Difference between revisions of "PppGp-his-tRNAs"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=3-OXOPIMELOYL-COA 3-OXOPIMELOYL-COA] == * smiles: ** CC(C)(C(O)C(=O)NCCC(=O)NCCSC(CC(CCCC([O-])...")
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=pppGp-his-tRNAs pppGp-his-tRNAs] == * common name: ** pppGp-tRNAHis * Synonym(s): == Reaction(...")
 
Line 1: Line 1:
 
[[Category:Metabolite]]
 
[[Category:Metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=3-OXOPIMELOYL-COA 3-OXOPIMELOYL-COA] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=pppGp-his-tRNAs pppGp-his-tRNAs] ==
* smiles:
+
** CC(C)(C(O)C(=O)NCCC(=O)NCCSC(CC(CCCC([O-])=O)=O)=O)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]
+
* inchi key:
+
** InChIKey=KJXFOFKTZDJLMQ-UYRKPTJQSA-I
+
 
* common name:
 
* common name:
** 3-oxopimeloyl-CoA
+
** pppGp-tRNAHis
* molecular weight:
+
** 918.632   
+
 
* Synonym(s):
 
* Synonym(s):
** 3-oxopimelyl-CoA
 
** 3-ketopimeloyl-CoA
 
** 3-ketopimelyl-CoA
 
  
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
* [[RXN-8032]]
+
* [[RXN-12502]]
 +
* [[RXN-12504]]
 
== External links  ==
 
== External links  ==
* PUBCHEM:
+
{{#set: common name=pppGp-tRNAHis}}
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=45266579 45266579]
+
{{#set: reversible reaction associated=RXN-12502|RXN-12504}}
* CHEBI:
+
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=57350 57350]
+
* LIGAND-CPD:
+
** [http://www.genome.jp/dbget-bin/www_bget?C06715 C06715]
+
* HMDB : HMDB12158
+
{{#set: smiles=CC(C)(C(O)C(=O)NCCC(=O)NCCSC(CC(CCCC([O-])=O)=O)=O)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]}}
+
{{#set: inchi key=InChIKey=KJXFOFKTZDJLMQ-UYRKPTJQSA-I}}
+
{{#set: common name=3-oxopimeloyl-CoA}}
+
{{#set: molecular weight=918.632    }}
+
{{#set: common name=3-oxopimelyl-CoA|3-ketopimeloyl-CoA|3-ketopimelyl-CoA}}
+
{{#set: reversible reaction associated=RXN-8032}}
+

Latest revision as of 19:44, 21 March 2018

Metabolite pppGp-his-tRNAs

  • common name:
    • pppGp-tRNAHis
  • Synonym(s):

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links