Difference between revisions of "SINAPATE"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Gene == Gene Ec-20_003150 == * left end position: ** 3278669 * transcription direction: ** NEGATIVE * right end position: ** 3287112 * centisome position: ** 63.5...")
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=SINAPATE SINAPATE] == * smiles: ** COC1(C=C(C=C(OC)C(O)=1)C=CC([O-])=O) * inchi key: ** InChIKe...")
 
Line 1: Line 1:
−
[[Category:Gene]]
+
[[Category:Metabolite]]
−
== Gene Ec-20_003150 ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=SINAPATE SINAPATE] ==
−
* left end position:
+
* smiles:
−
** 3278669
+
** COC1(C=C(C=C(OC)C(O)=1)C=CC([O-])=O)
−
* transcription direction:
+
* inchi key:
−
** NEGATIVE
+
** InChIKey=PCMORTLOPMLEFB-ONEGZZNKSA-M
−
* right end position:
+
* common name:
−
** 3287112
+
** sinapate
−
* centisome position:
+
* molecular weight:
−
** 63.584198    
+
** 223.205    
 
* Synonym(s):
 
* Synonym(s):
−
** Esi_0123_0030
+
** 3,5-dimethoxy-4-hydroxycinnamate
−
** Esi0123_0030
+
** sinapinate
 +
** sinapinic acid
 +
** sinapic acid
 +
** 3,5-dimethoxy-4-hydroxycinnamic acid
 +
** 4-hydroxy-3,5-dimethoxycinnamate
  
−
== Reactions associated ==
+
== Reaction(s) known to consume the compound ==
−
* Reaction: [[ENOYL-COA-DELTA-ISOM-RXN]]
+
* [[RXN-10919]]
−
** Source: [[annotation-esiliculosus_genome]]
+
== Reaction(s) known to produce the compound ==
−
*** Assignment: automated-name-match
+
* [[RXN-3422]]
−
== Pathways associated ==
+
== Reaction(s) of unknown directionality ==
−
* [[PWY-5137]]
+
−
* [[FAO-PWY]]
+
 
== External links  ==
 
== External links  ==
−
{{#set: left end position=3278669}}
+
* NCI:
−
{{#set: transcription direction=NEGATIVE}}
+
** [http://cactus.nci.nih.gov/ncidb2.2/?nsc=59261 59261]
−
{{#set: right end position=3287112}}
+
* CAS : 530-59-6
−
{{#set: centisome position=63.584198   }}
+
* PUBCHEM:
−
{{#set: common name=Esi_0123_0030|Esi0123_0030}}
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=54710960 54710960]
−
{{#set: reaction associated=ENOYL-COA-DELTA-ISOM-RXN}}
+
* HMDB : HMDB32616
−
{{#set: pathway associated=PWY-5137|FAO-PWY}}
+
* LIGAND-CPD:
 +
** [http://www.genome.jp/dbget-bin/www_bget?C00482 C00482]
 +
* CHEMSPIDER:
 +
** [http://www.chemspider.com/Chemical-Structure.4573878.html 4573878]
 +
* CHEBI:
 +
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=30023 30023]
 +
{{#set: smiles=COC1(C=C(C=C(OC)C(O)=1)C=CC([O-])=O)}}
 +
{{#set: inchi key=InChIKey=PCMORTLOPMLEFB-ONEGZZNKSA-M}}
 +
{{#set: common name=sinapate}}
 +
{{#set: molecular weight=223.205   }}
 +
{{#set: common name=3,5-dimethoxy-4-hydroxycinnamate|sinapinate|sinapinic acid|sinapic acid|3,5-dimethoxy-4-hydroxycinnamic acid|4-hydroxy-3,5-dimethoxycinnamate}}
 +
{{#set: consumed by=RXN-10919}}
 +
{{#set: produced by=RXN-3422}}

Latest revision as of 19:48, 21 March 2018

Metabolite SINAPATE

  • smiles:
    • COC1(C=C(C=C(OC)C(O)=1)C=CC([O-])=O)
  • inchi key:
    • InChIKey=PCMORTLOPMLEFB-ONEGZZNKSA-M
  • common name:
    • sinapate
  • molecular weight:
    • 223.205
  • Synonym(s):
    • 3,5-dimethoxy-4-hydroxycinnamate
    • sinapinate
    • sinapinic acid
    • sinapic acid
    • 3,5-dimethoxy-4-hydroxycinnamic acid
    • 4-hydroxy-3,5-dimethoxycinnamate

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"COC1(C=C(C=C(OC)C(O)=1)C=CC([O-])=O)" cannot be used as a page name in this wiki.




Retrieved from "http://gem-aureme.irisa.fr/ectogem/index.php?title=SINAPATE&oldid=29441"