Difference between revisions of "Ec-07 002870"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-11715 CPD-11715] == * smiles: ** C(=O)(NCC(=O)[O-])CC1(C=CC=CC=1) * inchi key: ** InChIKey=...") |
(Created page with "Category:Gene == Gene Ec-07_002870 == * left end position: ** 3080445 * transcription direction: ** POSITIVE * right end position: ** 3083396 * centisome position: ** 39.8...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Gene]] |
− | == | + | == Gene Ec-07_002870 == |
− | * | + | * left end position: |
− | ** | + | ** 3080445 |
− | * | + | * transcription direction: |
− | ** | + | ** POSITIVE |
− | * | + | * right end position: |
− | ** | + | ** 3083396 |
− | * | + | * centisome position: |
− | ** | + | ** 39.88958 |
* Synonym(s): | * Synonym(s): | ||
− | ** | + | ** Esi_0261_0032 |
− | ** | + | ** Esi0261_0032 |
− | ** | + | ** SDH4 |
− | + | ||
− | + | ||
− | + | ||
− | == | + | == Reactions associated == |
− | + | * Reaction: [[RXN-14971]] | |
− | * [[RXN- | + | ** Source: [[annotation-esiliculosus_genome]] |
− | == | + | *** Assignment: ec-number |
+ | * Reaction: [[RXN-15378]] | ||
+ | ** Source: [[annotation-esiliculosus_genome]] | ||
+ | *** Assignment: ec-number | ||
+ | * Reaction: [[SUCCINATE-DEHYDROGENASE-UBIQUINONE-RXN]] | ||
+ | ** Source: [[annotation-esiliculosus_genome]] | ||
+ | *** Assignment: ec-number | ||
+ | == Pathways associated == | ||
+ | * [[PWY-561]] | ||
+ | * [[PWY0-1353]] | ||
+ | * [[PWY-3781]] | ||
+ | * [[PWY66-398]] | ||
+ | * [[PWY-7279]] | ||
+ | * [[P105-PWY]] | ||
+ | * [[PWY-6969]] | ||
+ | * [[PWY-6728]] | ||
+ | * [[PWY0-1329]] | ||
+ | * [[PWY-7254]] | ||
+ | * [[TCA]] | ||
+ | * [[PWY-4302]] | ||
+ | * [[PWY-5690]] | ||
== External links == | == External links == | ||
− | + | {{#set: left end position=3080445}} | |
− | + | {{#set: transcription direction=POSITIVE}} | |
− | + | {{#set: right end position=3083396}} | |
− | + | {{#set: centisome position=39.88958 }} | |
− | + | {{#set: common name=Esi_0261_0032|Esi0261_0032|SDH4}} | |
− | + | {{#set: reaction associated=RXN-14971|RXN-15378|SUCCINATE-DEHYDROGENASE-UBIQUINONE-RXN}} | |
− | {{#set: | + | {{#set: pathway associated=PWY-561|PWY0-1353|PWY-3781|PWY66-398|PWY-7279|P105-PWY|PWY-6969|PWY-6728|PWY0-1329|PWY-7254|TCA|PWY-4302|PWY-5690}} |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: common name= | + | |
− | {{#set: | + |
Latest revision as of 20:49, 21 March 2018
Gene Ec-07_002870
- left end position:
- 3080445
- transcription direction:
- POSITIVE
- right end position:
- 3083396
- centisome position:
- 39.88958
- Synonym(s):
- Esi_0261_0032
- Esi0261_0032
- SDH4
Reactions associated
- Reaction: RXN-14971
- Source: annotation-esiliculosus_genome
- Assignment: ec-number
- Source: annotation-esiliculosus_genome
- Reaction: RXN-15378
- Source: annotation-esiliculosus_genome
- Assignment: ec-number
- Source: annotation-esiliculosus_genome
- Reaction: SUCCINATE-DEHYDROGENASE-UBIQUINONE-RXN
- Source: annotation-esiliculosus_genome
- Assignment: ec-number
- Source: annotation-esiliculosus_genome
Pathways associated
- PWY-561
- PWY0-1353
- PWY-3781
- PWY66-398
- PWY-7279
- P105-PWY
- PWY-6969
- PWY-6728
- PWY0-1329
- PWY-7254
- TCA
- PWY-4302
- PWY-5690