Difference between revisions of "CPD-18761"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=DXS-RXN DXS-RXN] == * direction: ** LEFT-TO-RIGHT * common name: ** Transketolase, C-terminal/Pyruv...")
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-18761 CPD-18761] == * smiles: ** COC1(=CC(=CCCO)C=CC(=O)1) * inchi key: ** InChIKey=ORAJWSY...")
 
Line 1: Line 1:
−
[[Category:Reaction]]
+
[[Category:Metabolite]]
−
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=DXS-RXN DXS-RXN] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-18761 CPD-18761] ==
−
* direction:
+
* smiles:
−
** LEFT-TO-RIGHT
+
** COC1(=CC(=CCCO)C=CC(=O)1)
 +
* inchi key:
 +
** InChIKey=ORAJWSYKRGVTDP-UHFFFAOYSA-N
 
* common name:
 
* common name:
−
** Transketolase, C-terminal/Pyruvate-ferredoxin oxidoreductase, domain II
+
** coniferyl alcohol radical
−
* ec number:
+
* molecular weight:
−
** [http://enzyme.expasy.org/EC/2.2.1.7 EC-2.2.1.7]
+
** 179.195   
 
* Synonym(s):
 
* Synonym(s):
  
−
== Reaction Formula ==
+
== Reaction(s) known to consume the compound ==
−
* With identifiers:
+
== Reaction(s) known to produce the compound ==
−
** 1 [[GAP]][c] '''+''' 1 [[PYRUVATE]][c] '''+''' 1 [[PROTON]][c] '''=>''' 1 [[DEOXYXYLULOSE-5P]][c] '''+''' 1 [[CARBON-DIOXIDE]][c]
+
* [[RXN-17352]]
−
* With common name(s):
+
== Reaction(s) of unknown directionality ==
−
** 1 D-glyceraldehyde 3-phosphate[c] '''+''' 1 pyruvate[c] '''+''' 1 H+[c] '''=>''' 1 1-deoxy-D-xylulose 5-phosphate[c] '''+''' 1 CO2[c]
+
−
 
+
−
== Genes associated with this reaction  ==
+
−
Genes have been associated with this reaction based on different elements listed below.
+
−
* Gene: [[Ec-15_004230]]
+
−
** Source: [[annotation-esiliculosus_genome]]
+
−
*** Assignment: EC-NUMBER
+
−
** Source: [[orthology-aragem]]
+
−
== Pathways  ==
+
−
* [[NONMEVIPP-PWY]], methylerythritol phosphate pathway I: [http://metacyc.org/META/NEW-IMAGE?object=NONMEVIPP-PWY NONMEVIPP-PWY]
+
−
** '''8''' reactions found over '''9''' reactions in the full pathway
+
−
* [[PWY-6891]], thiazole biosynthesis II (aerobic bacteria): [http://metacyc.org/META/NEW-IMAGE?object=PWY-6891 PWY-6891]
+
−
** '''2''' reactions found over '''7''' reactions in the full pathway
+
−
* [[PYRIDOXSYN-PWY]], pyridoxal 5'-phosphate biosynthesis I: [http://metacyc.org/META/NEW-IMAGE?object=PYRIDOXSYN-PWY PYRIDOXSYN-PWY]
+
−
** '''3''' reactions found over '''8''' reactions in the full pathway
+
−
* [[PWY-6892]], thiazole biosynthesis I (facultative anaerobic bacteria): [http://metacyc.org/META/NEW-IMAGE?object=PWY-6892 PWY-6892]
+
−
** '''3''' reactions found over '''7''' reactions in the full pathway
+
−
* [[PWY-7560]], methylerythritol phosphate pathway II: [http://metacyc.org/META/NEW-IMAGE?object=PWY-7560 PWY-7560]
+
−
** '''9''' reactions found over '''9''' reactions in the full pathway
+
−
== Reconstruction information  ==
+
−
* Category: [[orthology]]
+
−
** Source: [[orthology-aragem]]
+
−
*** Tool: [[pantograph]]
+
−
* Category: [[annotation]]
+
−
** Source: [[annotation-esiliculosus_genome]]
+
−
*** Tool: [[pathwaytools]]
+
 
== External links  ==
 
== External links  ==
−
* RHEA:
+
{{#set: smiles=COC1(=CC(=CCCO)C=CC(=O)1)}}
−
** [http://www.ebi.ac.uk/rhea/reaction.xhtml?id=12605 12605]
+
{{#set: inchi key=InChIKey=ORAJWSYKRGVTDP-UHFFFAOYSA-N}}
−
* LIGAND-RXN:
+
{{#set: common name=coniferyl alcohol radical}}
−
** [http://www.genome.jp/dbget-bin/www_bget?R05636 R05636]
+
{{#set: molecular weight=179.195    }}
−
{{#set: direction=LEFT-TO-RIGHT}}
+
{{#set: produced by=RXN-17352}}
−
{{#set: common name=Transketolase, C-terminal/Pyruvate-ferredoxin oxidoreductase, domain II}}
+
−
{{#set: ec number=EC-2.2.1.7}}
+
−
{{#set: gene associated=Ec-15_004230}}
+
−
{{#set: in pathway=NONMEVIPP-PWY|PWY-6891|PYRIDOXSYN-PWY|PWY-6892|PWY-7560}}
+
−
{{#set: reconstruction category=orthology|annotation}}
+
−
{{#set: reconstruction source=annotation-esiliculosus_genome|orthology-aragem}}
+
−
{{#set: reconstruction tool=pantograph|pathwaytools}}
+

Latest revision as of 19:46, 21 March 2018

Metabolite CPD-18761

  • smiles:
    • COC1(=CC(=CCCO)C=CC(=O)1)
  • inchi key:
    • InChIKey=ORAJWSYKRGVTDP-UHFFFAOYSA-N
  • common name:
    • coniferyl alcohol radical
  • molecular weight:
    • 179.195
  • Synonym(s):

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

Retrieved from "http://gem-aureme.irisa.fr/ectogem/index.php?title=CPD-18761&oldid=29185"