Difference between revisions of "CDP-CHOLINE"
From metabolic_network
(Created page with "Category:Gene == Gene Ec-23_003460 == * left end position: ** 3706742 * transcription direction: ** POSITIVE * right end position: ** 3715455 * centisome position: ** 76.5...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CDP-CHOLINE CDP-CHOLINE] == * smiles: ** C[N+](C)(C)CCOP([O-])(=O)OP([O-])(=O)OCC1(OC(C(O)C(O)1...") |
||
(2 intermediate revisions by the same user not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Metabolite]] |
− | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CDP-CHOLINE CDP-CHOLINE] == |
− | * | + | * smiles: |
− | ** | + | ** C[N+](C)(C)CCOP([O-])(=O)OP([O-])(=O)OCC1(OC(C(O)C(O)1)N2(C=CC(=NC2=O)N)) |
− | * | + | * inchi key: |
− | ** | + | ** InChIKey=RZZPDXZPRHQOCG-OJAKKHQRSA-M |
− | * | + | * common name: |
− | ** | + | ** CDP-choline |
− | * | + | * molecular weight: |
− | ** | + | ** 487.319 |
* Synonym(s): | * Synonym(s): | ||
− | ** | + | ** citicoline |
− | ** | + | ** citicholine |
− | ** | + | ** cidifos |
+ | ** cyticholine | ||
+ | ** cytidine 5'-diphosphocholine | ||
+ | ** cytidine diphosphate choline | ||
− | == | + | == Reaction(s) known to consume the compound == |
− | * [[ | + | == Reaction(s) known to produce the compound == |
− | + | * [[2.7.7.15-RXN]] | |
− | + | == Reaction(s) of unknown directionality == | |
− | + | * [[RXN-5781]] | |
− | == | + | |
− | * [[ | + | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
== External links == | == External links == | ||
− | {{#set: | + | * CAS : 987-78-0 |
− | {{#set: | + | * PUBCHEM: |
− | {{#set: | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25202509 25202509] |
− | {{#set: | + | * CHEBI: |
− | {{#set: common name= | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=58779 58779] |
− | {{#set: | + | * LIGAND-CPD: |
− | {{#set: | + | ** [http://www.genome.jp/dbget-bin/www_bget?C00307 C00307] |
+ | * HMDB : HMDB01413 | ||
+ | {{#set: smiles=C[N+](C)(C)CCOP([O-])(=O)OP([O-])(=O)OCC1(OC(C(O)C(O)1)N2(C=CC(=NC2=O)N))}} | ||
+ | {{#set: inchi key=InChIKey=RZZPDXZPRHQOCG-OJAKKHQRSA-M}} | ||
+ | {{#set: common name=CDP-choline}} | ||
+ | {{#set: molecular weight=487.319 }} | ||
+ | {{#set: common name=citicoline|citicholine|cidifos|cyticholine|cytidine 5'-diphosphocholine|cytidine diphosphate choline}} | ||
+ | {{#set: produced by=2.7.7.15-RXN}} | ||
+ | {{#set: reversible reaction associated=RXN-5781}} |
Latest revision as of 19:17, 21 March 2018
Contents
Metabolite CDP-CHOLINE
- smiles:
- C[N+](C)(C)CCOP([O-])(=O)OP([O-])(=O)OCC1(OC(C(O)C(O)1)N2(C=CC(=NC2=O)N))
- inchi key:
- InChIKey=RZZPDXZPRHQOCG-OJAKKHQRSA-M
- common name:
- CDP-choline
- molecular weight:
- 487.319
- Synonym(s):
- citicoline
- citicholine
- cidifos
- cyticholine
- cytidine 5'-diphosphocholine
- cytidine diphosphate choline
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"C[N+](C)(C)CCOP([O-])(=O)OP([O-])(=O)OCC1(OC(C(O)C(O)1)N2(C=CC(=NC2=O)N))" cannot be used as a page name in this wiki.