Difference between revisions of "HOMO-SER"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=EPOXYSQUALENE EPOXYSQUALENE] == * smiles: ** CC(C)=CCCC(C)=CCCC(C)=CCCC=C(C)CCC=C(C)CC[CH]1(C(C...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=HOMO-SER HOMO-SER] == * smiles: ** C(CO)C([N+])C([O-])=O * inchi key: ** InChIKey=UKAUYVFTDYCKQ...") |
||
| (2 intermediate revisions by the same user not shown) | |||
| Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
| − | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=HOMO-SER HOMO-SER] == |
* smiles: | * smiles: | ||
| − | ** | + | ** C(CO)C([N+])C([O-])=O |
* inchi key: | * inchi key: | ||
| − | ** InChIKey= | + | ** InChIKey=UKAUYVFTDYCKQA-VKHMYHEASA-N |
* common name: | * common name: | ||
| − | ** | + | ** L-homoserine |
* molecular weight: | * molecular weight: | ||
| − | ** | + | ** 119.12 |
* Synonym(s): | * Synonym(s): | ||
| − | ** | + | ** homo-ser |
| − | ** | + | ** homoserine |
| − | ** | + | ** 2-amino-4-hydroxybutanoic acid |
| − | + | ** 2-amino-4-hydroxybutanoate | |
| − | + | ||
| − | + | ||
| − | ** 2 | + | |
| − | + | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[ | + | * [[HOMOSERDEAM-RXN]] |
| + | * [[HOMOSERKIN-RXN]] | ||
| + | * [[HOMSUCTRAN-RXN]] | ||
| + | * [[RXN-14049]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[ | + | * [[HOMOSERDEHYDROG-RXN]] |
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| + | * [[CYSTATHIONASE-RXN]] | ||
== External links == | == External links == | ||
| − | * CAS : | + | * CAS : 672-15-1 |
| + | * BIGG : 34437 | ||
* PUBCHEM: | * PUBCHEM: | ||
| − | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid= | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=6971022 6971022] |
| − | * HMDB : | + | * HMDB : HMDB00719 |
* LIGAND-CPD: | * LIGAND-CPD: | ||
| − | ** [http://www.genome.jp/dbget-bin/www_bget? | + | ** [http://www.genome.jp/dbget-bin/www_bget?C00263 C00263] |
| − | + | ||
| − | + | ||
* CHEBI: | * CHEBI: | ||
| − | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId= | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=57476 57476] |
| − | * METABOLIGHTS : | + | * METABOLIGHTS : MTBLC57476 |
| − | {{#set: smiles= | + | {{#set: smiles=C(CO)C([N+])C([O-])=O}} |
| − | {{#set: inchi key=InChIKey= | + | {{#set: inchi key=InChIKey=UKAUYVFTDYCKQA-VKHMYHEASA-N}} |
| − | {{#set: common name= | + | {{#set: common name=L-homoserine}} |
| − | {{#set: molecular weight= | + | {{#set: molecular weight=119.12 }} |
| − | {{#set: common name= | + | {{#set: common name=homo-ser|homoserine|2-amino-4-hydroxybutanoic acid|2-amino-4-hydroxybutanoate}} |
| − | {{#set: consumed by= | + | {{#set: consumed by=HOMOSERDEAM-RXN|HOMOSERKIN-RXN|HOMSUCTRAN-RXN|RXN-14049}} |
| − | {{#set: produced by= | + | {{#set: produced by=HOMOSERDEHYDROG-RXN}} |
| + | {{#set: reversible reaction associated=CYSTATHIONASE-RXN}} | ||
Latest revision as of 19:17, 21 March 2018
Contents
Metabolite HOMO-SER
- smiles:
- C(CO)C([N+])C([O-])=O
- inchi key:
- InChIKey=UKAUYVFTDYCKQA-VKHMYHEASA-N
- common name:
- L-homoserine
- molecular weight:
- 119.12
- Synonym(s):
- homo-ser
- homoserine
- 2-amino-4-hydroxybutanoic acid
- 2-amino-4-hydroxybutanoate
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
- CAS : 672-15-1
- BIGG : 34437
- PUBCHEM:
- HMDB : HMDB00719
- LIGAND-CPD:
- CHEBI:
- METABOLIGHTS : MTBLC57476
"C(CO)C([N+])C([O-])=O" cannot be used as a page name in this wiki.
