB-BJBRNGJVSA-J}}
+
{{#set: gene associated=Ec-01_003780}}
−
{{#set: common name=2-trans-6-trans-tridecadienoyl-CoA}}
+
{{#set: in pathway=}}
−
{{#set: molecular weight=955.803    }}
+
{{#set: reconstruction category=annotation}}
−
{{#set: common name=2E, 6E-tridecadienoyl-CoA}}
+
{{#set: reconstruction source=annotation-esiliculosus_genome}}
−
{{#set: produced by=RXN-14785}}
+
{{#set: reconstruction tool=pathwaytools}}

Latest revision as of 19:43, 21 March 2018

Reaction RXN-16378

  • direction:
    • REVERSIBLE
  • common name:
    • Fatty acid hydroxylase
  • ec number:
  • Synonym(s):

Reaction Formula

Genes associated with this reaction

Genes have been associated with this reaction based on different elements listed below.

Pathways

Reconstruction information

External links

Retrieved from "http://gem-aureme.irisa.fr/ectogem/index.php?title=RXN-16378&oldid=28885"