Difference between revisions of "CPD-308"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=5-P-BETA-D-RIBOSYL-AMINE 5-P-BETA-D-RIBOSYL-AMINE] == * smiles: ** C(OP([O-])(=O)[O-])C1(C(O)C(...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-308 CPD-308] == * smiles: ** C([O-])(=O)CCC([N+]C(C(=O)[O-])CCCNC(N)=[N+])C([O-])=O * inchi...") |
||
| Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
| − | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-308 CPD-308] == |
* smiles: | * smiles: | ||
| − | ** C | + | ** C([O-])(=O)CCC([N+]C(C(=O)[O-])CCCNC(N)=[N+])C([O-])=O |
* inchi key: | * inchi key: | ||
| − | ** InChIKey= | + | ** InChIKey=LMKYZBGVKHTLTN-NKWVEPMBSA-M |
* common name: | * common name: | ||
| − | ** | + | ** D-nopaline |
* molecular weight: | * molecular weight: | ||
| − | ** | + | ** 303.294 |
* Synonym(s): | * Synonym(s): | ||
| − | ** | + | ** N2-(D-1,3-dicarboxypropyl)-L-arginine |
| − | + | ||
| − | + | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| + | * [[1.5.1.19-RXN]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | |||
== External links == | == External links == | ||
| − | |||
* PUBCHEM: | * PUBCHEM: | ||
| − | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid= | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=49791983 49791983] |
| − | + | ||
| − | + | ||
| − | + | ||
* CHEBI: | * CHEBI: | ||
| − | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId= | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=58074 58074] |
| − | * | + | * LIGAND-CPD: |
| − | {{#set: smiles=C | + | ** [http://www.genome.jp/dbget-bin/www_bget?C01682 C01682] |
| − | {{#set: inchi key=InChIKey= | + | {{#set: smiles=C([O-])(=O)CCC([N+]C(C(=O)[O-])CCCNC(N)=[N+])C([O-])=O}} |
| − | {{#set: common name= | + | {{#set: inchi key=InChIKey=LMKYZBGVKHTLTN-NKWVEPMBSA-M}} |
| − | {{#set: molecular weight= | + | {{#set: common name=D-nopaline}} |
| − | {{#set: common name= | + | {{#set: molecular weight=303.294 }} |
| − | {{#set: | + | {{#set: common name=N2-(D-1,3-dicarboxypropyl)-L-arginine}} |
| − | + | {{#set: produced by=1.5.1.19-RXN}} | |
Latest revision as of 19:47, 21 March 2018
Contents
Metabolite CPD-308
- smiles:
- C([O-])(=O)CCC([N+]C(C(=O)[O-])CCCNC(N)=[N+])C([O-])=O
- inchi key:
- InChIKey=LMKYZBGVKHTLTN-NKWVEPMBSA-M
- common name:
- D-nopaline
- molecular weight:
- 303.294
- Synonym(s):
- N2-(D-1,3-dicarboxypropyl)-L-arginine
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"C([O-])(=O)CCC([N+]C(C(=O)[O-])CCCNC(N)=[N+])C([O-])=O" cannot be used as a page name in this wiki.
