Difference between revisions of "CPD-16618"
From metabolic_network
(Created page with "Category:Gene == Gene Ec-21_004100 == * left end position: ** 5063794 * transcription direction: ** POSITIVE * right end position: ** 5072147 * centisome position: ** 68.6...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-16618 CPD-16618] == * smiles: ** C(C(=O)[O-])C(O)[CH]=O * inchi key: ** InChIKey=QWHDXIUUXW...") |
||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:Metabolite]] |
| − | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-16618 CPD-16618] == |
| − | * | + | * smiles: |
| − | ** | + | ** C(C(=O)[O-])C(O)[CH]=O |
| − | * | + | * inchi key: |
| − | ** | + | ** InChIKey=QWHDXIUUXWGQME-GSVOUGTGSA-M |
| − | * | + | * common name: |
| − | ** | + | ** L-malic semialdehyde |
| − | * | + | * molecular weight: |
| − | ** | + | ** 117.081 |
* Synonym(s): | * Synonym(s): | ||
| − | ** | + | ** (3R)-3-hydroxy-4-oxobutanoate |
| − | + | ||
| − | == | + | == Reaction(s) known to consume the compound == |
| − | * | + | * [[RXN-6002]] |
| − | + | == Reaction(s) known to produce the compound == | |
| − | + | == Reaction(s) of unknown directionality == | |
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | == | + | |
| − | + | ||
| − | + | ||
== External links == | == External links == | ||
| − | {{#set: | + | * PUBCHEM: |
| − | {{#set: | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=90658049 90658049] |
| − | {{#set: | + | {{#set: smiles=C(C(=O)[O-])C(O)[CH]=O}} |
| − | {{#set: | + | {{#set: inchi key=InChIKey=QWHDXIUUXWGQME-GSVOUGTGSA-M}} |
| − | {{#set: common name= | + | {{#set: common name=L-malic semialdehyde}} |
| − | + | {{#set: molecular weight=117.081 }} | |
| − | {{#set: | + | {{#set: common name=(3R)-3-hydroxy-4-oxobutanoate}} |
| + | {{#set: consumed by=RXN-6002}} | ||
Latest revision as of 19:45, 21 March 2018
Contents
Metabolite CPD-16618
- smiles:
- C(C(=O)[O-])C(O)[CH]=O
- inchi key:
- InChIKey=QWHDXIUUXWGQME-GSVOUGTGSA-M
- common name:
- L-malic semialdehyde
- molecular weight:
- 117.081
- Synonym(s):
- (3R)-3-hydroxy-4-oxobutanoate
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
- PUBCHEM:
"C(C(=O)[O-])C(O)[CH]=O" cannot be used as a page name in this wiki.
