Difference between revisions of "CPD-18761"
From metabolic_network
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=DXS-RXN DXS-RXN] == * direction: ** LEFT-TO-RIGHT * common name: ** Transketolase, C-terminal/Pyruv...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-18761 CPD-18761] == * smiles: ** COC1(=CC(=CCCO)C=CC(=O)1) * inchi key: ** InChIKey=ORAJWSY...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Metabolite]] |
− | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-18761 CPD-18761] == |
− | * | + | * smiles: |
− | ** | + | ** COC1(=CC(=CCCO)C=CC(=O)1) |
+ | * inchi key: | ||
+ | ** InChIKey=ORAJWSYKRGVTDP-UHFFFAOYSA-N | ||
* common name: | * common name: | ||
− | ** | + | ** coniferyl alcohol radical |
− | * | + | * molecular weight: |
− | ** | + | ** 179.195 |
* Synonym(s): | * Synonym(s): | ||
− | == Reaction | + | == Reaction(s) known to consume the compound == |
− | + | == Reaction(s) known to produce the compound == | |
− | + | * [[RXN-17352]] | |
− | + | == Reaction(s) of unknown directionality == | |
− | + | ||
− | + | ||
− | = | + | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | == | + | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | * [[ | + | |
− | + | ||
− | == | + | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
== External links == | == External links == | ||
− | + | {{#set: smiles=COC1(=CC(=CCCO)C=CC(=O)1)}} | |
− | + | {{#set: inchi key=InChIKey=ORAJWSYKRGVTDP-UHFFFAOYSA-N}} | |
− | + | {{#set: common name=coniferyl alcohol radical}} | |
− | + | {{#set: molecular weight=179.195 }} | |
− | {{#set: | + | {{#set: produced by=RXN-17352}} |
− | + | ||
− | + | ||
− | {{#set: | + | |
− | + | ||
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + |
Latest revision as of 20:46, 21 March 2018
Contents
Metabolite CPD-18761
- smiles:
- COC1(=CC(=CCCO)C=CC(=O)1)
- inchi key:
- InChIKey=ORAJWSYKRGVTDP-UHFFFAOYSA-N
- common name:
- coniferyl alcohol radical
- molecular weight:
- 179.195
- Synonym(s):