Difference between revisions of "RXN-14179"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=2-KETOGLUTARATE 2-KETOGLUTARATE] == * smiles: ** C(CC([O-])=O)C(=O)C([O-])=O * inchi key: ** In...") |
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-14179 RXN-14179] == * direction: ** LEFT-TO-RIGHT * common name: ** Beta-glucosidase, family GH...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Reaction]] |
− | == | + | == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-14179 RXN-14179] == |
− | * | + | * direction: |
− | ** | + | ** LEFT-TO-RIGHT |
− | + | ||
− | + | ||
* common name: | * common name: | ||
− | ** | + | ** Beta-glucosidase, family GH3 |
− | * | + | ** Beta-glucosidase, family GH1 |
− | ** | + | ** Beta-glucosidase, family GH30 |
+ | * ec number: | ||
+ | ** [http://enzyme.expasy.org/EC/3.2.1.21 EC-3.2.1.21] | ||
* Synonym(s): | * Synonym(s): | ||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | == Reaction | + | == Reaction Formula == |
− | * | + | * With identifiers: |
− | * | + | ** 1 [[WATER]][c] '''+''' 1 [[SCOPOLIN]][c] '''=>''' 1 [[SCOPOLETIN]][c] '''+''' 1 [[Glucopyranose]][c] |
− | * [[ | + | * With common name(s): |
− | + | ** 1 H2O[c] '''+''' 1 scopolin[c] '''=>''' 1 scopoletin[c] '''+''' 1 D-glucopyranose[c] | |
− | + | ||
− | + | == Genes associated with this reaction == | |
− | + | Genes have been associated with this reaction based on different elements listed below. | |
− | + | * Gene: [[Ec-26_002410]] | |
− | + | ** Source: [[annotation-esiliculosus_genome]] | |
− | + | *** Assignment: EC-NUMBER | |
− | * | + | * Gene: [[Ec-07_001850]] |
− | * | + | ** Source: [[annotation-esiliculosus_genome]] |
− | * | + | *** Assignment: EC-NUMBER |
− | + | * Gene: [[Ec-07_005240]] | |
− | + | ** Source: [[annotation-esiliculosus_genome]] | |
− | + | *** Assignment: EC-NUMBER | |
− | + | * Gene: [[Ec-20_004800]] | |
− | + | ** Source: [[annotation-esiliculosus_genome]] | |
− | + | *** Assignment: EC-NUMBER | |
− | + | * Gene: [[Ec-04_002190]] | |
− | + | ** Source: [[annotation-esiliculosus_genome]] | |
− | * [[ | + | *** Assignment: EC-NUMBER |
− | * | + | == Pathways == |
− | * [[ | + | == Reconstruction information == |
− | * | + | * Category: [[annotation]] |
− | * | + | ** Source: [[annotation-esiliculosus_genome]] |
− | * | + | *** Tool: [[pathwaytools]] |
− | * [[ | + | |
− | * | + | |
− | + | ||
− | * [[ | + | |
− | + | ||
− | * | + | |
− | * | + | |
− | * | + | |
− | * [[ | + | |
− | * | + | |
− | * [[ | + | |
− | * | + | |
− | * | + | |
− | * | + | |
− | * [[ | + | |
− | * | + | |
− | * [[ | + | |
− | * | + | |
− | * | + | |
− | * | + | |
− | * [[ | + | |
− | * | + | |
− | * [[ | + | |
− | * | + | |
− | * | + | |
− | * | + | |
− | + | ||
− | + | ||
− | * [[ | + | |
− | * | + | |
− | * [[ | + | |
− | * | + | |
− | * | + | |
− | * [[ | + | |
− | + | ||
== External links == | == External links == | ||
− | + | {{#set: direction=LEFT-TO-RIGHT}} | |
− | + | {{#set: common name=Beta-glucosidase, family GH3}} | |
− | + | {{#set: common name=Beta-glucosidase, family GH1}} | |
− | + | {{#set: common name=Beta-glucosidase, family GH30}} | |
− | + | {{#set: ec number=EC-3.2.1.21}} | |
− | + | {{#set: gene associated=Ec-26_002410|Ec-07_001850|Ec-07_005240|Ec-20_004800|Ec-04_002190}} | |
− | + | {{#set: in pathway=}} | |
− | + | {{#set: reconstruction category=annotation}} | |
− | + | {{#set: reconstruction source=annotation-esiliculosus_genome}} | |
− | + | {{#set: reconstruction tool=pathwaytools}} | |
− | + | ||
− | + | ||
− | + | ||
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: common name= | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + |
Latest revision as of 19:43, 21 March 2018
Contents
Reaction RXN-14179
- direction:
- LEFT-TO-RIGHT
- common name:
- Beta-glucosidase, family GH3
- Beta-glucosidase, family GH1
- Beta-glucosidase, family GH30
- ec number:
- Synonym(s):
Reaction Formula
- With identifiers:
- 1 WATER[c] + 1 SCOPOLIN[c] => 1 SCOPOLETIN[c] + 1 Glucopyranose[c]
- With common name(s):
- 1 H2O[c] + 1 scopolin[c] => 1 scopoletin[c] + 1 D-glucopyranose[c]
Genes associated with this reaction
Genes have been associated with this reaction based on different elements listed below.
- Gene: Ec-26_002410
- Source: annotation-esiliculosus_genome
- Assignment: EC-NUMBER
- Source: annotation-esiliculosus_genome
- Gene: Ec-07_001850
- Source: annotation-esiliculosus_genome
- Assignment: EC-NUMBER
- Source: annotation-esiliculosus_genome
- Gene: Ec-07_005240
- Source: annotation-esiliculosus_genome
- Assignment: EC-NUMBER
- Source: annotation-esiliculosus_genome
- Gene: Ec-20_004800
- Source: annotation-esiliculosus_genome
- Assignment: EC-NUMBER
- Source: annotation-esiliculosus_genome
- Gene: Ec-04_002190
- Source: annotation-esiliculosus_genome
- Assignment: EC-NUMBER
- Source: annotation-esiliculosus_genome
Pathways
Reconstruction information
- Category: annotation
- Source: annotation-esiliculosus_genome
- Tool: pathwaytools
- Source: annotation-esiliculosus_genome