Difference between revisions of "RXN-12508"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-4127 CPD-4127] == * smiles: ** CC=C(C(C)C)CCC(C)[CH]3(CC[CH]4([CH]2(CC=C1(CC(O)CCC(C)1[CH]2...")
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-12508 RXN-12508] == * direction: ** LEFT-TO-RIGHT * common name: ** 2-(α-hydroxyethyl)-TP...")
 
Line 1: Line 1:
[[Category:Metabolite]]
+
[[Category:Reaction]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-4127 CPD-4127] ==
+
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-12508 RXN-12508] ==
* smiles:
+
* direction:
** CC=C(C(C)C)CCC(C)[CH]3(CC[CH]4([CH]2(CC=C1(CC(O)CCC(C)1[CH]2CCC(C)34))))
+
** LEFT-TO-RIGHT
* inchi key:
+
** InChIKey=OSELKOCHBMDKEJ-WGMIZEQOSA-N
+
 
* common name:
 
* common name:
** isofucosterol
+
** 2-(α-hydroxyethyl)-TPP:[dihydrolipoyllysine-residue acetyltransferase]-lipoyllysine acetyltransferase
* molecular weight:
+
** Transketolase, C-terminal/Pyruvate-ferredoxin oxidoreductase, domain II
** 412.698   
+
 
* Synonym(s):
 
* Synonym(s):
  
== Reaction(s) known to consume the compound ==
+
== Reaction Formula ==
== Reaction(s) known to produce the compound ==
+
* With identifiers:
* [[RXN-4210]]
+
** 1 [[2-ALPHA-HYDROXYETHYL-THPP]][c] '''+''' 1 [[Pyruvate-dehydrogenase-lipoate]][c] '''=>''' 1 [[THIAMINE-PYROPHOSPHATE]][c] '''+''' 1 [[Pyruvate-dehydrogenase-acetylDHlipoyl]][c]
== Reaction(s) of unknown directionality ==
+
* With common name(s):
 +
** 1 2-(α-hydroxyethyl)thiamine diphosphate[c] '''+''' 1 a [pyruvate dehydrogenase E2 protein] N6-lipoyl-L-lysine[c] '''=>''' 1 thiamine diphosphate[c] '''+''' 1 a [pyruvate dehydrogenase E2 protein] N6-S-acetyldihydrolipoyl-L-lysine[c]
 +
 
 +
== Genes associated with this reaction  ==
 +
Genes have been associated with this reaction based on different elements listed below.
 +
* Gene: [[Ec-23_002710]]
 +
** Source: [[annotation-esiliculosus_genome]]
 +
*** Assignment: EC-NUMBER
 +
* Gene: [[Ec-18_003420]]
 +
** Source: [[annotation-esiliculosus_genome]]
 +
*** Assignment: EC-NUMBER
 +
== Pathways  ==
 +
== Reconstruction information  ==
 +
* Category: [[annotation]]
 +
** Source: [[annotation-esiliculosus_genome]]
 +
*** Tool: [[pathwaytools]]
 
== External links  ==
 
== External links  ==
* PUBCHEM:
+
* LIGAND-RXN:
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25244964 25244964]
+
** [http://www.genome.jp/dbget-bin/www_bget?R03270 R03270]
* LIGAND-CPD:
+
{{#set: direction=LEFT-TO-RIGHT}}
** [http://www.genome.jp/dbget-bin/www_bget?C08821 C08821]
+
{{#set: common name=2-(α-hydroxyethyl)-TPP:[dihydrolipoyllysine-residue acetyltransferase]-lipoyllysine acetyltransferase}}
* HMDB : HMDB02374
+
{{#set: common name=Transketolase, C-terminal/Pyruvate-ferredoxin oxidoreductase, domain II}}
{{#set: smiles=CC=C(C(C)C)CCC(C)[CH]3(CC[CH]4([CH]2(CC=C1(CC(O)CCC(C)1[CH]2CCC(C)34))))}}
+
{{#set: gene associated=Ec-23_002710|Ec-18_003420}}
{{#set: inchi key=InChIKey=OSELKOCHBMDKEJ-WGMIZEQOSA-N}}
+
{{#set: in pathway=}}
{{#set: common name=isofucosterol}}
+
{{#set: reconstruction category=annotation}}
{{#set: molecular weight=412.698    }}
+
{{#set: reconstruction source=annotation-esiliculosus_genome}}
{{#set: produced by=RXN-4210}}
+
{{#set: reconstruction tool=pathwaytools}}

Latest revision as of 19:44, 21 March 2018

Reaction RXN-12508

  • direction:
    • LEFT-TO-RIGHT
  • common name:
    • 2-(α-hydroxyethyl)-TPP:[dihydrolipoyllysine-residue acetyltransferase]-lipoyllysine acetyltransferase
    • Transketolase, C-terminal/Pyruvate-ferredoxin oxidoreductase, domain II
  • Synonym(s):

Reaction Formula

Genes associated with this reaction

Genes have been associated with this reaction based on different elements listed below.

Pathways

Reconstruction information

External links

"2-(α-hydroxyethyl)-TPP:[dihydrolipoyllysine-residue acetyltransferase]-lipoyllysine acetyltransferase" cannot be used as a page name in this wiki.