Difference between revisions of "Ec-14 005080"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=GDP-TP GDP-TP] == * smiles: ** C(OP(=O)([O-])OP(=O)([O-])OP(=O)([O-])[O-])C1(OC(C(O)C(OP(=O)([O...")
(Created page with "Category:Gene == Gene Ec-14_005080 == * left end position: ** 4711320 * transcription direction: ** POSITIVE * right end position: ** 4718623 * centisome position: ** 71.8...")
 
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Gene]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=GDP-TP GDP-TP] ==
+
== Gene Ec-14_005080 ==
−
* smiles:
+
* left end position:
−
** C(OP(=O)([O-])OP(=O)([O-])OP(=O)([O-])[O-])C1(OC(C(O)C(OP(=O)([O-])OP(=O)(O)[O-])1)N3(C=NC2(C(=O)NC(N)=NC=23)))
+
** 4711320
−
* inchi key:
+
* transcription direction:
−
** InChIKey=KCPMACXZAITQAX-UUOKFMHZSA-H
+
** POSITIVE
−
* common name:
+
* right end position:
−
** pppGpp
+
** 4718623
−
* molecular weight:
+
* centisome position:
−
** 677.095    
+
** 71.81422    
 
* Synonym(s):
 
* Synonym(s):
−
** guanosine pentaphosphate
+
** Esi_0399_0017
−
** guanosine 3'-diphosphate 5'-triphosphate
+
** Esi0399_0017
−
** guanosine 5'-triphosphate,3'-diphosphate
+
  
−
== Reaction(s) known to consume the compound ==
+
== Reactions associated ==
−
== Reaction(s) known to produce the compound ==
+
* Reaction: [[RXN-15556]]
−
* [[GTPPYPHOSKIN-RXN]]
+
** Source: [[annotation-esiliculosus_genome]]
−
== Reaction(s) of unknown directionality ==
+
*** Assignment: automated-name-match
 +
== Pathways associated ==
 +
* [[PWY-7511]]
 
== External links  ==
 
== External links  ==
−
* LIGAND-CPD:
+
{{#set: left end position=4711320}}
−
** [http://www.genome.jp/dbget-bin/www_bget?C04494 C04494]
+
{{#set: transcription direction=POSITIVE}}
−
* CHEBI:
+
{{#set: right end position=4718623}}
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=16690 16690]
+
{{#set: centisome position=71.81422   }}
−
* BIGG : 43927
+
{{#set: common name=Esi_0399_0017|Esi0399_0017}}
−
* PUBCHEM:
+
{{#set: reaction associated=RXN-15556}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=46173549 46173549]
+
{{#set: pathway associated=PWY-7511}}
−
* HMDB : HMDB60480
+
−
{{#set: smiles=C(OP(=O)([O-])OP(=O)([O-])OP(=O)([O-])[O-])C1(OC(C(O)C(OP(=O)([O-])OP(=O)(O)[O-])1)N3(C=NC2(C(=O)NC(N)=NC=23)))}}
+
−
{{#set: inchi key=InChIKey=KCPMACXZAITQAX-UUOKFMHZSA-H}}
+
−
{{#set: common name=pppGpp}}
+
−
{{#set: molecular weight=677.095   }}
+
−
{{#set: common name=guanosine pentaphosphate|guanosine 3'-diphosphate 5'-triphosphate|guanosine 5'-triphosphate,3'-diphosphate}}
+
−
{{#set: produced by=GTPPYPHOSKIN-RXN}}
+

Latest revision as of 19:43, 21 March 2018

Gene Ec-14_005080

  • left end position:
    • 4711320
  • transcription direction:
    • POSITIVE
  • right end position:
    • 4718623
  • centisome position:
    • 71.81422
  • Synonym(s):
    • Esi_0399_0017
    • Esi0399_0017

Reactions associated

Pathways associated

External links

Retrieved from "http://gem-aureme.irisa.fr/ectogem/index.php?title=Ec-14_005080&oldid=28931"