Difference between revisions of "Protein-hydroxyprolines"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=D-GALACTONATE D-GALACTONATE] == * smiles: ** C(O)C(O)C(O)C(O)C(O)C(=O)[O-] * inchi key: ** InCh...")
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Protein-hydroxyprolines Protein-hydroxyprolines] == * common name: ** a [protein]-trans-4-hydro...")
 
Line 1: Line 1:
 
[[Category:Metabolite]]
 
[[Category:Metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=D-GALACTONATE D-GALACTONATE] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Protein-hydroxyprolines Protein-hydroxyprolines] ==
* smiles:
+
** C(O)C(O)C(O)C(O)C(O)C(=O)[O-]
+
* inchi key:
+
** InChIKey=RGHNJXZEOKUKBD-MGCNEYSASA-M
+
 
* common name:
 
* common name:
** D-galactonate
+
** a [protein]-trans-4-hydroxy-L-proline
* molecular weight:
+
** 195.149   
+
 
* Synonym(s):
 
* Synonym(s):
** galactonate
 
  
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[GALACTONOLACTONASE-RXN]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
 +
* [[2.4.1.229-RXN]]
 
== External links  ==
 
== External links  ==
* PUBCHEM:
+
{{#set: common name=a [protein]-trans-4-hydroxy-L-proline}}
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=5461127 5461127]
+
{{#set: reversible reaction associated=2.4.1.229-RXN}}
* HMDB : HMDB00565
+
* LIGAND-CPD:
+
** [http://www.genome.jp/dbget-bin/www_bget?C00880 C00880]
+
* CHEMSPIDER:
+
** [http://www.chemspider.com/Chemical-Structure.4574468.html 4574468]
+
* CHEBI:
+
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=12931 12931]
+
* BIGG : 36277
+
{{#set: smiles=C(O)C(O)C(O)C(O)C(O)C(=O)[O-]}}
+
{{#set: inchi key=InChIKey=RGHNJXZEOKUKBD-MGCNEYSASA-M}}
+
{{#set: common name=D-galactonate}}
+
{{#set: molecular weight=195.149    }}
+
{{#set: common name=galactonate}}
+
{{#set: produced by=GALACTONOLACTONASE-RXN}}
+

Latest revision as of 19:43, 21 March 2018

Metabolite Protein-hydroxyprolines

  • common name:
    • a [protein]-trans-4-hydroxy-L-proline
  • Synonym(s):

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"a [protein]-trans-4-hydroxy-L-proline" cannot be used as a page name in this wiki.