Difference between revisions of "N-terminal-specific-UCP-E2-L-cysteine"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=IMIDAZOLE-ACETOL-P IMIDAZOLE-ACETOL-P] == * smiles: ** C1(NC=NC=1CC(COP([O-])(=O)[O-])=O) * inc...")
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=N-terminal-specific-UCP-E2-L-cysteine N-terminal-specific-UCP-E2-L-cysteine] == * common name:...")
 
Line 1: Line 1:
 
[[Category:Metabolite]]
 
[[Category:Metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=IMIDAZOLE-ACETOL-P IMIDAZOLE-ACETOL-P] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=N-terminal-specific-UCP-E2-L-cysteine N-terminal-specific-UCP-E2-L-cysteine] ==
* smiles:
+
** C1(NC=NC=1CC(COP([O-])(=O)[O-])=O)
+
* inchi key:
+
** InChIKey=YCFFMSOLUMRAMD-UHFFFAOYSA-L
+
 
* common name:
 
* common name:
** imidazole acetol-phosphate
+
** an [N-terminal E2 ubiquitin-conjugating enzyme]-L-cysteine
* molecular weight:
+
** 218.105   
+
 
* Synonym(s):
 
* Synonym(s):
** imidazole acetol-P
+
** an [N-terminal ubiquitin-conjugating enzyme E2]-L-cysteine
** 3-(imidazol-4-yl)-2-oxopropyl phosphate
+
  
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[HISTAMINOTRANS-RXN]]
+
* [[RXN-15563]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[IMIDPHOSDEHYD-RXN]]
+
* [[RXN-15564]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
 
== External links  ==
 
== External links  ==
* CAS : 99979-59-6
+
{{#set: common name=an [N-terminal E2 ubiquitin-conjugating enzyme]-L-cysteine}}
* PUBCHEM:
+
{{#set: common name=an [N-terminal ubiquitin-conjugating enzyme E2]-L-cysteine}}
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25244516 25244516]
+
{{#set: consumed by=RXN-15563}}
* HMDB : HMDB12236
+
{{#set: produced by=RXN-15564}}
* LIGAND-CPD:
+
** [http://www.genome.jp/dbget-bin/www_bget?C01267 C01267]
+
* CHEBI:
+
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=57766 57766]
+
* BIGG : 37231
+
{{#set: smiles=C1(NC=NC=1CC(COP([O-])(=O)[O-])=O)}}
+
{{#set: inchi key=InChIKey=YCFFMSOLUMRAMD-UHFFFAOYSA-L}}
+
{{#set: common name=imidazole acetol-phosphate}}
+
{{#set: molecular weight=218.105    }}
+
{{#set: common name=imidazole acetol-P|3-(imidazol-4-yl)-2-oxopropyl phosphate}}
+
{{#set: consumed by=HISTAMINOTRANS-RXN}}
+
{{#set: produced by=IMIDPHOSDEHYD-RXN}}
+

Latest revision as of 19:44, 21 March 2018

Metabolite N-terminal-specific-UCP-E2-L-cysteine

  • common name:
    • an [N-terminal E2 ubiquitin-conjugating enzyme]-L-cysteine
  • Synonym(s):
    • an [N-terminal ubiquitin-conjugating enzyme E2]-L-cysteine

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"an [N-terminal E2 ubiquitin-conjugating enzyme]-L-cysteine" cannot be used as a page name in this wiki.
"an [N-terminal ubiquitin-conjugating enzyme E2]-L-cysteine" cannot be used as a page name in this wiki.