Difference between revisions of "Ec-15 000530"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=PORPHOBILINOGEN PORPHOBILINOGEN] == * smiles: ** C(C1(=C(C(=CN1)CCC(=O)[O-])CC(=O)[O-]))[N+] *...") |
(Created page with "Category:Gene == Gene Ec-15_000530 == * Synonym(s): ** Esi_0012_0087 ** Esi0012_0087 ** Centrin == Reactions associated == * Reaction: RXN-8443 ** Source: orthology...") |
||
(2 intermediate revisions by the same user not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Gene]] |
− | == | + | == Gene Ec-15_000530 == |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
* Synonym(s): | * Synonym(s): | ||
+ | ** Esi_0012_0087 | ||
+ | ** Esi0012_0087 | ||
+ | ** Centrin | ||
− | == | + | == Reactions associated == |
− | * [[ | + | * Reaction: [[RXN-8443]] |
− | + | ** Source: [[orthology-aragem]] | |
− | * [[ | + | == Pathways associated == |
− | == | + | * [[PWY-5381]] |
== External links == | == External links == | ||
− | + | {{#set: common name=Esi_0012_0087|Esi0012_0087|Centrin}} | |
− | + | {{#set: reaction associated=RXN-8443}} | |
− | + | {{#set: pathway associated=PWY-5381}} | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | {{#set: common name= | + | |
− | {{#set: | + | |
− | + | ||
− | {{#set: | + |
Latest revision as of 19:16, 21 March 2018
Gene Ec-15_000530
- Synonym(s):
- Esi_0012_0087
- Esi0012_0087
- Centrin
Reactions associated
- Reaction: RXN-8443
- Source: orthology-aragem