Difference between revisions of "RXN0-6491"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-10488 CPD-10488] == * smiles: ** C(=O)NC1(C(C(=O)CC([N+])C(=O)[O-])=CC=CC=1) * inchi key: *...") |
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN0-6491 RXN0-6491] == * direction: ** LEFT-TO-RIGHT * common name: ** dihydroorotate dehydrogenas...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Reaction]] |
− | == | + | == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN0-6491 RXN0-6491] == |
− | * | + | * direction: |
− | ** | + | ** LEFT-TO-RIGHT |
− | + | ||
− | + | ||
* common name: | * common name: | ||
− | ** | + | ** dihydroorotate dehydrogenase |
− | * | + | * ec number: |
− | ** | + | ** [http://enzyme.expasy.org/EC/1.3.5.2 EC-1.3.5.2] |
* Synonym(s): | * Synonym(s): | ||
− | == Reaction(s) | + | == Reaction Formula == |
− | == | + | * With identifiers: |
− | * [[ | + | ** 1 [[DI-H-OROTATE]][c] '''+''' 1 [[Ubiquinones]][c] '''=>''' 1 [[Ubiquinols]][c] '''+''' 1 [[OROTATE]][c] |
− | == | + | * With common name(s): |
+ | ** 1 (S)-dihydroorotate[c] '''+''' 1 a ubiquinone[c] '''=>''' 1 an ubiquinol[c] '''+''' 1 orotate[c] | ||
+ | |||
+ | == Genes associated with this reaction == | ||
+ | Genes have been associated with this reaction based on different elements listed below. | ||
+ | * Gene: [[Ec-27_005670]] | ||
+ | ** Source: [[annotation-esiliculosus_genome]] | ||
+ | *** Assignment: GO-TERM | ||
+ | == Pathways == | ||
+ | * [[PWY-5686]], UMP biosynthesis: [http://metacyc.org/META/NEW-IMAGE?object=PWY-5686 PWY-5686] | ||
+ | ** '''6''' reactions found over '''6''' reactions in the full pathway | ||
+ | == Reconstruction information == | ||
+ | * Category: [[annotation]] | ||
+ | ** Source: [[annotation-esiliculosus_genome]] | ||
+ | *** Tool: [[pathwaytools]] | ||
== External links == | == External links == | ||
− | * | + | * RHEA: |
− | + | ** [http://www.ebi.ac.uk/rhea/reaction.xhtml?id=28690 28690] | |
− | + | {{#set: direction=LEFT-TO-RIGHT}} | |
− | ** [http://www.ebi.ac.uk/ | + | {{#set: common name=dihydroorotate dehydrogenase}} |
− | + | {{#set: ec number=EC-1.3.5.2}} | |
− | + | {{#set: gene associated=Ec-27_005670}} | |
− | + | {{#set: in pathway=PWY-5686}} | |
− | {{#set: | + | {{#set: reconstruction category=annotation}} |
− | {{#set: | + | {{#set: reconstruction source=annotation-esiliculosus_genome}} |
− | {{#set: | + | {{#set: reconstruction tool=pathwaytools}} |
− | {{#set: | + | |
− | {{#set: | + |
Latest revision as of 20:47, 21 March 2018
Contents
Reaction RXN0-6491
- direction:
- LEFT-TO-RIGHT
- common name:
- dihydroorotate dehydrogenase
- ec number:
- Synonym(s):
Reaction Formula
- With identifiers:
- 1 DI-H-OROTATE[c] + 1 Ubiquinones[c] => 1 Ubiquinols[c] + 1 OROTATE[c]
- With common name(s):
- 1 (S)-dihydroorotate[c] + 1 a ubiquinone[c] => 1 an ubiquinol[c] + 1 orotate[c]
Genes associated with this reaction
Genes have been associated with this reaction based on different elements listed below.
- Gene: Ec-27_005670
- Source: annotation-esiliculosus_genome
- Assignment: GO-TERM
- Source: annotation-esiliculosus_genome
Pathways
Reconstruction information
- Category: annotation
- Source: annotation-esiliculosus_genome
- Tool: pathwaytools
- Source: annotation-esiliculosus_genome
External links
- RHEA: